{ "Protein (biolink:Protein)": { "Chemokine receptor-7 (CCR7)": { "id": "UMLS:C0672987", "name": "Receptors, CCR7" }, "Nerve growth factor": { "id": "UMLS:C0027752", "name": "nerve growth factor" }, "Cytokine": { "id": "UMLS:C0079189", "name": "cytokine" }, "\u03bc opioid receptor": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "\u03b4 opioid receptor": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "\u03ba opioid receptor": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Chemokines": { "id": "UMLS:C0751959", "name": "CX3C Chemokines" }, "Cytokines": { "id": "UMLS:C5161707", "name": "Cytokines | XXX | Chemistry - non-challenge" }, "Aggrecan": { "id": "PR:000003606", "name": "aggrecan core protein" }, "Toll-like receptor 2": { "id": "PR:000001096", "name": "Toll-like receptor" }, "CCL2": { "id": "UMLS:C1452296", "name": "Ccl2 protein, rat" }, "Protein gene product 9.5 (PGP9.5)": { "id": "UMLS:C3641723", "name": "PARP1 Gene Product" }, "Pattern Recognition Receptors": { "id": "UMLS:C1564907", "name": "Receptors, Pattern Recognition" }, "pERK": { "id": "UMLS:C0762890", "name": "PERK kinase" }, "pp38": { "id": "UniProtKB:Q77MR0", "name": "PP38_GAHVM Phosphoprotein pp38 (sprot)" }, "TLR4": { "id": "UMLS:C2744265", "name": "TLR4 decoy" }, "MyD88": { "id": "UniProtKB:Q5XJ85", "name": "MYD88_DANRE Myeloid differentiation primary response protein MyD88 (sprot)" }, "IL-6": { "id": "UMLS:C1448616", "name": "IL-6-PE40 protein, chimeric" }, "Wnt3a": { "id": "UMLS:C0148810", "name": "Wnt3A Protein" }, "Wnt10a": { "id": "UMLS:C1429875", "name": "Wnt10a protein, zebrafish" }, "\u03b2-Catenin": { "id": "UMLS:C0105770", "name": "beta catenin" }, "rAxin2": { "id": "UniProtKB:O70240", "name": "AXIN2_RAT Axin-2 (sprot)" }, "Neurotrophin": { "id": "PR:000021998", "name": "neurotrophin" }, "Growth factors": { "id": "UMLS:C0018284", "name": "Growth Factor" }, "Neuropeptides": { "id": "UMLS:C0027895", "name": "Neuropeptides" }, "Ion channel": { "id": "UMLS:C0022009", "name": "Ion Channel" }, "Ion channels": { "id": "UMLS:C0022009", "name": "Ion Channel" }, "G protein-coupled receptors (GPCRs)": { "id": "UMLS:C0682972", "name": "G-Protein-Coupled Receptors" }, "Pruritogen receptor": { "id": "UMLS:C0597357", "name": "receptor" }, "Human Cytochrome P450s": { "id": "UMLS:C0965027", "name": "CYP2S1 protein, human" }, "Hemoglobin": { "id": "UMLS:C0019046", "name": "Hemoglobin" }, "Diacylglycerol lipase-beta (DAGL\u03b2)": { "id": "PR:000006269", "name": "diacylglycerol lipase-beta" }, "Monoacylglycerol Lipase (MAGL)": { "id": "PR:000003576", "name": "monoacylglycerol lipase ABHD2" }, "Monocyte Chemoattractant Protein-1 (MCP-1, CCL2)": { "id": "UMLS:C0128897", "name": "Monocyte Chemoattractant Protein-1" }, "Phospho-p38 MAPK": { "id": "UMLS:C1120843", "name": "mitogen-activated protein kinase p38" }, "Protease activated receptor 2 (PAR2)": { "id": "UMLS:C0259628", "name": "Receptor, PAR-2" }, "Serine proteases": { "id": "UMLS:C0036720", "name": "serine" }, "Calcitonin Gene-Related Peptide (CGRP)": { "id": "UMLS:C0006669", "name": "Calcitonin Gene-Related Peptide" }, "Interleukin-6": { "id": "PR:000001393", "name": "interleukin-6" }, "BDNF": { "id": "UMLS:C5196595", "name": "Bdnf protein, mouse" }, "Opioid receptors": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Endogenous opioid": { "id": "UMLS:C0205753", "name": "Opioid Peptide" }, "\u00b5-opioid receptor (MOR)": { "id": "PR:000001612", "name": "mu-type opioid receptor" }, "Calcitonin gene-related peptide (CGRP)": { "id": "UMLS:C0006669", "name": "Calcitonin Gene-Related Peptide" }, "Acid-sensing ion channels (ASICs)": { "id": "UMLS:C3503750", "name": "Acid Sensing Ion Channels" }, "Delta-opioid receptor (DOR)": { "id": "UMLS:C0140057", "name": "Receptors, Opioid, delta" }, "5-HT2A receptor (5-HT2AR)": { "id": "UMLS:C0289174", "name": "Receptor, Serotonin, 5-HT2A" }, "5-HT2C receptor (5-HT2CR)": { "id": "UMLS:C0528200", "name": "Receptor, Serotonin, 5-HT2C" }, "Protease-activated receptor 2 (PAR2)": { "id": "UMLS:C0259628", "name": "Receptor, PAR-2" }, "Mas-related GPCR family (Mrg)": { "id": "PR:000001607", "name": "Mas-related G-protein coupled receptor MRG" }, "Protease Activated Receptor Type 3 (PAR3)": { "id": "UMLS:C0537642", "name": "protease-activated receptor 3" }, "PAR2": { "id": "UMLS:C2000133", "name": "PAR2 protein, Arabidopsis" }, "PAR1": { "id": "UMLS:C2000132", "name": "PAR1 protein, Arabidopsis" }, "PAR4": { "id": "UniProtKB:Q920E0", "name": "PAR4_RAT Proteinase-activated receptor 4 (sprot)" }, "Peptide": { "id": "UniProtKB:A0A6B9HCL2", "name": "A0A6B9HCL2_9BURK Lasso peptide peptide A (trembl)" }, "Luciferase reporter": { "id": "UMLS:C0024075", "name": "Luciferases" }, "TRPV1+ nociceptors": { "id": "UMLS:C1564816", "name": "TRPV1 receptor" }, "Cannabinoid receptor type 1 (CB 1)": { "id": "PR:000001125", "name": "cannabinoid receptor 1" }, "TRPV1": { "id": "UMLS:C1564816", "name": "TRPV1 receptor" }, "Type III Collagen": { "id": "UMLS:C0009332", "name": "Collagen Type III" }, "Type IV Collagen": { "id": "UMLS:C0009333", "name": "Collagen Type IV" }, "PRO-C3": { "id": "UMLS:C0071997", "name": "complement C3 precursor" }, "C4M": { "id": "UniProtKB:C4M7C1", "name": "C4M7C1_ENTH1 Palmitoyltransferase (trembl)" }, "Proteoglycan": { "id": "UMLS:C0033692", "name": "Proteoglycan" }, "STAT3": { "id": "UMLS:C0253050", "name": "Stat3 protein" }, "CREB": { "id": "UMLS:C0256079", "name": "CREB-binding protein" }, "Nerve growth factor (NGF)": { "id": "UMLS:C0027752", "name": "nerve growth factor" }, "Inflammatory proteins": { "id": "UMLS:C0376579", "name": "Macrophage Inflammatory Proteins" }, "IL-18": { "id": "UMLS:C0666963", "name": "interleukin-18 receptor" }, "Brain \u03bc-opioid receptor (MOR)": { "id": "PR:000001612", "name": "mu-type opioid receptor" }, "Plasma IL-18": { "id": "UMLS:C0032120", "name": "Plasma Proteins" }, "Tetanus toxoid (TT)": { "id": "UMLS:C0305062", "name": "tetanus toxoid vaccine, inactivated" }, "dmLT": { "id": null, "name": null }, "LTA1": { "id": "UniProtKB:Q9M7Z1", "name": "ODB2_ARATH Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial (sprot)" }, "Anti-fentanyl serum antibodies": { "id": "UMLS:C0003242", "name": "Antibodies, Anti-Idiotypic" }, "Carrier protein": { "id": "PR:000015203", "name": "protein SLC7A6OS" }, "Anti-FEN IgA": { "id": "UMLS:C5565219", "name": "IgA anti-tissue transglutaminase autoantibodies" }, "Tetanus Toxoid": { "id": "UMLS:C0305062", "name": "tetanus toxoid vaccine, inactivated" }, "ELISA": { "id": null, "name": null }, "Chimeric monoclonal antibodies (mAb)": { "id": "UMLS:C3542957", "name": "Monoclonal antibodies, antineoplastic" }, "Apolipoprotein A-I binding protein (AIBP)": { "id": "PR:000004141", "name": "apolipoprotein A-I-binding protein" }, "Toll-like receptor-4 (TLR4)": { "id": "UMLS:C1411976", "name": "toll-like receptor 4" }, "Spinal AMPA receptor Ca2+": { "id": "UMLS:C0072899", "name": "AMPA Receptors" }, "Calcium permeable (CP) \u03b1-amino-3-hydroxy-5-methyl-4-isoxazole propionic acid receptors (AMPARs)": { "id": "UMLS:C1528634", "name": "alpha-amino-3-hydroxy-5-methylisoxazole-4-propionic acid subtype glutamate receptor, human" }, "C-fiber stimulus-evoked, AMPAR-mediated EPSCs": { "id": "UMLS:C5551443", "name": "Anti-AMPAR antibody" }, "AMPAR-evoked Ca2+ transients": { "id": "UMLS:C5551443", "name": "Anti-AMPAR antibody" }, "mu opioid receptor constitutive activity (MORCA)": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "CP-AMPARs": { "id": "UMLS:C0651405", "name": "CP 82218" }, "Transient receptor potential ankyrin subtype 1 (TRPA1)": { "id": "UniProtKB:A0A8F9SJ94", "name": "A0A8F9SJ94_PROCL Transient receptor potential ankyrin subtype 1 (trembl)" }, "Adenylyl cyclase type 1 (AC1)": { "id": "UMLS:C0540404", "name": "adenylyl cyclase 1" }, "Exchange protein directly activated by cyclic adenosine monophosphate (Epac)": { "id": "UniProtKB:A0A164SC44", "name": "A0A164SC44_9CRUS Exchange protein directly activated by cAMP (trembl)" }, "Glyoxalase 1": { "id": "UniProtKB:A0A812CMJ1", "name": "A0A812CMJ1_SEPPH Glyoxalase domain-containing protein 4,Glyoxalase 1 (trembl)" }, "Vascular endothelial growth factor receptor-2": { "id": "UMLS:C0378796", "name": "Vascular Endothelial Growth Factor Receptor-2" }, "Notch1": { "id": "UMLS:C1504822", "name": "Notch1 protein, mouse" }, "Toll-like receptor (TLR)4": { "id": "PR:000001096", "name": "Toll-like receptor" }, "GluA1": { "id": "UniProtKB:P07728", "name": "GLUA1_ORYSJ Glutelin type-A 1 (sprot)" }, "GluA2": { "id": "UMLS:C4045247", "name": "Tat-GluA2(3Y) peptide" }, "GluA1/GluA2 ratio": { "id": "UMLS:C4045247", "name": "Tat-GluA2(3Y) peptide" }, "Gpr160": { "id": "UMLS:C5543974", "name": "Gpr160 protein, rat" }, "Cocaine- and amphetamine-regulated transcript peptide (CARTp)": { "id": "PR:000005046", "name": "cocaine- and amphetamine-regulated transcript protein" }, "ERK": { "id": "UMLS:C5771958", "name": "ERK-IN-3" }, "cAMP response element-binding protein (CREB)": { "id": "UniProtKB:A2Q4V1", "name": "A2Q4V1_MEDTR cAMP response element binding (CREB) protein (trembl)" }, "CGRP receptor": { "id": "UniProtKB:H7BY40", "name": "H7BY40_HUMAN CGRP receptor component (trembl)" }, "Histone H3 lysine 9": { "id": "UMLS:C3829684", "name": "Histone H3 Lysine 9" }, "Toll-like receptor 7 (TLR7)": { "id": "UMLS:C1579758", "name": "Toll-Like Receptor 7" }, "NF-\u03baB": { "id": "UMLS:C0664956", "name": "NF 6505" }, "p65": { "id": "UMLS:C1437259", "name": "p65 oncofetal mRNA transport protein, rat" }, "Extracellular signal-regulated kinase \u00bd (p-ERK1/2)": { "id": "UMLS:C0600388", "name": "Extracellular Signal Regulated Kinases" }, "Glial fibrillary acidic protein (GFAP)": { "id": "PR:000007939", "name": "glial fibrillary acidic protein" }, "Transforming growth factor-\u03b2": { "id": "UMLS:C0040691", "name": "Transforming Growth Factors" }, "CGRP": { "id": "UMLS:C0002251", "name": "alpha-CGRP" }, "P2X3R": { "id": null, "name": null }, "Transient receptor potential channels": { "id": "UMLS:C1563722", "name": "Transient Receptor Potential Channels" }, "Cholinergic receptors": { "id": "UMLS:C0034792", "name": "Cholinergic Receptors" }, "Potassium channels": { "id": "UMLS:C0032824", "name": "Potassium Channel" }, "Sodium channels": { "id": "UMLS:C0037492", "name": "Sodium Channel" }, "Cyclin-dependent kinase 5 (Cdk5)": { "id": "UMLS:C0249586", "name": "Cyclin-Dependent Kinase 5" }, "p35": { "id": "UMLS:C0908502", "name": "p35 histone" }, "p39": { "id": "UMLS:C0769114", "name": "p39 protein, Brucella" }, "Transient receptor potential cation channel": { "id": "PR:000000679", "name": "transient receptor potential cation channel TRPA" }, "Voltage-gated calcium channel": { "id": "UMLS:C0814022", "name": "voltage-gated calcium channel (VGCC)" }, "Synaptophysin": { "id": "PR:000015890", "name": "synaptophysin" }, "Collapsin response mediator protein 2": { "id": "UMLS:C0300791", "name": "collapsin response mediator protein-2" }, "Purinergic": { "id": "UMLS:C0914622", "name": "purinergic P2X8 receptor" }, "Neuropeptide Y (NPY)": { "id": "UMLS:C0027893", "name": "neuropeptide Y" }, "Neuropeptide Y1 receptor (Y1)": { "id": "UMLS:C0384842", "name": "neuropeptide Y-Y1 receptor" }, "Legumain (Lgmn)": { "id": "PR:000009780", "name": "legumain" }, "Protease-Activated Receptor-2 (PAR2)": { "id": "UMLS:C0259628", "name": "Receptor, PAR-2" }, "Adenylyl cyclase": { "id": "UniProtKB:A0A0U5HZT6", "name": "A0A0U5HZT6_9PROT Putative Adenylyl cyclase (Adenylyl cyclase class-3/4/guanylyl cyclase,166-326) (trembl)" }, "Protein kinase A (PKA)": { "id": "UMLS:C5441746", "name": "Protein Kinase A, human" }, "\u00b5-opioid receptors (MOPrs)": { "id": "UMLS:C0034801", "name": "Opioid Receptor" }, "Endosomes": { "id": "UniProtKB:A0A5C3FVI3", "name": "A0A5C3FVI3_PSEA2 Related to SNX41 - sorting nexin, mediate distinct retrieval pathways from endosomes (trembl)" }, "IL-10": { "id": "UMLS:C0912462", "name": "IL-10-related T cell-derived inducible factor, IL-TIF" }, "Transcription factors": { "id": "UMLS:C0040648", "name": "TRANSCRIPTION FACTOR" }, "Transient Receptor Potential (TRP) Ion Channels": { "id": "UMLS:C1563722", "name": "Transient Receptor Potential Channels" }, "TRPA1": { "id": "UMLS:C4505180", "name": "TRPA1 Cation Channel" }, "TRPV4": { "id": "UMLS:C1452147", "name": "Trpv4 protein, rat" }, "TRPM8": { "id": "UMLS:C1452521", "name": "Trpm8 protein, rat" }, "Neurokinin 1 receptor (NK1R)": { "id": "UMLS:C0531978", "name": "neurokinin receptor 4" }, "\u03b2-arrestin": { "id": "UMLS:C0379339", "name": "beta-arrestin 1" }, "Interleukin 6 (IL-6)": { "id": "UMLS:C0063717", "name": "Interleukin 6 Receptor" }, "IgM": { "id": "UMLS:C5168913", "name": "IgM IgM | Serum or Plasma | Chemistry - non-challenge" }, "Anti-IL-6 antibodies": { "id": "UMLS:C0003242", "name": "Antibodies, Anti-Idiotypic" }, "Parathyroid hormone": { "id": "UMLS:C0030520", "name": "parathyroid hormone" }, "PTH type 1 receptor": { "id": "UMLS:C0529330", "name": "Receptor, Angiotensin, Type 1" }, "Nrf2": { "id": "UniProtKB:A0A2H4G8G8", "name": "A0A2H4G8G8_HELAM Nrf2 (trembl)" }, "M\u03a6-colony stimulating factor (M-CSF)": { "id": "UMLS:C0079784", "name": "Macrophage Colony-Stimulating Factor" }, "Transient receptor potential ankyrin 1 (TRPA1)": { "id": "UniProtKB:W8VTH6", "name": "W8VTH6_CHICK Transient receptor potential ankyrin 1 (trembl)" }, "Schwann cell TRPA1": { "id": "UMLS:C1430697", "name": "SMP protein, Schwann cell, Coturnix coturnix" }, "\u00b5-opioid receptor (MOPr)": { "id": "UMLS:C0034801", "name": "Opioid Receptor" }, "\u03b2-arrestins": { "id": "UMLS:C0376570", "name": "Arrestins" }, "Monocyte chemokine CCL2": { "id": "UMLS:C0128897", "name": "Monocyte Chemoattractant Protein-1" }, "ApoA-I binding protein (AIBP)": { "id": "UniProtKB:U5KLT9", "name": "U5KLT9_EPIAK ApoA-I (trembl)" }, "FTO": { "id": "UMLS:C2002654", "name": "FTO protein, mouse" }, "Toll-Like Receptor 4": { "id": "PR:000001096", "name": "Toll-like receptor" }, "YTHDF2": { "id": "UMLS:C4079011", "name": "YTHDF2 protein, mouse" }, "Coll IV": { "id": "UniProtKB:A0A3Q8BXM5", "name": "A0A3Q8BXM5_BAMOL COLL (trembl)" }, "Mitochondrial calcium uniporter": { "id": "UMLS:C0054487", "name": "mitochondrial calcium uniporter" }, "Mitochondrial fission proteins": { "id": "PR:000010366", "name": "mitochondrial fission factor" }, "Calcitonin": { "id": "UMLS:C0006668", "name": "calcitonin" }, "Calcitonin receptor-like receptors": { "id": "UMLS:C0054455", "name": "Calcitonin Receptor" }, "Adrenomedullin": { "id": "UMLS:C0215825", "name": "adrenomedullin" }, "Adrenomedullin 2": { "id": "UMLS:C0215825", "name": "adrenomedullin" }, "\u03b2CGRP": { "id": null, "name": null }, "\u03b1CGRP": { "id": null, "name": null }, "m-CTR": { "id": "UniProtKB:A0A199VS20", "name": "A0A199VS20_ANACO Protein CTR (trembl)" }, "m-RAMP3": { "id": "UniProtKB:A0A212CL08", "name": "A0A212CL08_CEREH RAMP3 (trembl)" }, "m-CLR": { "id": "UniProtKB:G4WMY3", "name": "G4WMY3_MOUSE Clr-G (trembl)" }, "Protein Kinase A (PKA)": { "id": "UMLS:C5441746", "name": "Protein Kinase A, human" }, "Kappa Opioid Receptors (KOR)": { "id": "UMLS:C0064239", "name": "Receptors, Opioid, kappa" }, "NMDA receptor (NMDAR)": { "id": "UMLS:C5565201", "name": "anti-NMDA receptor autoantibody" }, "Adenylyl cyclase-1 (AC1)": { "id": "UMLS:C1175840", "name": "adenylyl cyclase 7" }, "Exchange proteins directly activated by cyclic AMP (Epacs)": { "id": "UniProtKB:A0A164SC44", "name": "A0A164SC44_9CRUS Exchange protein directly activated by cAMP (trembl)" }, "Cathepsin S": { "id": "UMLS:C0054874", "name": "cathepsin S" }, "Cystatin C": { "id": "PR:000005965", "name": "cystatin-C" }, "CRISPR/Cas9": { "id": "UMLS:C4704710", "name": "CRISPR-Associated Protein 9" }, "AP2\u03b12": { "id": null, "name": null }, "Norepinephrine receptors": { "id": "UMLS:C0068979", "name": "Norepinephrine Receptors" }, "Transient Receptor Potential Channels (TRP)": { "id": "UMLS:C1563722", "name": "Transient Receptor Potential Channels" }, "Botulinum Neurotoxins (BoNTs)": { "id": "UMLS:C0006055", "name": "Botulinum Toxins" }, "Transient receptor potential cation channel subfamily C member 4 (TRPC4)": { "id": "UMLS:C3494496", "name": "transient receptor potential cation channel, subfamily C, member 1" }, "N-type voltage-gated calcium (Cav2.2)": { "id": "UMLS:C1317827", "name": "Voltage-gated calcium channel N type binding Ab" }, "Nav1.7 voltage-gated sodium channels": { "id": "UMLS:C3503759", "name": "NAV1.7 Voltage-Gated Sodium Channel" }, "CLR/RAMP1": { "id": "UniProtKB:G4WMY3", "name": "G4WMY3_MOUSE Clr-G (trembl)" }, "Nociceptor TRPA1": { "id": "UMLS:C4505180", "name": "TRPA1 Cation Channel" }, "\u03b4-opioid receptor (DOPr)": { "id": "UMLS:C0034801", "name": "Opioid Receptor" }, "\u00b5-opioid receptors (MOPr)": { "id": "UMLS:C0034801", "name": "Opioid Receptor" }, "Protein kinase C": { "id": "UMLS:C0033634", "name": "Protein Kinase C" }, "IL-13": { "id": "UMLS:C1101015", "name": "IL-13 receptor alpha2-Fc fusion protein, Canis familiaris" }, "OT receptors": { "id": "PR:000012100", "name": "oxytocin-neurophysin 1" }, "5-HT2A receptors": { "id": "UMLS:C0289174", "name": "Receptor, Serotonin, 5-HT2A" }, "FK506-binding protein 51 (FKBP51)": { "id": "UniProtKB:Q9GK72", "name": "Q9GK72_LEMCA FK506-binding immunophilin FKBP51 (Fragment) (trembl)" }, "AMY1 receptor": { "id": "UMLS:C2001751", "name": "Amy1 protein, mouse" }, "CTR": { "id": "UniProtKB:Q03560", "name": "CTR9_CAEEL RNA polymerase-associated protein CTR9 (sprot)" }, "Spinal CCK1 Receptors": { "id": "UMLS:C0663842", "name": "CCK1 protein, Chlamydomonas moewusii" }, "Cholecystokinin (CCK)": { "id": "PR:000005110", "name": "cholecystokinin" }, "Interleukin-18 (IL-18)": { "id": "PR:000001376", "name": "interleukin-18" }, "IL-18 Receptors (IL-18R)": { "id": "UMLS:C0666963", "name": "interleukin-18 receptor" }, "IL-18R": { "id": "PR:000001377", "name": "interleukin-18 receptor 1" }, "Tumor necrosis factor alpha": { "id": "PR:000000134", "name": "tumor necrosis factor" }, "\u03b2-adrenergic 1 and 2 receptors": { "id": "UMLS:C0001638", "name": "Receptors, Adrenergic, alpha-1" }, "\u03b2-AR2": { "id": "UniProtKB:Q9YNX0", "name": "Q9YNX0_9GEMI AR2 (trembl)" }, "RNA-interacting protein FUS": { "id": "UniProtKB:P56959", "name": "FUS_MOUSE RNA-binding protein FUS (sprot)" }, "Calcitonin peptide family": { "id": "UMLS:C0006669", "name": "Calcitonin Gene-Related Peptide" }, "Amylin": { "id": "UMLS:C0063684", "name": "Amylin" }, "CGRP-responsive receptor": { "id": "UniProtKB:H7BY40", "name": "H7BY40_HUMAN CGRP receptor component (trembl)" }, "CGRP isoforms": { "id": "UMLS:C0002251", "name": "alpha-CGRP" }, "NGF": { "id": "UMLS:C0763527", "name": "NGF-like protease" }, "\u03bc-opioid receptor (MOR)": { "id": "PR:000001612", "name": "mu-type opioid receptor" }, "Luciferase": { "id": "UMLS:C0024075", "name": "Luciferases" }, "\u03bc-Opioid Receptor": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Opioid Receptor Antagonists": { "id": "UMLS:C0034801", "name": "Opioid Receptor" }, "Opioid receptor": { "id": "UMLS:C0034801", "name": "Opioid Receptor" }, "\u00b5-Opioid Receptor": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Adrenergic receptor": { "id": "UMLS:C0034783", "name": "Adrenergic Receptor" }, "G-protein-biased \u03bc-opioid agonists": { "id": "UMLS:C0205753", "name": "Opioid Peptide" }, "mu opioid receptor": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Opioid Receptors": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Mu opioid receptors (MOR-1)": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Mouse mu opioid receptors (mMOR-1)": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Mu-opioid receptor": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Mu opioid receptor (MOR)": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Soluble epoxide hydrolase (sEH)": { "id": "UniProtKB:A0A1B8GGM9", "name": "A0A1B8GGM9_9PEZI Epoxide hydrolase, soluble (SEH) (trembl)" }, "Mu Opioid Receptor (MOR-1)": { "id": "PR:000001612", "name": "mu-type opioid receptor" }, "G protein": { "id": "UMLS:C0086870", "name": "Protein Phosphatase G" }, "\u03b2-arrestin2": { "id": "UniProtKB:A0A3R7T195", "name": "A0A3R7T195_PENVA Arrestin2 (trembl)" }, "MOR-1O": { "id": "UniProtKB:Q716A7", "name": "Q716A7_HUMAN Mu opioid receptor MOR-1O (Fragment) (trembl)" }, "MOR-1": { "id": "UMLS:C4043330", "name": "MOR-103" }, "Opioid Receptor": { "id": "UMLS:C0034801", "name": "Opioid Receptor" }, "Serotonin (5-HT)1A Receptor Agonists": { "id": "UMLS:C0295352", "name": "Serotonin 5-HT-3 Receptor" }, "\u03bc-\u03b4 Opioid Receptor Heteromer": { "id": "UMLS:C0034801", "name": "Opioid Receptor" }, "Carrier proteins": { "id": "UMLS:C0007292", "name": "Carrier Proteins" }, "Glucagon-like peptide-1 receptor (GLP-1R)": { "id": "UMLS:C0378073", "name": "Glucagon-Like Peptide-1 Receptor" }, "Exendin-4 (Ex-4)": { "id": "UMLS:C0167116", "name": "exendin receptor" }, "Orexin 1 receptor (OX1)": { "id": "UMLS:C3887946", "name": "Orexin A Receptor" }, "Cytochrome P450": { "id": "UMLS:C0010762", "name": "Cytochrome P450" }, "Kappa opioid receptor (KOR)": { "id": "UMLS:C0064239", "name": "Receptors, Opioid, kappa" }, "Mu Opioid Receptor (MOR)": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "\u00b5 opioid receptor (MOR)": { "id": "PR:000001612", "name": "mu-type opioid receptor" }, "\u03bc-opioid receptor": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "\u03b2-arrestin 2": { "id": "UMLS:C0287638", "name": "beta-arrestin 2" }, "Antibodies": { "id": "UMLS:C0003241", "name": "Antibodies" }, "Serotonin Receptors (5-HTRs)": { "id": "UMLS:C0036757", "name": "Receptors, Serotonin, 5-HT2" }, "5-HT1ARs and 5-HT2BRs": { "id": "PR:000008748", "name": "phospholipase A and acyltransferase 5" }, "5-HT1ARs": { "id": "UMLS:C0048783", "name": "5',5',5'-trifluoroleucine" }, "5-HT2BRs": { "id": "UMLS:C0048783", "name": "5',5',5'-trifluoroleucine" }, "Mu Opioid Receptor": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "7 transmembrane (TM) C-terminal variants": { "id": "UMLS:C1257634", "name": "seven-transmembrane G-protein-coupled receptor" }, "6TM variants": { "id": "UniProtKB:A0A8H7M5Y4", "name": "A0A8H7M5Y4_9AGAM Putative ER transporter, 6TM, N-terminal (trembl)" }, "Single TM variants": { "id": "UniProtKB:A0A5K1VK93", "name": "A0A5K1VK93_ENTHI Single tm domain protein (trembl)" }, "OPRM1 splice variants": { "id": "UMLS:C1720834", "name": "Splice Variants, Protein" }, "Nociceptin opioid peptide receptor (NOP)": { "id": "UniProtKB:A0A8C0QCE6", "name": "A0A8C0QCE6_CANLF Opioid related nociceptin receptor 1 (trembl)" }, "Antibody": { "id": "UMLS:C1566673", "name": "Antibody Fragments" }, "Serotonin (5-HT) 5-HT1ARs": { "id": "UMLS:C0295352", "name": "Serotonin 5-HT-3 Receptor" }, "Serotonin (5-HT) 5-HT2BRs": { "id": "UMLS:C0295352", "name": "Serotonin 5-HT-3 Receptor" }, "5-HT G protein-coupled receptors (GPCRs)": { "id": "UMLS:C0034838", "name": "serotonin receptor" }, "Diphtheria toxin (CRM)": { "id": "UMLS:C0012550", "name": "Diphtheria Toxin" }, "Keyhole limpet hemocyanin (KLH)": { "id": "UMLS:C0064332", "name": "keyhole-limpet hemocyanin" }, "IgG": { "id": "UMLS:C0063351", "name": "IGG-horseradish peroxidase" }, "5-HT2A Receptor": { "id": "UMLS:C0289174", "name": "Receptor, Serotonin, 5-HT2A" }, "Opioid receptor antagonist naloxone": { "id": "UMLS:C0068383", "name": "naloxone receptor" }, "Glucagon-like peptide-1 receptor": { "id": "UMLS:C0378073", "name": "Glucagon-Like Peptide-1 Receptor" }, "Glucagon-like peptide-1 (GLP-1)": { "id": "UMLS:C0061355", "name": "Glucagon-Like Peptide 1" }, "\u03bc-Opioid Receptor (MOR)": { "id": "PR:000001612", "name": "mu-type opioid receptor" }, "RGS4": { "id": "UMLS:C0388278", "name": "RGS4 protein" }, "RGS9-2": { "id": "UMLS:C1567919", "name": "RGS9-2 protein, mouse" }, "G-protein": { "id": "UMLS:C0682972", "name": "G-Protein-Coupled Receptors" }, "\u00b5-opioid": { "id": "UMLS:C0205753", "name": "Opioid Peptide" }, "Liver microsomes and Hepatocytes": { "id": "UMLS:C4739345", "name": "Liver cancer antibodies & Alpha-1-Fetoprotein" }, "CYP3A4": { "id": "UMLS:C0914565", "name": "Cyp3a41a protein, mouse" }, "CYP2D6": { "id": "UMLS:C5773029", "name": "CYP2D6 protein, human" }, "GLP-1": { "id": "UMLS:C1448599", "name": "Glp-1 protein, C elegans" }, "\u00b5-Opioid receptors (MORs)": { "id": "UMLS:C0034801", "name": "Opioid Receptor" }, "Adrenergic-\u03b1 2 receptors (A\u03b1 2Rs)": { "id": "UMLS:C0001639", "name": "Receptors, Adrenergic, alpha-2" }, "Leptin": { "id": "PR:000009758", "name": "leptin" }, "High-sensitivity C-reactive protein (hsCRP)": { "id": "UMLS:C0006560", "name": "C-reactive protein" }, "Extracellular microRNAs (miRNAs)": { "id": "UMLS:C0079323", "name": "Extracellular Matrix Proteins" }, "miR-128-3p, miR-30c-5p, miR-421": { "id": "UMLS:C5391318", "name": "MIRN463-3p microRNA, mouse" }, "let-7d-5p, miR-584-5p": { "id": "UMLS:C5433577", "name": "MIRN3184-5p microRNA, human" }, "let-7b-5p, miR-10-5p": { "id": "UMLS:C5433577", "name": "MIRN3184-5p microRNA, human" }, "Endogenous neurotransmitter/receptor": { "id": "UMLS:C0205921", "name": "Endogenous Substances Receptors" }, "Mu opioid receptor": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "T-type calcium channels": { "id": "UMLS:C0752118", "name": "T-Type Calcium Channels" }, "CaV3.2 channels": { "id": "UMLS:C1721429", "name": "Cacna1h protein, rat" }, "Proteins that regulate the trafficking or transcription": { "id": "UniProtKB:C4R928", "name": "C4R928_KOMPG Protein that interacts with silencing proteins at the telomere (trembl)" }, "T-type Calcium Channel": { "id": "UMLS:C0752118", "name": "T-Type Calcium Channels" }, "RAP-103": { "id": "UMLS:C3491989", "name": "RAP-103" }, "Nociceptor-specific voltage-gated sodium ion channels": { "id": "UMLS:C3494197", "name": "Voltage-Gated Sodium Channels" }, "Nav1.7": { "id": "UMLS:C3503759", "name": "NAV1.7 Voltage-Gated Sodium Channel" }, "Nav1.8": { "id": "UMLS:C3494341", "name": "NAV1.8 Voltage-Gated Sodium Channel" }, "Bone morphogenetic proteins (BMPs)": { "id": "UMLS:C0053932", "name": "Bone Morphogenetic Proteins" }, "Voltage-gated calcium channels": { "id": "UMLS:C0814023", "name": "Voltage-Gated Potassium Channel" }, "Analgesic targets": { "id": "UniProtKB:A0A6G5VBU0", "name": "A0A6G5VBU0_HEMLE Analgesic peptide (trembl)" }, "Ryanodine receptors (RyRs)": { "id": "UMLS:C0917729", "name": "Ryanodine Receptors" }, "Hyperpolarization-activated cyclic nucleotide-gated (HCN) channels": { "id": "UMLS:C1956068", "name": "Hyperpolarization-Activated Cyclic Nucleotide-Gated Channels" }, "Voltage-gated K+ channels": { "id": "UMLS:C0814023", "name": "Voltage-Gated Potassium Channel" }, "P2 X4R Single-Chain Fragment Variable Antibody": { "id": "UniProtKB:A0A1E1GJG6", "name": "A0A1E1GJG6_MOUSE Single-chain variable (trembl)" }, "P2X4R receptor": { "id": "UMLS:C4742900", "name": "P2X4R protein, human" }, "scFvs": { "id": "UMLS:C4055461", "name": "Anti-CD20 B9E9 scFv-Streptavidin Fusion Protein" }, "Anti-P2X4R scFv clones (95, 12)": { "id": "UMLS:C0760608", "name": "anti-quadruplex DNA scFv" }, "MRGPRX1": { "id": "UniProtKB:B2RWR5", "name": "B2RWR5_MOUSE Mrgprx1 protein (trembl)" }, "Nociceptin": { "id": "PR:000012940", "name": "nociceptin" }, "Proinflammatory Cytokine": { "id": "UMLS:C0079189", "name": "cytokine" }, "Neuronal PAS domain protein 2 (NPAS2)": { "id": "UMLS:C1447522", "name": "NPAS2 protein, human" }, "Caspase-3": { "id": "PR:000002312", "name": "caspase-3" } }, "Disease (biolink:Disease)": { "Osteoarthritis (OA)": { "id": "MONDO:0005178", "name": "osteoarthritis" }, "Osteophytosis": { "id": "UMLS:C0037942", "name": "Spinal Osteophytosis" }, "Osteoarthritis": { "id": "MONDO:0005178", "name": "osteoarthritis" }, "Synovitis": { "id": "MONDO:0002400", "name": "synovitis" }, "CINP": { "id": null, "name": null }, "Chemotherapy-induced peripheral neuropathy": { "id": "UMLS:C3873567", "name": "Peripheral neuropathy due to and following antineoplastic therapy" }, "Neuropathic pain": { "id": "UMLS:C1963916", "name": "Diabetic peripheral neuropathic pain" }, "Chronic pain": { "id": "UMLS:C0744939", "name": "hip pain chronic" }, "Peripheral painful neuropathy": { "id": "MONDO:0009752", "name": "neuropathy, painful" }, "Type 2 diabetes mellitus (T2DM)": { "id": "MONDO:0005148", "name": "type 2 diabetes mellitus" }, "Diabetic peripheral neuropathy (DPN)": { "id": "UMLS:C0740447", "name": "Diabetic peripheral neuropathy" }, "Obesity": { "id": "MONDO:0011122", "name": "obesity disorder" }, "Trauma": { "id": "UMLS:C3714660", "name": "Trauma" }, "Substance use": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Suicide": { "id": "UMLS:C0038663", "name": "Suicide attempt" }, "Depression": { "id": "UMLS:C0221745", "name": "Depression suicidal" }, "Historical trauma": { "id": "UMLS:C5197707", "name": "Historical Trauma" }, "Externalizing and internalizing behavior": { "id": "UMLS:C0278075", "name": "Behavior problem of childhood and adolescence" }, "Opioid misuse": { "id": "UMLS:C5392920", "name": "Opioid Misuse" }, "Suicide attempts": { "id": "UMLS:C0038663", "name": "Suicide attempt" }, "Opioid use disorders (OUDs)": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Irritability": { "id": "UMLS:C1405432", "name": "irritability; sympathetic" }, "Memory Loss": { "id": "UMLS:C0860628", "name": "Loss of memory ability" }, "Joint Pain": { "id": "UMLS:C0587242", "name": "Pain associated with prosthesis of knee joint" }, "Sleep Disturbance": { "id": "UMLS:C0852566", "name": "Disturbances in sleep phase rhythm" }, "Mood Disturbance": { "id": "UMLS:C2939186", "name": "Disturbance in mood" }, "Anxiety": { "id": "MONDO:0011918", "name": "anxiety" }, "Mood disorders": { "id": "UMLS:C0086640", "name": "Psychotic Mood Disorders" }, "Alcohol or substance abuse disorders": { "id": "UMLS:C5570673", "name": "Alcohol or substance abuse disorder" }, "Arthritis": { "id": "UMLS:C0741233", "name": "arthritis reiter" }, "Persistent pain": { "id": "UMLS:C0494408", "name": "Persistent somatoform pain disorder" }, "Tissue damage": { "id": "UMLS:C0010957", "name": "Tissue damage" }, "Cocaine use disorder": { "id": "UMLS:C3496069", "name": "cocaine use" }, "Opioid use disorder": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Neonatal outcomes": { "id": "MONDO:0004354", "name": "neonatal leukemia" }, "NAS": { "id": "MONDO:0001040", "name": "nasopharyngitis" }, "Mechanical Allodynia": { "id": "MONDO:0004753", "name": "mechanical strabismus" }, "Sickle cell disease (SCD)": { "id": "UMLS:C1263999", "name": "Sickle cell-hemoglobin Lepore disease" }, "Hemolytic anemia": { "id": "MONDO:0003664", "name": "hemolytic anemia" }, "End-organ damage": { "id": "UMLS:C0743496", "name": "end organ damage" }, "Neurogenic inflammation": { "id": "UMLS:C0600467", "name": "Neurogenic Inflammation" }, "Chronic pain patient": { "id": "UMLS:C0744939", "name": "hip pain chronic" }, "Opioid use disorder (OUD)": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Cancer": { "id": "MONDO:0004992", "name": "cancer" }, "Severe pain": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "Nonburn, nondiabetic foot, full-thickness wound": { "id": "UMLS:C0433581", "name": "Full thickness burn of foot" }, "Migraine": { "id": "MONDO:0005277", "name": "migraine disorder" }, "Low back pain": { "id": "UMLS:C0457949", "name": "Chronic low back pain" }, "New persistent opioid use": { "id": "UMLS:C2349426", "name": "New daily persistent headache" }, "Binge drinking": { "id": "MESH:D063425", "name": "Binge Drinking" }, "Marijuana use": { "id": "UMLS:C4316909", "name": "Marijuana Use" }, "Melanoma": { "id": "MONDO:0005105", "name": "melanoma" }, "Urology": { "id": "UMLS:C3825518", "name": "Veterinary urology" }, "Neurosurgery": { "id": null, "name": null }, "Neonatal abstinence syndrome (NAS)": { "id": "MONDO:0005566", "name": "neonatal abstinence syndrome" }, "Negative affect": { "id": "UMLS:C0740825", "name": "AFFECT MANIC" }, "Depressive disorders": { "id": "UMLS:C0683408", "name": "depressive schizoaffective disorder" }, "Musculoskeletal chronic pain": { "id": "UMLS:C3178789", "name": "Widespread Chronic Pain" }, "Opioid epidemic": { "id": "NCIT:C171452", "name": "Epidemic Disorder" }, "Substance abuse disorders": { "id": "MONDO:0002491", "name": "substance abuse" }, "Pain disorders": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "Psychiatric conditions": { "id": "UMLS:C1718246", "name": "Psychiatric or mood diseases or conditions" }, "Suicide and self-harm disorder": { "id": "UMLS:C0178360", "name": "Suicide and selfinflicted injury" }, "Alcohol dependence or abuse": { "id": "UMLS:C1398410", "name": "abuse; drugs, non-dependence-producing" }, "Mood disorder": { "id": "MONDO:0005371", "name": "mood disorder" }, "Anxiety disorder": { "id": "MONDO:0005618", "name": "anxiety disorder" }, "Pain diagnosis": { "id": "UMLS:C5700083", "name": "chronic pain (diagnosis)" }, "Endocarditis": { "id": "MONDO:0005025", "name": "endocarditis" }, "Infective endocarditis (IE)": { "id": "MONDO:0000565", "name": "infective endocarditis" }, "Opioid Use Disorder": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Substance Use Disorder": { "id": "UMLS:C1405565", "name": "disorder; mental, due to use of, amfetamine (or related substance)" }, "Back pain": { "id": "UMLS:C0546193", "name": "Pain, psychogenic, lower back" }, "Drug abuse": { "id": "UMLS:C0338677", "name": "Abuse of antidepressant drug" }, "Postoperative pain": { "id": "UMLS:C2074900", "name": "Postoperative Pain, Chronic" }, "Suicide or self-harm": { "id": "UMLS:C0418328", "name": "Suicide or self injury by arson" }, "Opioid Use Disorder (OUD)": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Neonatal Abstinence Syndrome (NAS)": { "id": "MONDO:0005566", "name": "neonatal abstinence syndrome" }, "Knee osteoarthritis": { "id": "MONDO:0005416", "name": "osteoarthritis, knee" }, "Pain": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "Fibromyalgia": { "id": "MONDO:0005546", "name": "fibromyalgia" }, "Sleep disturbance": { "id": "UMLS:C0852566", "name": "Disturbances in sleep phase rhythm" }, "Cocaine use disorder (CUD)": { "id": "UMLS:C4763868", "name": "Cocaine Use Disorder" }, "Chronic TMD Pain": { "id": "UMLS:C0744939", "name": "hip pain chronic" }, "Persistent postoperative opioid use": { "id": "UMLS:C0161832", "name": "Persistent postoperative fistula" }, "Low Back Pain (LBP)": { "id": "UMLS:C0457949", "name": "Chronic low back pain" }, "Acute pain": { "id": "UMLS:C0747142", "name": "PAIN CRISIS ACUTE" }, "Chronic Pain": { "id": "UMLS:C0744939", "name": "hip pain chronic" }, "Postoperative Pain": { "id": "UMLS:C2074900", "name": "Postoperative Pain, Chronic" }, "Hepatobiliary malignancy": { "id": "UMLS:C0852439", "name": "Hepatobiliary neoplasms malignancy unspecified" }, "TMD": { "id": "MONDO:0010870", "name": "tibial muscular dystrophy" }, "Neurogenic Flare": { "id": "UMLS:C0581345", "name": "Flare of rheumatoid arthritis" }, "Secondary Hyperalgesia": { "id": "MONDO:0006964", "name": "secondary hyperparathyroidism" }, "Inflammatory pain": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "Visceral pain": { "id": "UMLS:C1405041", "name": "pain; thorax, thoracic, spine, with radicular and visceral pain" }, "Mechanical hyperalgesia": { "id": "MONDO:0004753", "name": "mechanical strabismus" }, "Thermal hyperalgesia": { "id": "UMLS:C0701836", "name": "Thermal burn" }, "Adenoma": { "id": "MONDO:0004972", "name": "adenoma" }, "Mood": { "id": "UMLS:C1409662", "name": "mood disorder; sedative" }, "Adverse childhood experiences (ACE)": { "id": "UMLS:C0871166", "name": "Psychedelic Experiences" }, "Sexual abuse": { "id": "UMLS:C0282350", "name": "Sexual abuse" }, "Overdose": { "id": "UMLS:C0572066", "name": "Overdose of codeine" }, "Maternal depression": { "id": "UMLS:C4302615", "name": "Neonatal effect of maternal postpartum depression" }, "Prenatal opioid exposure (POE)": { "id": "UMLS:C0033054", "name": "Prenatal Exposure Delayed Effects" }, "Persistent Opioid Use": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Mental Health Disorders": { "id": "UMLS:C4061796", "name": "Mental health issue" }, "Pain Disorders": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "Mortality": { "id": "MONDO:0025293", "name": "poult enteritis mortality syndrome" }, "Opioid crisis": { "id": "UMLS:C1394213", "name": "crisis; state" }, "Coronavirus disease (COVID-19)": { "id": "MONDO:0020753", "name": "Orthocoronavirinae infectious disease" }, "Mental health": { "id": "UMLS:C4061796", "name": "Mental health issue" }, "Substance use disorder (SUD)": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Neck or upper back pain": { "id": "UMLS:C2033095", "name": "panniculitis affecting neck or back" }, "Hemorrhoid": { "id": "MONDO:0004872", "name": "hemorrhoid" }, "Fissure": { "id": "UMLS:C1397368", "name": "fissure; palate" }, "Fistula": { "id": "UMLS:C0865818", "name": "fistula; mediastinal" }, "Persistent opioid use": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Low back pain (LBP)": { "id": "UMLS:C0457949", "name": "Chronic low back pain" }, "Mental Health Comorbidities": { "id": "UMLS:C4061796", "name": "Mental health issue" }, "Post-traumatic stress disorder": { "id": "MONDO:0005146", "name": "post-traumatic stress disorder" }, "Musculoskeletal disorders": { "id": "UMLS:C0410788", "name": "Disorders of musculoskeletal implants and repairs" }, "Substance misuse": { "id": "UMLS:C4075794", "name": "Novel psychoactive substance misuse" }, "COVID-19": { "id": "MONDO:0100096", "name": "COVID-19" }, "Musculoskeletal conditions": { "id": "UMLS:C5225913", "name": "Musculoskeletal congenital conditions" }, "Chronic low back pain": { "id": "UMLS:C0457949", "name": "Chronic low back pain" }, "Chronic musculoskeletal pain": { "id": "UMLS:C3178789", "name": "Widespread Chronic Pain" }, "Substance use disorders": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Alcohol use disorders (AUD)": { "id": "UMLS:C0001956", "name": "Alcohol Use Disorder" }, "Mental illness": { "id": "UMLS:C0870281", "name": "Chronic mental disorder" }, "Pain-associated behavior": { "id": "UMLS:C0856052", "name": "Radiation associated pain" }, "Traumatic brain injury": { "id": "MONDO:0858950", "name": "traumatic brain injury" }, "Systemic bacterial infections": { "id": "UMLS:C4285778", "name": "Systemic bacterial infection" }, "Major surgery": { "id": "UMLS:C3825618", "name": "Surgery--Complications" }, "Abdominal pain": { "id": "UMLS:C0585107", "name": "Psychosomatic abdominal pain" }, "Back/joint/head pain": { "id": "UMLS:C0546193", "name": "Pain, psychogenic, lower back" }, "Acute Postoperative Pain": { "id": "UMLS:C1719392", "name": "Other acute postoperative pain" }, "Systemic Side Effects": { "id": "UMLS:C1634521", "name": "Effects of side flash from lightning" }, "Addiction": { "id": "UMLS:C1274914", "name": "Addiction to sun exposure" }, "Problematic substance use": { "id": "UMLS:C0678253", "name": "problematic AOD use" }, "Cocaine use disorder (CocUD)": { "id": "UMLS:C4763868", "name": "Cocaine Use Disorder" }, "Prescription Opioid Use Disorder": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Heroin Use Disorder": { "id": "UMLS:C4545086", "name": "Disorder caused by synthetic cannabinoid use" }, "Acute Pain": { "id": "UMLS:C0747142", "name": "PAIN CRISIS ACUTE" }, "Opioid overdose": { "id": "UMLS:C0572061", "name": "Morphinan opioid overdose" }, "Behavioral and mental health issues": { "id": "UMLS:C3844441", "name": "Acute mental/behavioral health problem" }, "Suicide risk": { "id": "UMLS:C0749138", "name": "SUICIDE RISK NOT PRESENTLY SUICIDAL" }, "New persistent opioid use after surgery": { "id": "UMLS:C2349426", "name": "New daily persistent headache" }, "Accidental drug poisoning": { "id": "UMLS:C2879252", "name": "Poisoning by hemostatic drug, accidental (unintentional)" }, "Mental and behavioral disorders due to polysubstance use": { "id": "UMLS:C0349160", "name": "Mental and behavioral disorders due to use of hallucinogens, other mental and behavioral disorders" }, "Cardiovascular diseases": { "id": "UMLS:C0541430", "name": "Diseases and Syndromes of the Cardiovascular and Respiratory Systems" }, "Maternal psychological factors": { "id": "UMLS:C4061735", "name": "Maternal psychological distress" }, "Neonatal opioid withdrawal syndrome (NOWS)": { "id": "UMLS:C3274639", "name": "Neonatal Opiate Withdrawal Syndrome" }, "Maternal psychological conditions": { "id": "UMLS:C4061735", "name": "Maternal psychological distress" }, "Polysubstance use": { "id": "UMLS:C4290106", "name": "polysubstance drug use (indiscriminate drug use)" }, "Perioperative anxiety": { "id": "UMLS:C4546043", "name": "Perioperative hematoma" }, "Surgical site pain": { "id": "UMLS:C0549429", "name": "Surgical site reaction" }, "Open skin wounds": { "id": "UMLS:C0332802", "name": "Multiple open wounds" }, "Resting wound pain": { "id": "UMLS:C4075844", "name": "Resting ischemia" }, "Expected pain": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "Nociceptive pain": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "Inflammatory bowel diseases (IBDs)": { "id": "MONDO:0005265", "name": "inflammatory bowel disease" }, "Neonatal abstinence syndrome": { "id": "MONDO:0005566", "name": "neonatal abstinence syndrome" }, "Neonatal Opioid Withdrawal Syndrome (NOWS)": { "id": "UMLS:C3274639", "name": "Neonatal Opiate Withdrawal Syndrome" }, "Lower back pain": { "id": "UMLS:C0546193", "name": "Pain, psychogenic, lower back" }, "Vertebral Endplate Bone Marrow Lesions": { "id": "UMLS:C4511580", "name": "Defect of vertebral endplate" }, "Chronic Low Back Pain (cLBP)": { "id": "UMLS:C0457949", "name": "Chronic low back pain" }, "Modic changes (MC)": { "id": "UMLS:C0158568", "name": "Congenital macular changes" }, "Bone Marrow Fibrosis": { "id": "UMLS:C1368107", "name": "Aplastic bone marrow" }, "Disc degeneration": { "id": "UMLS:C0263875", "name": "Degeneration of lumbosacral intervertebral disc" }, "Low Back Pain": { "id": "UMLS:C0457949", "name": "Chronic low back pain" }, "Vertebral endplate bone marrow lesions": { "id": "UMLS:C4511580", "name": "Defect of vertebral endplate" }, "MC 1": { "id": "UMLS:C5680264", "name": "MC type II" }, "MC 2": { "id": "UMLS:C5680264", "name": "MC type II" }, "Chronic lower back pain (cLBP)": { "id": "UMLS:C0457949", "name": "Chronic low back pain" }, "Spinal deformities": { "id": "UMLS:C3151987", "name": "Deformities of metatarsal bones" }, "Functional disability": { "id": "MONDO:0001272", "name": "functional diarrhea" }, "Preoperative deformity patients": { "id": "UMLS:C0155134", "name": "Corneal deformity" }, "Pain intensity": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "Chronic LBP subjects": { "id": "MONDO:0004514", "name": "chronic rhinitis" }, "CEP damage": { "id": "UMLS:C1627934", "name": "AML+MDS gene CEP 8 trisomy" }, "Chronic low back pain (cLBP)": { "id": "UMLS:C0457949", "name": "Chronic low back pain" }, "Intervertebral disc (IVD) pathology": { "id": "UMLS:C1400706", "name": "infection of intervertebral disc" }, "Chronic low back pain (LBP)": { "id": "UMLS:C0457949", "name": "Chronic low back pain" }, "Musculoskeletal Pain": { "id": "UMLS:C0746816", "name": "musculoskeletal neck pain" }, "Infectious disease": { "id": "MONDO:0005550", "name": "infectious disease" }, "Illicit drug use": { "id": "UMLS:C0281875", "name": "Illicit drug use (finding)" }, "Substance use (SU)": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Opioid Crisis": { "id": "UMLS:C1394213", "name": "crisis; state" }, "Neuropathic corneal pain (NCP)": { "id": "UMLS:C0339223", "name": "Neuropathic corneal ulcer" }, "Dry eye disease (DED)": { "id": "UMLS:C5197850", "name": "Evaporative Dry Eye Disease" }, "Herpetic eye disease (H-NCP)": { "id": "MONDO:0004616", "name": "herpetic whitlow" }, "Temporomandibular disorder": { "id": "MONDO:0005473", "name": "temporomandibular joint disorder" }, "Chronic symptoms": { "id": "UMLS:C2074921", "name": "chronic schizophreniform disorder with residual symptoms" }, "Myofascial temporomandibular pain": { "id": "MONDO:0006862", "name": "myofascial pain syndrome" }, "Neurotrophic keratopathy (NK)": { "id": "MONDO:0015290", "name": "neurotrophic keratopathy" }, "Ocular pain": { "id": "MONDO:0006875", "name": "ocular hypertension" }, "Chronic ocular pain": { "id": "UMLS:C1263865", "name": "Chronic disease of ocular adnexa" }, "Disease pathology": { "id": "MONDO:0000001", "name": "disease" }, "Chronic musculoskeletal (MSK) pain": { "id": "UMLS:C3178789", "name": "Widespread Chronic Pain" }, "Post-traumatic headache (PTH)": { "id": "UMLS:C0032816", "name": "Post-Traumatic Headache" }, "mild traumatic brain injury (mTBI)": { "id": "UMLS:C3508472", "name": "Mild Traumatic Brain Injury" }, "Substance use disorders (SUD)": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Diphtheria": { "id": "MONDO:0005504", "name": "diphtheria" }, "Tetanus": { "id": "MONDO:0005526", "name": "tetanus" }, "Neuroinflammatory changes": { "id": "UMLS:C5544451", "name": "Neuroinflammatory Diseases" }, "Peripheral neuropathic pain": { "id": "UMLS:C1963916", "name": "Diabetic peripheral neuropathic pain" }, "Neuropathic radiating leg pain": { "id": "UMLS:C2896443", "name": "Pain in leg, unspecified" }, "Spared nerve injury (SNI)": { "id": "UMLS:C0262593", "name": "Peripheral Nerve Injuries" }, "Neuroinflammation": { "id": "MONDO:0004466", "name": "neuronitis" }, "Allodynia": { "id": null, "name": null }, "Spinal Cord Injury (SCI)": { "id": "MONDO:0043797", "name": "spinal cord injury" }, "Neuropathic Pain": { "id": "UMLS:C1963916", "name": "Diabetic peripheral neuropathic pain" }, "Chronic Spinal Cord Injury": { "id": "UMLS:C4281603", "name": "Injury of lumbar spinal cord" }, "Central neuropathic pain": { "id": "UMLS:C1963916", "name": "Diabetic peripheral neuropathic pain" }, "Diabetes": { "id": "UMLS:C0205734", "name": "Diabetes, Autoimmune" }, "T9 contusion SCI": { "id": "UMLS:C1390461", "name": "Bone contusion" }, "Heat hyperalgesia": { "id": "UMLS:C3665909", "name": "Instillation site hyperalgesia" }, "Acute inflammation": { "id": "UMLS:C1265843", "name": "Inflammation with fat necrosis, acute" }, "NTX-induced increases in mechanical hypersensitivity": { "id": "UMLS:C0264482", "name": "Hypersensitivity alveolitis in lungworm infection" }, "Painful diabetic neuropathy (PDN)": { "id": "UMLS:C0751074", "name": "Diabetic Neuralgia" }, "Atherosclerosis": { "id": "MONDO:0005311", "name": "atherosclerosis" }, "Chemotherapy-induced polyneuropathy": { "id": "UMLS:C4546305", "name": "Chronic painful polyneuropathy following chemotherapy" }, "Acute lung injury": { "id": "MONDO:0015796", "name": "acute lung injury" }, "Neuropathic phenotype": { "id": "UMLS:C0403768", "name": "Neuropathic impotence" }, "Thermal Hyperalgesia": { "id": "UMLS:C0701836", "name": "Thermal burn" }, "Cold Allodynia": { "id": "UMLS:C0863093", "name": "Cold symptoms" }, "Reward and addiction": { "id": "UMLS:C1274914", "name": "Addiction to sun exposure" }, "Chronic Neuropathic Pain": { "id": "UMLS:C1395172", "name": "demyelination; neuropathic, chronic, progressive, segmentally" }, "Emotional Disorders": { "id": "UMLS:C0233459", "name": "Emotional disorder" }, "Chronic Constriction Injury (CCI)": { "id": "UMLS:C0332680", "name": "Constriction injury" }, "Peripheral nerve injury": { "id": "EFO:0009510", "name": "peripheral nerve injury" }, "Mechanical allodynia": { "id": "MONDO:0004753", "name": "mechanical strabismus" }, "Spinal cord injury (SCI)": { "id": "MONDO:0043797", "name": "spinal cord injury" }, "Neurodegeneration": { "id": "MONDO:0013674", "name": "neurodegeneration with brain iron accumulation 4" }, "Chronic latent pain sensitization": { "id": "UMLS:C0338811", "name": "Chronic latent schizophrenia" }, "Oral squamous cell carcinoma (OSCC)": { "id": "MONDO:0700157", "name": "canine oral squamous cell carcinoma" }, "Radiculopathy": { "id": "MONDO:0002959", "name": "radiculopathy" }, "Inflammatory diseases": { "id": "UMLS:C1285431", "name": "Sequelae of inflammatory diseases" }, "Chemotherapy-induced peripheral neuropathy (CIPN)": { "id": "UMLS:C3873567", "name": "Peripheral neuropathy due to and following antineoplastic therapy" }, "Peripheral nerve trauma": { "id": "UMLS:C0564440", "name": "Traumatic avulsion of peripheral nerve" }, "Heat Hypersensitivity": { "id": "UMLS:C4552319", "name": "Hypersensitivity myocarditis" }, "Spontaneous Pain": { "id": "UMLS:C0035956", "name": "Rupture, Spontaneous" }, "Orofacial Pain": { "id": "UMLS:C4523791", "name": "Feline orofacial pain syndrome" }, "Complex regional pain syndrome (CRPS)": { "id": "MONDO:0019369", "name": "complex regional pain syndrome" }, "Neuropathies": { "id": "UMLS:C0393822", "name": "Neuropathies and neuromyelopathies associated with systemic disorder" }, "Complex regional pain syndrome-I": { "id": "MONDO:0019369", "name": "complex regional pain syndrome" }, "Migraine headache": { "id": "UMLS:C0744638", "name": "headache migraine chronic" }, "Functional pain": { "id": "UMLS:C0872239", "name": "painful functional bowel disorder" }, "Lung carcinoma": { "id": "MONDO:0005138", "name": "lung carcinoma" }, "Colitis": { "id": "MONDO:0005292", "name": "colitis" }, "Sciatic Nerve Injury": { "id": "UMLS:C0161467", "name": "Injury of sciatic nerve" }, "neuropathic pain": { "id": "UMLS:C1963916", "name": "Diabetic peripheral neuropathic pain" }, "Hemorrhage": { "id": "UMLS:C0940931", "name": "hemorrhage as a complication" }, "Thalamic Pain": { "id": "UMLS:C1719386", "name": "Thalamic pain syndrome (hyperesthetic)" }, "Neurodegenerative disease": { "id": "MONDO:0005559", "name": "neurodegenerative disease" }, "Spinal pain": { "id": "UMLS:C1405029", "name": "infusion catheter, spinal; pain" }, "hypersensitivity": { "id": "UMLS:C4552319", "name": "Hypersensitivity myocarditis" }, "Latent Postoperative Pain Sensitization": { "id": "UMLS:C2074900", "name": "Postoperative Pain, Chronic" }, "Latent Sensitization (LS)": { "id": "UMLS:C3839736", "name": "Sensitization (disorder)" }, "Oral Squamous Cell Carcinoma (SCC)": { "id": "MONDO:0004958", "name": "oral cavity squamous cell carcinoma" }, "Carcinoma": { "id": "MONDO:0004993", "name": "carcinoma" }, "Spontaneous pain": { "id": "UMLS:C0035956", "name": "Rupture, Spontaneous" }, "Spontaneous pain behavior": { "id": "UMLS:C0035956", "name": "Rupture, Spontaneous" }, "Chronic neuropathic pain": { "id": "UMLS:C1395172", "name": "demyelination; neuropathic, chronic, progressive, segmentally" }, "Spared nerve injury": { "id": "UMLS:C1402745", "name": "injury; nerve, auditory nerve" }, "Periorbital mechanical allodynia": { "id": "UMLS:C0948065", "name": "Periorbital Infection" }, "Opioid tolerance (OT)": { "id": "UMLS:C5392920", "name": "Opioid Misuse" }, "Opioid-induced hyperalgesia (OIH)": { "id": "UMLS:C5392793", "name": "Opioid-Induced Bowel Dysfunction" }, "hindpaw hyperalgesia": { "id": "UMLS:C0685477", "name": "Supernumerary hindpaw phalanx" }, "Enduring stress-induced hyperalgesia (ESIH)": { "id": "UMLS:C4295709", "name": "enduring personality change" }, "Single prolonged stress (SPS)": { "id": "UMLS:C0154593", "name": "Prolonged post-traumatic stress disorder" }, "Chronic post-traumatic pain": { "id": "UMLS:C4082769", "name": "Chronic Traumatic Encephalopathy" }, "Hyperalgesia": { "id": "UMLS:C3665909", "name": "Instillation site hyperalgesia" }, "Tactile hypersensitivity": { "id": "UMLS:C4552319", "name": "Hypersensitivity myocarditis" }, "Craniofacial pain": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "Somatic Pain Hypersensitivity": { "id": "UMLS:C4552319", "name": "Hypersensitivity myocarditis" }, "Malocclusion": { "id": "UMLS:C1403534", "name": "malocclusion; temporomandibular" }, "Unilateral Anterior Crossbite (UAC)": { "id": "UMLS:C0266058", "name": "Anterior crossbite" }, "Interstitial cystitis/bladder pain syndrome (IC/BPS)": { "id": "MONDO:0018301", "name": "interstitial cystitis" }, "Overactive bladder syndrome (OAB)": { "id": "MONDO:0006624", "name": "overactive bladder" }, "Oral squamous cell carcinoma": { "id": "MONDO:0700157", "name": "canine oral squamous cell carcinoma" }, "Spastic cerebral palsy (CP)": { "id": "MONDO:0000396", "name": "spastic cerebral palsy" }, "Pathological conditions": { "id": "UMLS:C0752135", "name": "Pathological Conditions, Anatomical" }, "Skeletal pain": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "allodynia and neuropathic pain": { "id": "UMLS:C1963916", "name": "Diabetic peripheral neuropathic pain" }, "Inflammatory Pain": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "Sickle cell disease": { "id": "UMLS:C1385175", "name": "disease (or disorder); sickle-cell, spherocytosis" }, "Opioid Dependence": { "id": "MONDO:0005530", "name": "opiate dependence" }, "HIV": { "id": "UMLS:C4505456", "name": "HIV Coinfection" }, "HIV/AIDS": { "id": "UMLS:C1456617", "name": "HIV/AIDS and Infections" }, "Methamphetamine-use disorders": { "id": "UMLS:C5229802", "name": "Methamphetamine withdrawal" }, "Opioid relapse": { "id": "UMLS:C2959881", "name": "Relapse pulmonary tuberculosis" }, "Substance use disorders (SUDs)": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Substance Use Disorders": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Cognitive Dysfunction": { "id": "UMLS:C4721773", "name": "Postoperative cognitive dysfunction" }, "Mania": { "id": "UMLS:C1403565", "name": "mania; puerperal" }, "Insomnia": { "id": "MONDO:0013600", "name": "insomnia" }, "Stimulant use disorders": { "id": "UMLS:C3509145", "name": "stimulant use" }, "DSM-IV diagnoses": { "id": "UMLS:C0338067", "name": "Disease/diagnosis" }, "Psychotic symptoms": { "id": "UMLS:C0349206", "name": "Mania with psychotic symptoms" }, "Depressive symptoms": { "id": "UMLS:C0494400", "name": "Severe depressive episode with psychotic symptoms" }, "Anxiety symptoms": { "id": "MONDO:0011918", "name": "anxiety" }, "Impulsivity": { "id": "UMLS:C0233461", "name": "Emotional impulsivity" }, "Alcohol use disorder": { "id": "UMLS:C0001956", "name": "Alcohol Use Disorder" }, "Injection drug use": { "id": "UMLS:C1393201", "name": "injection; complications, drug reaction" }, "Drug use disorders (DUD)": { "id": "UMLS:C0013222", "name": "Drug Use Disorders" }, "Non-addiction mental health disorders": { "id": "UMLS:C4061796", "name": "Mental health issue" }, "Alcohol use disorders": { "id": "UMLS:C0001956", "name": "Alcohol Use Disorder" }, "Opioid use disorders": { "id": "UMLS:C0240602", "name": "opioid use" }, "Substance use disorder": { "id": "UMLS:C1405565", "name": "disorder; mental, due to use of, amfetamine (or related substance)" }, "Prescription Opioid Dependence": { "id": "UMLS:C5392921", "name": "Prescription Opioid Abuse" }, "Cannabis use disorders (CUDs)": { "id": "UMLS:C4536315", "name": "cannabis use with other cannabis-induced mental and behavioral disorders" }, "Drug use disorders (DUDs)": { "id": "UMLS:C0013222", "name": "Drug Use Disorders" }, "Psychiatric diagnoses": { "id": "UMLS:C0748061", "name": "psychiatric hospitalization" }, "Tobacco use": { "id": "UMLS:C1398180", "name": "tobacco; harmful use" }, "Asthma": { "id": "MONDO:0004979", "name": "asthma" }, "Chronic obstructive pulmonary disease": { "id": "MONDO:0005002", "name": "chronic obstructive pulmonary disease" }, "Non-medical prescription drug use": { "id": "UMLS:C0850320", "name": "prescription drug dependence" }, "Non-cancer pain": { "id": "UMLS:C0935681", "name": "Non-Hematologic Malignancy" }, "Mental health disorders": { "id": "UMLS:C4061796", "name": "Mental health issue" }, "Prescription opioid use disorder (POUD)": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Chronic non-cancer pain (CNCP)": { "id": "UMLS:C4546304", "name": "Chronic pain following surgical procedure for cancer" }, "Chronic medical conditions": { "id": "UMLS:C3266262", "name": "Multiple Chronic Conditions" }, "Non-opioid drug use disorders": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Addictions": { "id": "UMLS:C5392818", "name": "Smartphone Addiction" }, "Chronic conditions": { "id": "UMLS:C5545294", "name": "Chronic Condition" }, "Hypertension": { "id": "UMLS:C0497249", "name": "hypertension complicated" }, "Mental health problems": { "id": "UMLS:C4061796", "name": "Mental health issue" }, "Major depressive disorder": { "id": "MONDO:0002009", "name": "major depressive disorder" }, "Human Immunodeficiency Virus (HIV)": { "id": "UMLS:C0338422", "name": "Human immunodeficiency virus leukoencephalopathy" }, "Substance Use Disorder (SUD)": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Mental disorders": { "id": "UMLS:C4046029", "name": "Mental Disorders, Severe" }, "Tobacco/alcohol use disorder": { "id": "UMLS:C4237447", "name": "Tobacco use disorder, moderate" }, "Stimulant use disorder": { "id": "UMLS:C3509145", "name": "stimulant use" }, "Hepatitis C": { "id": "MONDO:0002251", "name": "hepatitis" }, "Acute care": { "id": "UMLS:C3251604", "name": "acute infection due to medical care" }, "Urgent care": { "id": "UMLS:C0857184", "name": "Urgent diarrhea" }, "Emergency department visits": { "id": "UMLS:C5578054", "name": "Hyperglycemic crisis" }, "Hospitalizations": { "id": "UMLS:C0748061", "name": "psychiatric hospitalization" }, "Opioid misuse behaviors": { "id": "UMLS:C5392920", "name": "Opioid Misuse" }, "Substance Use Disorders (SUD)": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Social determinants of poor health": { "id": "OMIM:609535", "name": "" }, "OUD": { "id": "MONDO:0007854", "name": "keratolytic winter erythema" }, "Methamphetamine use disorder": { "id": "UMLS:C5229802", "name": "Methamphetamine withdrawal" }, "Gastrointestinal disorders": { "id": "UMLS:C0852271", "name": "Neonatal gastrointestinal disorder" }, "Tremor": { "id": "MONDO:0011201", "name": "tremor, hereditary essential, 2" }, "Malaise": { "id": "UMLS:C1720231", "name": "Malaise with AIDS (acquired immunodeficiency syndrome)" }, "Hyperhidrosis": { "id": "MONDO:0007754", "name": "hyperhidrosis palmaris ET plantaris" }, "Anorexia": { "id": "MONDO:0005351", "name": "anorexia nervosa" }, "Heart condition/disease": { "id": "UMLS:C0743930", "name": "FETAL HEART CONDITION" }, "Chronic obstructive pulmonary disease (COPD)": { "id": "MONDO:0005002", "name": "chronic obstructive pulmonary disease" }, "Substance Use Disorders (SUDs)": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Infectious diseases": { "id": "UMLS:C0005943", "name": "Bone Diseases, Infectious" }, "Bacterial infections": { "id": "UMLS:C0015404", "name": "Eye Infections, Bacterial" }, "Fungal infections": { "id": "UMLS:C0947879", "name": "Infections NEC" }, "HCV": { "id": "UMLS:C1698259", "name": "HCV coinfection" }, "Drug overdose": { "id": "UMLS:C0029944", "name": "Drug Overdose" }, "Stimulant abuse": { "id": "UMLS:C1456332", "name": "Stimulant abuse" }, "Stimulant dependence": { "id": "UMLS:C3509130", "name": "stimulant dependence - uncomplicated" }, "Depression/anxiety": { "id": "UMLS:C1387804", "name": "anxiety depression; persistent" }, "Opioid-related overdose": { "id": "UMLS:C0572061", "name": "Morphinan opioid overdose" }, "Hepatitis": { "id": "MONDO:0002251", "name": "hepatitis" }, "Psychiatric disorders": { "id": "UMLS:C2015805", "name": "other psychiatric disorders" }, "Bipolar disorder": { "id": "MONDO:0004985", "name": "bipolar disorder" }, "Posttraumatic stress disorder (PTSD)": { "id": "UMLS:C3166103", "name": "PhenX measure - posttraumatic stress disorder (PTSD)" }, "Disability": { "id": "UMLS:C3649396", "name": "disability or chronic disease leading to disablement" }, "Pain severity/interference": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "Overdose history": { "id": "UMLS:C0572867", "name": "Phenobarbitone overdose" }, "Anxiety Disorders": { "id": "MONDO:0011918", "name": "anxiety" }, "Psychiatric Disorders": { "id": "UMLS:C2015805", "name": "other psychiatric disorders" }, "Perinatal Opioid Use Disorder": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Opioid craving": { "id": "UMLS:C5392920", "name": "Opioid Misuse" }, "Mental health conditions": { "id": "UMLS:C2107096", "name": "conditions influencing health status" }, "SUD": { "id": "EFO:0004278", "name": "sudden cardiac arrest" }, "Traumatic events": { "id": "UMLS:C0002694", "name": "Amputation, Traumatic" }, "Opioid withdrawal": { "id": "UMLS:C0029104", "name": "Opioid withdrawal" }, "Infections": { "id": "UMLS:C0947879", "name": "Infections NEC" }, "Suicidality": { "id": null, "name": null }, "Homelessness": { "id": null, "name": null }, "Non-fatal overdose": { "id": "UMLS:C0559046", "name": "Non-fatal electric shock" }, "Illicit/non-medical drug toxicology": { "id": "UMLS:C3872526", "name": "Illicit drug overdose" }, "Fatal opioid poisoning": { "id": "UMLS:C5445174", "name": "Poisoning caused by opioid receptor agonist" }, "Suicidal Ideation": { "id": "UMLS:C0438696", "name": "Suicidal" }, "Alcohol misuse": { "id": "UMLS:C0678254", "name": "AOD misuse" }, "Non-opioid drug misuse": { "id": "UMLS:C5392920", "name": "Opioid Misuse" }, "Mental Disorders": { "id": "UMLS:C4046029", "name": "Mental Disorders, Severe" }, "Nonnicotine Substance Use Disorders": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Alcohol use": { "id": "UMLS:C0001956", "name": "Alcohol Use Disorder" }, "Psychosis": { "id": "UMLS:C0543911", "name": "psychosis; situational" }, "Liver disease": { "id": "UMLS:C1385051", "name": "disease (or disorder); liver, toxic, with veno-occlusive disease of liver" }, "Opioid Use Disorders": { "id": "UMLS:C0240602", "name": "opioid use" }, "Respiratory Depression": { "id": "UMLS:C1386218", "name": "depression; respiratory center" }, "Opioid Abuse": { "id": "MONDO:0001225", "name": "opioid abuse" }, "Withdrawal": { "id": "UMLS:C0235097", "name": "Withdrawal convulsions" }, "Maternal morbidity": { "id": "UMLS:C3494405", "name": "Maternal Death" }, "Newborn morbidity": { "id": "UMLS:C0848898", "name": "newborn morbidity" }, "Maternal mortality": { "id": "UMLS:C3494405", "name": "Maternal Death" }, "Newborn mortality": { "id": "UMLS:C1400290", "name": "newborn, transient" }, "Respiratory depression": { "id": "UMLS:C1386218", "name": "depression; respiratory center" }, "Chronic Low Back Pain": { "id": "UMLS:C0457949", "name": "Chronic low back pain" }, "Opioid addiction": { "id": "MONDO:0005530", "name": "opiate dependence" }, "Sedation": { "id": "UMLS:C4523931", "name": "Sedation complication" }, "Anxiolytic effects": { "id": "UMLS:C0338766", "name": "Anxiolytic dependence" }, "Diabetic neuropathic pain": { "id": "UMLS:C1963916", "name": "Diabetic peripheral neuropathic pain" }, "Paralysis": { "id": "UMLS:C1406910", "name": "paralysis; quadriplegic" }, "Nausea": { "id": "UMLS:C5684176", "name": "nausea disorder" }, "Opioid Overdose": { "id": "UMLS:C0572061", "name": "Morphinan opioid overdose" }, "Fentanyl Use Disorders and Toxicity": { "id": "UMLS:C0013222", "name": "Drug Use Disorders" }, "fentanyl- and sufentanil-induced antinociception, respiratory depression, and bradycardia": { "id": "UMLS:C0812393", "name": "Cancer patients and suicide and depression" }, "fentanyl intravenous self-administration": { "id": "UMLS:C5384896", "name": "poisoning by fentanyl or fentanyl analogs, intentional self-harm" }, "Prescription opioid misuse": { "id": "UMLS:C5392919", "name": "Prescription Opioid Misuse" }, "DSM-IV criteria for an opioid use disorder": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Valvulopathy": { "id": "UMLS:C4706538", "name": "Deafness, encephaloneuropathy, obesity, valvulopathy syndrome" }, "Opioid-induced constipation": { "id": "MONDO:0100187", "name": "opioid-induced constipation" }, "Opioid use disorders (OUD)": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Cardiac valvulopathy": { "id": "UMLS:C1956414", "name": "Cardiac asthma" }, "Sleep disturbances": { "id": "UMLS:C0852566", "name": "Disturbances in sleep phase rhythm" }, "Sleep disorders": { "id": "UMLS:C1561892", "name": "Organic sleep disorder" }, "Craving": { "id": "UMLS:C0678308", "name": "AOD craving" }, "Knee osteoarthritis (OA)": { "id": "MONDO:0005416", "name": "osteoarthritis, knee" }, "Hand Osteoarthritis (OA)": { "id": "UMLS:C2893978", "name": "primary osteoarthritis of hand" }, "Pelvic Floor Muscle Tenderness (PFT)": { "id": "UMLS:C1535916", "name": "Pelvic Floor Muscle Weakness" }, "Urologic Chronic Pelvic Pain Syndrome (UCPPS)": { "id": "UMLS:C1723764", "name": "Chronic Prostatitis with Chronic Pelvic Pain Syndrome" }, "Interstitial Cystitis/Bladder Pain Syndrome": { "id": "MONDO:0018301", "name": "interstitial cystitis" }, "Chronic Prostatitis/Chronic Pelvic Pain Syndrome": { "id": "UMLS:C1723764", "name": "Chronic Prostatitis with Chronic Pelvic Pain Syndrome" }, "Opioid overdose deaths": { "id": "UMLS:C0572061", "name": "Morphinan opioid overdose" }, "Opioid use disorder (MOUD)": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "opioid overdose deaths": { "id": "UMLS:C0572061", "name": "Morphinan opioid overdose" }, "opioid use disorder": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "high-risk opioid prescribing": { "id": "UMLS:C0242786", "name": "High-Risk Pregnancy" }, "Opioid Overdose Death": { "id": "UMLS:C0572061", "name": "Morphinan opioid overdose" }, "Prescription opioid use disorder": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Overdoses": { "id": "UMLS:C3888438", "name": "Overdoses NEC" }, "Fatalities": { "id": null, "name": null }, "Opioid-involved overdose deaths": { "id": "UMLS:C0572061", "name": "Morphinan opioid overdose" }, "Sepsis": { "id": "UMLS:C0264329", "name": "sepsis; tracheostomy" }, "Jaundice": { "id": "UMLS:C0242183", "name": "Jaundice, Hemolytic" }, "Strabismus": { "id": "MONDO:0003432", "name": "strabismus" }, "Nystagmus": { "id": "MONDO:0010694", "name": "nystagmus, myoclonic" }, "Childhood adversity (CA)": { "id": "UMLS:C0747676", "name": "pneumonia childhood" }, "Prenatal opioid/other drug exposure (PODE)": { "id": "UMLS:C0033054", "name": "Prenatal Exposure Delayed Effects" }, "Prenatal alcohol exposure (PAE)": { "id": "MONDO:0850461", "name": "neurobehavioral disorder with prenatal alcohol exposure" }, "Cognitive and behavioral problems": { "id": "MONDO:0013886", "name": "cerebellar dysfunction with variable cognitive and behavioral abnormalities" }, "End-stage kidney disease (ESKD)": { "id": "MONDO:0004375", "name": "end stage renal failure" }, "Chronic kidney disease": { "id": "MONDO:0005300", "name": "chronic kidney disease" }, "End-stage kidney disease": { "id": "MONDO:0004375", "name": "end stage renal failure" }, "Kidney Disease": { "id": "UMLS:C1385115", "name": "disease (or disorder); kidney, complicating pregnancy" }, "Chronic Kidney Disease (CKD)": { "id": "MONDO:0005300", "name": "chronic kidney disease" }, "Noncancer pain": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "HD-dependent kidney failure (HDKF)": { "id": "UMLS:C1404117", "name": "failure; transplant, kidney" }, "Morbidity": { "id": "UMLS:C1301727", "name": "Anesthesia morbidity" }, "Chronic kidney disease-associated-pruritus (CKD-aP)": { "id": "UMLS:C0748035", "name": "pruritus chronic" }, "Chronic Kidney Disease": { "id": "MONDO:0005300", "name": "chronic kidney disease" }, "Illness-related post-traumatic stress disorder": { "id": "MONDO:0005146", "name": "post-traumatic stress disorder" }, "Chronic pelvic pain": { "id": "UMLS:C1723764", "name": "Chronic Prostatitis with Chronic Pelvic Pain Syndrome" }, "Persistent pelvic pain": { "id": "UMLS:C0494408", "name": "Persistent somatoform pain disorder" }, "Endometriosis": { "id": "MONDO:0005133", "name": "endometriosis" }, "Uterine fibroids": { "id": "UMLS:C0237022", "name": "Multiple uterine fibroids" }, "Pelvic adhesions": { "id": "UMLS:C0262591", "name": "Pelvic adhesions" }, "Adenomyosis": { "id": "MONDO:0010888", "name": "adenomyosis" }, "Drug use": { "id": "UMLS:C0013222", "name": "Drug Use Disorders" }, "recidivism": { "id": "UMLS:C0680458", "name": "Recidivism" }, "Hepatitis C virus (HCV)": { "id": "MONDO:0012292", "name": "hepatitis C virus, susceptibility to" }, "Fatal Opioid Overdose": { "id": "UMLS:C0206277", "name": "Fatal Outcome" }, "Post traumatic stress disorder (PTSD)": { "id": "MONDO:0005146", "name": "post-traumatic stress disorder" }, "Hamilton Depression (HDRS)": { "id": "UMLS:C0235136", "name": "Agitated depression" }, "Anxiety (HARS)": { "id": "MONDO:0011918", "name": "anxiety" }, "Opioid Use Disorders (OUD)": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Alcohol Use Disorder": { "id": "UMLS:C0001956", "name": "Alcohol Use Disorder" }, "Lung cancer": { "id": "MONDO:0008903", "name": "lung cancer" }, "Epilepsy": { "id": "MONDO:0005027", "name": "epilepsy" }, "Tremor Disorder": { "id": "UMLS:C0349742", "name": "Dissociative tremor" }, "Chronic Neuropathic and Inflammatory Pains": { "id": "UMLS:C1290886", "name": "Chronic inflammatory disorder" }, "diabetic neuropathic pain": { "id": "UMLS:C1963916", "name": "Diabetic peripheral neuropathic pain" }, "Chondrocytic hypertrophy": { "id": "UMLS:C1510517", "name": "Hypertrophy of thymus" }, "Chronic Inflammatory Pain": { "id": "UMLS:C1290886", "name": "Chronic inflammatory disorder" }, "Injury": { "id": "UMLS:C0149992", "name": "Injury of trachea" }, "Acquired neuropathy": { "id": "UMLS:C0751133", "name": "Acquired Facial Neuropathy" }, "Acute and chronic pain": { "id": "UMLS:C0302472", "name": "Acute and chronic cholecystitis" }, "Psychiatric disorder": { "id": "MONDO:0002025", "name": "psychiatric disorder" }, "PTSD": { "id": "UMLS:C3166103", "name": "PhenX measure - posttraumatic stress disorder (PTSD)" }, "Psychiatric comorbidities": { "id": "UMLS:C0748061", "name": "psychiatric hospitalization" }, "Medical comorbidities": { "id": "UMLS:C4482549", "name": "Comorbidities and coexisting conditions" }, "Affective disorders": { "id": "UMLS:C0001723", "name": "Affective Disorders, Psychotic" }, "Psychotic disorders": { "id": "UMLS:C0086640", "name": "Psychotic Mood Disorders" }, "Trigeminal nerve chronic neuropathic pain": { "id": "UMLS:C3179086", "name": "Trigeminal Nerve Contusion" }, "Itch": { "id": "MONDO:0001951", "name": "Norwegian scabies" }, "Hazardous Opioid Use": { "id": "UMLS:C0679256", "name": "hazardous AOD use" }, "Acute postsurgical pain": { "id": "UMLS:C0747142", "name": "PAIN CRISIS ACUTE" }, "Chronic postsurgical pain": { "id": "UMLS:C2074900", "name": "Postoperative Pain, Chronic" }, "Psychological distress": { "id": "UMLS:C0815107", "name": "Psychological Distress" }, "Post-traumatic stress symptoms": { "id": "MONDO:0005146", "name": "post-traumatic stress disorder" }, "Sleep-disordered Breathing": { "id": "UMLS:C3697918", "name": "Pulmonary hypertension due to sleep-disordered breathing" }, "Opioid-related mortality": { "id": "UMLS:C4237476", "name": "Unspecified opioid-related disorder" }, "Obstructive sleep apnea": { "id": "MONDO:0007147", "name": "obstructive sleep apnea syndrome" }, "Apneas": { "id": "MONDO:0024358", "name": "complex sleep apnea" }, "Hypoventilation": { "id": "UMLS:C0745186", "name": "hypoventilation syndrome" }, "Central Apneas": { "id": "MONDO:0008807", "name": "apnea, central sleep" }, "Hypoxemia": { "id": "UMLS:C4075684", "name": "Hypoxemia during surgery" }, "Obstructive Sleep Apnea": { "id": "MONDO:0007147", "name": "obstructive sleep apnea syndrome" }, "Nonfatal Pharmaceutical Overdose": { "id": "UMLS:C2204141", "name": "self-inflicted overdose of pharmaceutical excipients" }, "Heroin Overdose": { "id": "UMLS:C0572070", "name": "Heroin overdose" }, "Fatal Overdose": { "id": "UMLS:C0206277", "name": "Fatal Outcome" }, "Nonmedical use of prescription opioids (NMUPO)": { "id": "UMLS:C0679258", "name": "nonprescribed use of drug" }, "Nonmedical use of prescription drugs (NMUPD)": { "id": "UMLS:C0679258", "name": "nonprescribed use of drug" }, "Cigarette smoking": { "id": "UMLS:C1880083", "name": "Cigarette Smoking Toxicity" }, "Fatal overdoses": { "id": "UMLS:C0206277", "name": "Fatal Outcome" }, "Nonfatal overdoses": { "id": "UMLS:C3888438", "name": "Overdoses NEC" }, "Adolescent cigarette smoking": { "id": "UMLS:C1880083", "name": "Cigarette Smoking Toxicity" }, "Opioid-related overdoses": { "id": "UMLS:C3888438", "name": "Overdoses NEC" }, "Drug overdoses": { "id": "UMLS:C3888438", "name": "Overdoses NEC" }, "Opioid-related deaths": { "id": "UMLS:C4237476", "name": "Unspecified opioid-related disorder" }, "Postpartum psychopathology": { "id": "UMLS:C0341975", "name": "Fibrinolysis - postpartum" }, "Mood symptoms": { "id": "UMLS:C0852544", "name": "Fluctuating mood symptoms" }, "Nonfatal opioid overdose (NFOD)": { "id": "UMLS:C0572061", "name": "Morphinan opioid overdose" }, "Mood or anxiety disorder": { "id": "UMLS:C0154587", "name": "Adjustment disorder with anxious mood" }, "Trauma and stress-related disorders": { "id": "UMLS:C0810065", "name": "Joint disorders and dislocations; trauma-related" }, "Suicide attempt or self-harm": { "id": "UMLS:C0038663", "name": "Suicide attempt" }, "Cannabis use disorder": { "id": "UMLS:C3160814", "name": "Cannabis use" }, "Boredom": { "id": "UMLS:C0679454", "name": "chronic boredom" }, "Externalizing behavior": { "id": "UMLS:C0149623", "name": "behavior disturbance" }, "Internalizing symptoms": { "id": "EFO:0020971", "name": "internalizing disorder\"@e" }, "Sensation seeking": { "id": "UMLS:C0036659", "name": "Sensation Disorders" }, "Depressive affect": { "id": "UMLS:C0086133", "name": "Depressive Syndrome" }, "Overdose mortality": { "id": "UMLS:C0572867", "name": "Phenobarbitone overdose" }, "Mood/anxiety disorders": { "id": "UMLS:C0154588", "name": "Adjustment disorder with mixed anxiety and depressed mood" }, "ADHD": { "id": "UMLS:C2231354", "name": "ADHD, predominantly hyperactive - impulsive" }, "Mental health difficulties": { "id": "UMLS:C4061796", "name": "Mental health issue" }, "Physical health difficulties": { "id": "UMLS:C3534575", "name": "Animal Health" }, "Cannabis use disorder (CUD)": { "id": "UMLS:C5419030", "name": "Cannabis Use Disorder" }, "Opioid Misuse": { "id": "UMLS:C5392920", "name": "Opioid Misuse" }, "adverse childhood experiences": { "id": "UMLS:C0747676", "name": "pneumonia childhood" }, "Parental substance abuse": { "id": "UMLS:C4546258", "name": "Abuse of synthetic cathinone" }, "Mental health symptoms": { "id": "UMLS:C4061796", "name": "Mental health issue" }, "Parenting risk": { "id": "UMLS:C3862450", "name": "risk of premature death" }, "Substance abuse": { "id": "MONDO:0002491", "name": "substance abuse" }, "Overdose risk behaviors": { "id": "UMLS:C0572867", "name": "Phenobarbitone overdose" }, "Impaired driving": { "id": "UMLS:C0684311", "name": "impaired driving" }, "Poverty": { "id": "UMLS:C0455732", "name": "Poverty of thought" }, "Unstable housing": { "id": "UMLS:C2880406", "name": "Unstable keratoconus" }, "Abuse": { "id": "UMLS:C0338671", "name": "Abuse of steroids" }, "Incarceration": { "id": "UMLS:C1400457", "name": "incarceration; lens" }, "Mental health support": { "id": "UMLS:C4061796", "name": "Mental health issue" }, "Group therapy": { "id": "UMLS:C1292780", "name": "Therapy-related myelodysplastic syndrome" }, "Opioid overdoses": { "id": "UMLS:C3888438", "name": "Overdoses NEC" }, "Opioid mortality rates": { "id": "MONDO:0025293", "name": "poult enteritis mortality syndrome" }, "Autism Spectrum Disorder (ASD)": { "id": "MONDO:0005258", "name": "autism spectrum disorder" }, "Stimulant Use Disorder": { "id": "UMLS:C3509145", "name": "stimulant use" }, "Opioid risk behavior": { "id": "UMLS:C0149623", "name": "behavior disturbance" }, "Patient knowledge about naloxone administration": { "id": "UMLS:C0274699", "name": "Poisoning by naloxone" }, "Other substance use": { "id": "UMLS:C2874833", "name": "Other psychoactive substance use, unspecified" }, "Musculoskeletal pain": { "id": "UMLS:C0746816", "name": "musculoskeletal neck pain" }, "Other drug use disorder symptoms": { "id": "UMLS:C0013222", "name": "Drug Use Disorders" }, "Non-fatal opioid overdoses": { "id": "UMLS:C0559046", "name": "Non-fatal electric shock" }, "Temporomandibular disorders (TMD)": { "id": "MONDO:0005473", "name": "temporomandibular joint disorder" }, "Chronic overlapping pain conditions (COPCs)": { "id": "UMLS:C0744939", "name": "hip pain chronic" }, "Pain-related disability": { "id": "UMLS:C1389784", "name": "worries; pain or disability" }, "Stress": { "id": "UMLS:C0234549", "name": "Stress seizure" }, "Sleep deficiency": { "id": "MONDO:0100081", "name": "sleep disorder" }, "Opioid use": { "id": "UMLS:C0240602", "name": "opioid use" }, "Attention-Deficit/Hyperactivity Disorder (ADHD)": { "id": "MONDO:0007743", "name": "attention deficit-hyperactivity disorder" }, "Sleep apnea": { "id": "MONDO:0008807", "name": "apnea, central sleep" }, "Sleep Deficiency": { "id": "MONDO:0100081", "name": "sleep disorder" }, "Sleep-Disordered Breathing": { "id": "UMLS:C3697918", "name": "Pulmonary hypertension due to sleep-disordered breathing" }, "Sleep Apnea Endotypes": { "id": "UMLS:C1135365", "name": "sleep apnea of newborn" }, "Sleep Disorders": { "id": "UMLS:C1561892", "name": "Organic sleep disorder" }, "Analgesic tolerance": { "id": "UMLS:C0149938", "name": "Analgesic nephropathy" }, "Physical dependence": { "id": "UMLS:C0235138", "name": "Drug dependence physical" }, "Fentanyl analgesia": { "id": "UMLS:C0570532", "name": "Allergy to fentanyl" }, "Tolerance": { "id": "UMLS:C1406989", "name": "tolerance; pancreatic, decreased (steatorrhea)" }, "Fentanyl-induced hypersensitivity": { "id": "UMLS:C4543752", "name": "Hypersensitivity disease of liver caused by drug" }, "Painful Diabetic Neuropathy (PDN)": { "id": "UMLS:C0751074", "name": "Diabetic Neuralgia" }, "L1 paraplegia": { "id": "MONDO:0003757", "name": "paraplegia" }, "Generator site pain": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "Pocket pain": { "id": "UMLS:C0854570", "name": "Pocket erosion" }, "Failed back surgery syndrome": { "id": "UMLS:C1963763", "name": "Failed Back Surgery Syndrome" }, "Complex regional pain syndrome": { "id": "MONDO:0019369", "name": "complex regional pain syndrome" }, "Neuropsychiatric disorders": { "id": "MONDO:0859292", "name": "developmental delay, behavioral abnormalities, and neuropsychiatric disorders" } }, "Gene (biolink:Gene)": { "Ccr7": { "id": "NCBIGene:1236", "name": "CCR7" }, "NaV1.8-tdTomato": { "id": "NCBIGene:20264", "name": "Scn10a" }, "Ngf": { "id": "NCBIGene:4803", "name": "NGF" }, "CX3CL1": { "id": "NCBIGene:6376", "name": "CX3CL1" }, "CCL2": { "id": "NCBIGene:6347", "name": "CCL2" }, "TLR1": { "id": "NCBIGene:7096", "name": "TLR1" }, "NGF": { "id": "NCBIGene:4803", "name": "NGF" }, "ANTXR2": { "id": "NCBIGene:71914", "name": "Antxr2" }, "Calcitonin-related polypeptide alpha (CALCA)": { "id": "NCBIGene:748619", "name": "CALCA" }, "mu-opioid receptor (OPRM1)": { "id": "NCBIGene:100060029", "name": "OPRM1" }, "delta-opioid receptor (OPRD1)": { "id": "NCBIGene:102174787", "name": "OPRD1" }, "dopamine D2 receptor (DRD2)": { "id": "NCBIGene:451553", "name": "DRD2" }, "brain-derived neurotrophic factor (BDNF)": { "id": "NCBIGene:119943514", "name": "BDNF" }, "KCNG2": { "id": "NCBIGene:26251", "name": "KCNG2" }, "KCNC1": { "id": "NCBIGene:3746", "name": "KCNC1" }, "CNIH3": { "id": "NCBIGene:72978", "name": "Cnih3" }, "APBB2": { "id": "NCBIGene:323", "name": "APBB2" }, "RGMA": { "id": "NCBIGene:56963", "name": "RGMA" }, "COMT": { "id": "NCBIGene:1312", "name": "COMT" }, "F2rl1 mRNA": { "id": "NCBIGene:2150", "name": "F2RL1" }, "Nppb": { "id": "NCBIGene:4879", "name": "NPPB" }, "IL31ra": { "id": "NCBIGene:133396", "name": "IL31RA" }, "Calcitonin gene-related peptide (CGRP/Calca)": { "id": "NCBIGene:700649", "name": "CALCA" }, "GluA1": { "id": "NCBIGene:110105546", "name": "LOC110105546" }, "GluA4": { "id": "NCBIGene:117871163", "name": "GRIA4" }, "GluA2": { "id": "NCBIGene:102589208", "name": "LOC102589208" }, "Nrcam": { "id": "NCBIGene:4897", "name": "NRCAM" }, "GPR160": { "id": "NCBIGene:26996", "name": "GPR160" }, "Long noncoding RNA H19": { "id": "UMLS:C4310732", "name": "LONG NONCODING RNA 13" }, "H19 siRNA": { "id": "NCBIGene:14955", "name": "H19" }, "MeCP2": { "id": "NCBIGene:4204", "name": "MECP2" }, "CCR2": { "id": "NCBIGene:12772", "name": "Ccr2" }, "CX3CR1": { "id": "NCBIGene:1524", "name": "CX3CR1" }, "TRPM3": { "id": "NCBIGene:80036", "name": "TRPM3" }, "c-Fos": { "id": "UMLS:C0085940", "name": "c-fos Genes" }, "Trpa1": { "id": "NCBIGene:8989", "name": "TRPA1" }, "ABCA1": { "id": "NCBIGene:19", "name": "ABCA1" }, "ABCG1": { "id": "NCBIGene:9619", "name": "ABCG1" }, "Fto mRNA": { "id": "NCBIGene:478125", "name": "FTO" }, "Tlr4 mRNA": { "id": "NCBIGene:7099", "name": "TLR4" }, "Pirt": { "id": "NCBIGene:193003", "name": "Pirt" }, "Phox2b, Efcab6": { "id": "NCBIGene:105373058", "name": "EFCAB6-DT" }, "Hoxa7": { "id": "NCBIGene:3204", "name": "HOXA7" }, "CTSS": { "id": "NCBIGene:1520", "name": "CTSS" }, "CRMP2": { "id": "NCBIGene:39729339", "name": "CRMP2" }, "RAMP1 gene": { "id": "NCBIGene:10267", "name": "RAMP1" }, "TGR5": { "id": "NCBIGene:317756", "name": "GPBAR1" }, "Gpbar1": { "id": "NCBIGene:151306", "name": "GPBAR1" }, "Trpv1": { "id": "NCBIGene:7442", "name": "TRPV1" }, "Ccl2": { "id": "NCBIGene:6347", "name": "CCL2" }, "ELF1": { "id": "NCBIGene:1997", "name": "ELF1" }, "Tropomyosin Receptor Kinase A (TrkA)": { "id": "NCBIGene:490404", "name": "NTRK1" }, "Npy1r": { "id": "NCBIGene:4886", "name": "NPY1R" }, "Adaptor-associated protein kinase 1 (AAK1)": { "id": "NCBIGene:22848", "name": "AAK1" }, "NIS-lncRNA": { "id": "NCBIGene:102637887", "name": "Gm34583" }, "OPRM1": { "id": "NCBIGene:4988", "name": "OPRM1" }, "BDNF": { "id": "NCBIGene:627", "name": "BDNF" }, "CYP2D6": { "id": "NCBIGene:1565", "name": "CYP2D6" }, "OPRD1": { "id": "NCBIGene:4985", "name": "OPRD1" }, "OPRK1": { "id": "NCBIGene:4986", "name": "OPRK1" }, "HTR1B": { "id": "NCBIGene:3351", "name": "HTR1B" }, "POMC": { "id": "NCBIGene:5443", "name": "POMC" }, "SLC6A4": { "id": "NCBIGene:6532", "name": "SLC6A4" }, "Prodynorphin (PDYN)": { "id": "NCBIGene:485808", "name": "PDYN" }, "CCR5": { "id": "NCBIGene:1234", "name": "CCR5" }, "CCR8": { "id": "NCBIGene:1237", "name": "CCR8" }, "IL-1\u03b2": { "id": "NCBIGene:445965", "name": "il-18" }, "TNF\u03b1": { "id": null, "name": null }, "CCL3": { "id": "NCBIGene:6348", "name": "CCL3" }, "Runx2": { "id": "NCBIGene:860", "name": "RUNX2" }, "Gene": { "id": "NCBIGene:666214", "name": "1700049E17Rik1" } }, "Organism (biolink:None)": { "Ccr7-deficient (Ccr7-/- ) mice": { "id": "NCBIGene:1236", "name": "CCR7" }, "Tlr2-null mice": { "id": "MESH:D018345", "name": "Mice, Knockout" }, "Transgenic mice": { "id": "MESH:D008822", "name": "Mice, Transgenic" }, "Mouse": { "id": "PUBCHEM.COMPOUND:91976823", "name": "Mouse obestatin; Obestatin (mouse)" }, "C57BL/6 NaV1.8-tdTomato reporter mice": { "id": "MESH:D008810", "name": "Mice, Inbred C57BL" }, "C57BL/6-Pirt-GCaMP3 mice": { "id": "MESH:D008810", "name": "Mice, Inbred C57BL" }, "Experimental models": { "id": "UMLS:C0086272", "name": "Experimental Model" }, "Sexes": { "id": "UMLS:C4700468", "name": "adult gender dysphoria, sexually attracted to both sexes" }, "Mice": { "id": "NCBIGene:4280", "name": "MICE" }, "Human": { "id": "UniProtKB:Q4R497", "name": "Q4R497_MACFA Testis cDNA clone: QtsA-11487, similar to human human immunodeficiency virus type I enhancer bindingprotein 3 (HIVEP3) (trembl)" }, "Nonhuman primates": { "id": "UMLS:C0237798", "name": "Nonhuman primate" }, "American Indian/Alaska Native (AI/AN)": { "id": "UMLS:C1515945", "name": "American Indian or Alaska Native" }, "New Mexico (NM)": { "id": "UMLS:C0027972", "name": "New Mexico" }, "Youth Resiliency and Risk Survey (NM-YRRS)": { "id": "UMLS:C4738085", "name": "Youth Risk Behavior Survey - body weight panel" }, "American Indians and Alaska Natives (AI/AN)": { "id": "UMLS:C1515945", "name": "American Indian or Alaska Native" }, "Lateral Prefrontal Cortex (LPFC)": { "id": "UMLS:C4019110", "name": "lateral prefrontal cortex" }, "Neonates": { "id": "HP:0005756", "name": "Neonatal epiphyseal stippling" }, "Healthcare professionals": { "id": "UMLS:C0677358", "name": "Market services to healthcare professionals" }, "Nurses": { "id": "UMLS:C0028661", "name": "Nurses" }, "Nurse practitioners": { "id": "UMLS:C0028657", "name": "nurse practitioner" }, "Physicians": { "id": "UMLS:C0031831", "name": "Physicians" }, "United States": { "id": "UMLS:C0041703", "name": "United States" }, "Adolescents": { "id": "UMLS:C0001588", "name": "Adolescents, Female" }, "Emerging adults": { "id": "UMLS:C0872315", "name": "Communicable Diseases, Emerging" }, "Surgical patients": { "id": "UMLS:C0871463", "name": "surgical patients" }, "Emergency medicine patients": { "id": "UMLS:C1555740", "name": "Pediatric Emergency Medicine - Emergency Medicine - Physicians" }, "Dental patients": { "id": "UMLS:C0226984", "name": "Dental" }, "Breast": { "id": "UBERON:0000310", "name": "breast" }, "West Virginia (WV)": { "id": "UMLS:C0043127", "name": "West Virginia" }, "Mother-infant dyad": { "id": "UMLS:C3658199", "name": "Mother-Infant Interaction" }, "Pregnant women in rural communities": { "id": "UMLS:C0033011", "name": "Pregnant Women" }, "MyBehaviorCBP": { "id": null, "name": null }, "Teaching hospitals": { "id": "UMLS:C0020027", "name": "Teaching Hospitals" }, "Nonteaching hospitals": { "id": "UMLS:C0020028", "name": "Hospitals, University" }, "West Virginia": { "id": "UMLS:C0043127", "name": "West Virginia" }, "West Virginia University Medicine health care system": { "id": "UMLS:C0043127", "name": "West Virginia" }, "Centers for Disease Control and Prevention WONDER (Wide-ranging ONline Data for Epidemiologic Research)": { "id": "UMLS:C0007670", "name": "Centers for Disease Control and Prevention (U.S.)" }, "Rat": { "id": "UMLS:C0034685", "name": "Rat Nematode" }, "Non-Hispanic black (NHB)": { "id": "UMLS:C1533017", "name": "Hispanic black finding" }, "Non-Hispanic white": { "id": "UMLS:C3843227", "name": "White/Not Hispanic" }, "Veterans": { "id": "UMLS:C0042610", "name": "Veterans" }, "Non-Hispanic Black (NHB)": { "id": "UMLS:C1533017", "name": "Hispanic black finding" }, "Non-Hispanic White (NHW)": { "id": "UMLS:C1533020", "name": "Hispanic white finding" }, "Patient": { "id": "UMLS:C0586634", "name": "Drug declined by patient - patient beliefs" }, "Surgeon": { "id": "UMLS:C0582175", "name": "Surgeon" }, "Medicare beneficiaries \u226565 years old": { "id": "UMLS:C0596728", "name": "human old age (65+)" }, "Cannabis": { "id": "NCBITaxon:3482", "name": "Cannabis" }, "Medicaid": { "id": "UMLS:C0025071", "name": "Medicaid" }, "Pain Management Collaboratory (PMC)": { "id": "UMLS:C0747141", "name": "pain chronic management" }, "US Department of Defense (DoD)": { "id": "UMLS:C1511775", "name": "Department of Defense" }, "Department of Veterans Affairs (VA)": { "id": "UMLS:C3496098", "name": "Department of Veterans Affairs Medical Benefits Plan" }, "National Institutes of Health (NIH)": { "id": "UMLS:C0027468", "name": "United States National Institutes of Health" }, "Military Treatment Facility Engagement Committee (MTFEC)": { "id": "UMLS:C3530278", "name": "Military Treatment Facility" }, "Military Treatment Facilities (MTFs)": { "id": "UMLS:C2936503", "name": "Military Facilities" }, "VA Medical Centers (VAMCs)": { "id": "UMLS:C0000872", "name": "Academic Medical Centers" }, "Hepatitis C virus": { "id": "UMLS:C0220847", "name": "hepatitis C virus" }, "Black children": { "id": "UMLS:C0418953", "name": "Children reassured" }, "White children": { "id": "NCBIGene:100499163", "name": "white" }, "Veterinary": { "id": "UMLS:C5445154", "name": "Veterinary" }, "IBM MarketScan Research databases": { "id": "UMLS:C0242356", "name": "Databases" }, "Heron Therapeutics": { "id": "UMLS:C0325437", "name": "Heron (bird)" }, "UM Michigan Genomics Initiative": { "id": "UMLS:C0424093", "name": "Initiative" }, "Non-Hispanic White individuals": { "id": "UMLS:C1533020", "name": "Hispanic white finding" }, "Black individuals": { "id": "UMLS:C0439541", "name": "Black color" }, "Hispanic individuals": { "id": "UMLS:C0086409", "name": "Hispanics" }, "Asian individuals": { "id": "UNII:CUQ3A77YXI", "name": "ASIAN GINSENG" }, "Native American individuals": { "id": "UMLS:C0886378", "name": "Native American Healing" }, "White individuals": { "id": "NCBIGene:100499163", "name": "white" }, "People who inject drugs (PWID)": { "id": "UMLS:C5545326", "name": "People Who Inject Drugs" }, "Brachial Plexus": { "id": "UBERON:0001814", "name": "brachial nerve plexus" }, "Sciatic Nerve": { "id": "UBERON:0001322", "name": "sciatic nerve" }, "American Indian and Alaska Native (AIAN) communities": { "id": "UMLS:C3261247", "name": "American indian and alaska native alone" }, "At-risk populations": { "id": "UMLS:C0242444", "name": "Population at Risk" }, "Department of Veteran Affairs": { "id": "UMLS:C3496104", "name": "Department of Veterans Affairs provided non-veteran care" }, "American Indian youth and young adults": { "id": "UMLS:C0238598", "name": "Young Adult" }, "Infants": { "id": "UMLS:C0557792", "name": "Infants school" }, "Surgeons": { "id": "UMLS:C0520260", "name": "Two Surgeons" }, "Dentists": { "id": "UMLS:C0011442", "name": "Dentists, Women" }, "Methicillin-resistant Staphylococcus aureus (MRSA)": { "id": "MESH:D055624", "name": "Methicillin-Resistant Staphylococcus aureus" }, "Intestinal microbiota": { "id": "UMLS:C2985398", "name": "Intestinal Microbiome" }, "Gram+Clostridium spp.": { "id": "UMLS:C2238248", "name": "skin lesion Gram stain Clostridium" }, "Lumbar intervertebral discs": { "id": "UMLS:C0446400", "name": "Lumbar intervertebral discal level" }, "Patient subgroups": { "id": "UMLS:C2959833", "name": "Subgroups for targeted treatment back screening tool" }, "Paraspinal musculature (PSM)": { "id": "UBERON:0007271", "name": "appendage musculature" }, "Paraspinal muscles (PSM)": { "id": "UMLS:C0448353", "name": "Paraspinal Muscles" }, "Astronauts": { "id": "UMLS:C0242688", "name": "Astronauts" }, "Asymptomatic controls": { "id": "UMLS:C0262380", "name": "Asymptomatic bacteriuria" }, "Lean muscle composition": { "id": "UMLS:C4045993", "name": "Lean Six Sigma" }, "Spinal segments PSM quality and structure": { "id": "UMLS:C3498577", "name": "spinal segments" }, "Gut Microbiome": { "id": "UMLS:C0699819", "name": "Gut" }, "Somatosensory nervous system": { "id": "UMLS:C0682663", "name": "somatosensory nervous system" }, "Cornea": { "id": "UBERON:0000964", "name": "cornea" }, "Peripheral nerves": { "id": "UMLS:C0205100", "name": "Peripheral" }, "Sensory neurons": { "id": "UMLS:C0027883", "name": "Afferent neuron" }, "L5 spinal nerve": { "id": "UMLS:C2066982", "name": "nerve block of spinal accessory nerve" }, "L5 dorsal root ganglion (DRG)": { "id": "GO:1990791", "name": "dorsal root ganglion development" }, "Female": { "id": "UMLS:C0079341", "name": "Female Circumcision" }, "Male": { "id": "NCBIGene:914317", "name": "malE" }, "Adeno-associated virus (AAV) 5": { "id": "UMLS:C5553018", "name": "Adeno-Associated Virus Vector" }, "HEK293 cells": { "id": "UMLS:C2936239", "name": "HEK293 Cells" }, "Rodent": { "id": "MONDO:0024981", "name": "rodent disease" }, "Humans": { "id": "UMLS:C0237720", "name": "Humans Mates" }, "IL-10 knockout animals": { "id": "GTOPDB:4975", "name": "IL-10" }, "C57BL/6J mice": { "id": "MESH:D008810", "name": "Mice, Inbred C57BL" }, "Swiss Webster mice": { "id": "UMLS:C3805302", "name": "Swiss Webster mouse breed" }, "Human cells": { "id": "UMLS:C0427861", "name": "Human cells" }, "Adeno-associated virus 5": { "id": "NCBITaxon:82300", "name": "adeno-associated virus 5" }, "Cos-7 cells": { "id": "UMLS:C1257858", "name": "COS-7 Cells" }, "TG, DRG, NG/JG": { "id": "FB:FBgn0000495", "name": "drg" }, "NG/JG": { "id": "UMLS:C0083098", "name": "JG 365" }, "T10-L1 and L3-L5 DRG neurons": { "id": "FB:FBgn0000495", "name": "drg" }, "TG neurons": { "id": "NCBIGene:7038", "name": "TG" }, "Trigeminal Sensory Neuronal": { "id": "UBERON:0004132", "name": "trigeminal sensory nucleus" }, "Masseter Muscle": { "id": "UBERON:0001597", "name": "masseter muscle" }, "Common marmoset": { "id": "NCBITaxon:2301497", "name": "Common marmoset adenovirus" }, "Astrocytes": { "id": "UMLS:C0004112", "name": "Astrocytes" }, "Large-diameter afferent fibers (A\u03b2-fibers)": { "id": "UMLS:C1185619", "name": "Set of afferent nerve fibers" }, "Neurokinin 1 receptor\u2013positive (NK1R+) projection neurons": { "id": "NCBIGene:127512052", "name": "tacr1a" }, "Sensory Neuron": { "id": "CL:0000101", "name": "sensory neuron" }, "Men": { "id": "NCBIGene:47173", "name": "Men" }, "Women": { "id": "UMLS:C0043215", "name": "Women, Working" }, "Animal models": { "id": "MESH:D023421", "name": "Models, Animal" }, "Human models": { "id": "UMLS:C3826744", "name": "Models, Human Anatomy" }, "Pregnant women": { "id": "UMLS:C0033011", "name": "Pregnant Women" }, "Tobacco": { "id": "MESH:D062789", "name": "Tobacco Products" }, "American Indians and Alaska Natives (AI/ANs)": { "id": "UMLS:C1515945", "name": "American Indian or Alaska Native" }, "Project HOPE": { "id": "UMLS:C1709701", "name": "Project" }, "Oregon Health Plan (Medicaid)": { "id": "UMLS:C0018726", "name": "Health Plan Implementation" }, "Opioid users": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "First responders": { "id": "UMLS:C3178988", "name": "Emergency Responders" }, "Emergency department providers": { "id": "UMLS:C2077962", "name": "interventional services emergency department" }, "Electronic health record systems": { "id": "UMLS:C1555708", "name": "electronic health record - ActClassContainer" }, "NIDA Center for the Clinical Trials Network": { "id": "UMLS:C1516645", "name": "Clinical Trials Information for Patients" }, "US Preventative Services Task Force": { "id": "UMLS:C0869701", "name": "Preventative Dental Services" }, "New Hampshire residents": { "id": "UMLS:C0027969", "name": "New Hampshire" }, "Primary care (PC) patients": { "id": "UMLS:C0033137", "name": "Primary Health Care" }, "Emergency departments (EDs)": { "id": "UMLS:C0868958", "name": "Engineering departments" }, "2019 novel corona virus": { "id": "NCBITaxon:264224", "name": "Melongena corona corona" }, "Boston, Massachusetts": { "id": "UMLS:C0677620", "name": "Boston Pharmaceuticals" }, "Young adults (aged 18-25 years)": { "id": "UMLS:C0238598", "name": "Young Adult" }, "Older adults (aged \u226526 years)": { "id": "UMLS:C0079379", "name": "Frail Older Adults" }, "Vulnerable Veteran Innovative Patient-Aligned Care Team (PACT) Initiative": { "id": "UMLS:C0030679", "name": "Patient Care Team" }, "National Survey of Drug Use and Health (NSDUH)": { "id": "UMLS:C0376344", "name": "National Health and Nutrition Examination Survey" }, "Emergency departments (ED)": { "id": "UMLS:C0868958", "name": "Engineering departments" }, "African-American race": { "id": "UMLS:C5441680", "name": "Black or African American" }, "primary care patients": { "id": "UMLS:C0033137", "name": "Primary Health Care" }, "Infectious Disease (ID) specialists": { "id": "UMLS:C0586873", "name": "Infectious disease specialist" }, "Hospitalists": { "id": "UMLS:C0600620", "name": "Hospitalists" }, "Syringe services programs (SSPs)": { "id": "UMLS:C0242883", "name": "Needle-Exchange Programs" }, "Young adults (youth)": { "id": "UMLS:C0238598", "name": "Young Adult" }, "Oakland, California": { "id": "UMLS:C3827222", "name": "Oakland County, MI" }, "Pregnant Women with Opioid Use Disorder": { "id": "UMLS:C0033011", "name": "Pregnant Women" }, "Primary care physicians": { "id": "UMLS:C0033131", "name": "Primary Care Physicians" }, "Project ECHO": { "id": "UMLS:C1709701", "name": "Project" }, "Primary Care Clinicians": { "id": "UMLS:C0033137", "name": "Primary Health Care" }, "Minnesota": { "id": "UMLS:C0026183", "name": "Minnesota" }, "Hispanic/Latinx": { "id": "UMLS:C5691407", "name": "Latinx" }, "White": { "id": "NCBIGene:100499163", "name": "white" }, "Kratom (Mitragyna speciosa)": { "id": "UMLS:C1197867", "name": "Mitragyna speciosa" }, "Sprague-Dawley rats": { "id": "MESH:D017207", "name": "Rats, Sprague-Dawley" }, "Mitragyna speciosa (kratom)": { "id": "UMLS:C1197867", "name": "Mitragyna speciosa" }, "Beagle dogs": { "id": "UMLS:C0324306", "name": "Beagle" }, "Papaver somniferum": { "id": "NCBITaxon:3468", "name": "Papaver" }, "Animals": { "id": "MESH:D000818", "name": "Animals" }, "Rats": { "id": "MESH:D020303", "name": "Rats, Inbred Dahl" }, "Kratom": { "id": "UMLS:C4547828", "name": "kratom alkaloids" }, "Monkeys": { "id": "UMLS:C0026447", "name": "Monkeys" }, "CNS": { "id": "UMLS:C2919013", "name": "CNS STIMULATION (finding)" }, "GI tract": { "id": "NCBIGene:838883", "name": "GI" }, "Sprague Dawley rats": { "id": "MESH:D017207", "name": "Rats, Sprague-Dawley" }, "Mitragyna speciosa": { "id": "NCBITaxon:170021", "name": "Mitragyna" }, "Balb/c mice": { "id": "MESH:D008807", "name": "Mice, Inbred BALB C" }, "Rhesus Monkeys": { "id": "NCBITaxon:9544", "name": "Macaca mulatta" }, "Male Rats": { "id": "NCBIGene:914317", "name": "malE" }, "Female Rats": { "id": "MESH:D020303", "name": "Rats, Inbred Dahl" }, "Mouse, Rat, Dog, Cynomolgus monkey": { "id": "UMLS:C2699535", "name": "Cynomolgus Maritius Monkey" }, "HEALing Communities Study (HCS)": { "id": "UMLS:C0086944", "name": "Rural Communities" }, "Communities That Heal (CTH) intervention": { "id": "UMLS:C0086944", "name": "Rural Communities" }, "Kentucky": { "id": "UMLS:C0022557", "name": "Kentucky (geographic area)" }, "Massachusetts": { "id": "UMLS:C0024874", "name": "Massachusetts (geographic location)" }, "New York": { "id": "UMLS:C0205314", "name": "New" }, "Ohio": { "id": "UMLS:C0028905", "name": "Ohio" }, "Healthcare providers": { "id": "UMLS:C0018724", "name": "Health Personnel" }, "Physician": { "id": "UMLS:C0031822", "name": "Physician Impairment" }, "Safer opioid prescribing guidelines": { "id": "UMLS:C2350518", "name": "Electronic Prescribing" }, "Patients": { "id": "UMLS:C0030705", "name": "Patients" }, "Prescriber": { "id": "UMLS:C1555293", "name": "Prescriber Declined Change" }, "Pharmacist": { "id": "UMLS:C0031323", "name": "Pharmacist" }, "Insurance": { "id": "UMLS:C0021672", "name": "Insurance" }, "Appalachian counties": { "id": "UMLS:C0003609", "name": "Appalachian Region" }, "Families": { "id": "UMLS:C3852959", "name": "Families of Veterans" }, "Fetuses": { "id": "UMLS:C0551995", "name": "Fetuses:Num:Pt:^Patient:Qn:US" }, "Adults": { "id": "UMLS:C5425880", "name": "Adults >65 years old" }, "juvenile justice system": { "id": "UMLS:C1510553", "name": "Juvenile Justice" }, "Veterans Health Administration (VHA) facilities": { "id": "UMLS:C4763569", "name": "Veterans Health Administration" }, "Community Supervision (CS) and Behavioral Health (BH) providers": { "id": "UMLS:C4280183", "name": "Agencies; Community/Behavioral Health" }, "Justice-involved youth": { "id": "UMLS:C0037422", "name": "Social Justice" }, "Juvenile offenders": { "id": "UMLS:C3146221", "name": "Juvenile" }, "MassJCOIN": { "id": null, "name": null }, "Black adults": { "id": "UMLS:C0439541", "name": "Black color" }, "White adults": { "id": "NCBIGene:100499163", "name": "white" }, "Formerly Incarcerated Persons": { "id": "UMLS:C2108012", "name": "contact with recently incarcerated persons" }, "Women who use drugs": { "id": "UMLS:C4727511", "name": "Women who Have Mastectomy" }, "Youth involved in the justice system": { "id": "NCBIGene:4851746", "name": "UTH1" }, "Criminal justice involved (CJI) individuals": { "id": "UMLS:C0086072", "name": "Criminal Justice" }, "criminal justice settings": { "id": "UMLS:C0086072", "name": "Criminal Justice" }, "Dorsal root ganglion neurons": { "id": "UBERON:0000044", "name": "dorsal root ganglion" }, "Human mesenchymal stem cells (hMSCs)": { "id": "UMLS:C5400079", "name": "Adult human mesenchymal stem cells" }, "Homeless youth": { "id": "UMLS:C0242663", "name": "Homeless Youth" }, "BALBc mice": { "id": "MESH:D008816", "name": "Mice, Jimpy" }, "Spinal cord": { "id": "UMLS:C0521329", "name": "Spinal" }, "MRGPRX1 mice": { "id": "NCBIGene:259249", "name": "MRGPRX1" }, "Twitter": { "id": "UMLS:C2936193", "name": "Twitter Messaging" }, "Children": { "id": "UMLS:C0418953", "name": "Children reassured" }, "Parents": { "id": "UMLS:C0425164", "name": "Parents separated" }, "White race": { "id": "NCBIGene:100499163", "name": "white" }, "Non-Hispanic whites": { "id": "UMLS:C1518424", "name": "Not Hispanic or Latino" }, "Non-Hispanic blacks": { "id": "UMLS:C1518424", "name": "Not Hispanic or Latino" }, "Prescription drug monitoring programs (PDMPs)": { "id": "UMLS:C4505167", "name": "Prescription Drug Monitoring Programs" }, "Opioid prescribing policies": { "id": "UMLS:C2350518", "name": "Electronic Prescribing" }, "Federal regulation of prescription opioids": { "id": "UMLS:C0033080", "name": "Prescription procedure" }, "Pain clinic laws": { "id": "UMLS:C0420379", "name": "Refer to pain clinic" }, "Treatment-related policies": { "id": "UMLS:C2825306", "name": "Treatment related leukaemia" }, "Overdose prevention policies": { "id": "UMLS:C0742770", "name": "Prevention problem" }, "US 12th-grade students": { "id": "UMLS:C1883615", "name": "12th Grade Completion, No Diploma" }, "Juvenile probation officers": { "id": "UMLS:C0401946", "name": "Probation officer" }, "US Department of Health and Human Services": { "id": "UMLS:C0041711", "name": "United States Dept. of Health and Human Services" }, "United States youth": { "id": "UMLS:C0041703", "name": "United States" }, "Fathers": { "id": "UMLS:C0870102", "name": "Adolescent Fathers" }, "Biological sex": { "id": "UMLS:C0205460", "name": "biological" }, "Adolescents and young adults (AYAs)": { "id": "UMLS:C0238598", "name": "Young Adult" }, "National Health Interview Survey (NHIS)": { "id": "UMLS:C1513894", "name": "National Health Interview Survey" }, "National Death Index": { "id": "UMLS:C3889680", "name": "National Death Index" }, "Adolescent": { "id": "UMLS:C5545196", "name": "Adolescent Trauma" }, "Academic schools": { "id": "UMLS:C3242376", "name": "Academic title" }, "Prepped-for-college schools": { "id": "UMLS:C0036381", "name": "Schools, Pharmacy" }, "Party schools": { "id": "UMLS:C1518904", "name": "Party" }, "Advanced practice clinicians (APCs)": { "id": "UMLS:C1510818", "name": "Advanced Practice Nurse" }, "Nurse practitioners (NPs)": { "id": "UMLS:C0028657", "name": "nurse practitioner" }, "Physician assistants (PAs)": { "id": "UMLS:C0031833", "name": "Physician Assistant" }, "American Indian/Alaska Native (AI/AN) populations": { "id": "UMLS:C1515945", "name": "American Indian or Alaska Native" }, "White populations": { "id": "NCBIGene:100499163", "name": "white" }, "Pediatric Patients": { "id": "UMLS:C1521725", "name": "Pediatric" }, "Adolescents and young adults (AYA)": { "id": "UMLS:C0238598", "name": "Young Adult" }, "transition-age youth": { "id": "UMLS:C0562982", "name": "Youth club" }, "NPAS2-deficient (NPAS2-/-) mice": { "id": "NCBIGene:4862", "name": "NPAS2" }, "Male NPAS2-/- mice": { "id": "MESH:D008816", "name": "Mice, Jimpy" }, "Humanized transgenic BERK sickle mice": { "id": "MESH:D008822", "name": "Mice, Transgenic" }, "Neural Targets": { "id": "UMLS:C3714606", "name": "Neural" }, "Cats": { "id": "NCBIGene:100196462", "name": "cats" } }, "Body Part (biolink:None)": { "Subchondral bone": { "id": "UMLS:C0038529", "name": "Subchondral Cysts" } }, "Antibody (biolink:ChemicalEntity)": { "Tanuzemab": { "id": null, "name": null }, "Fasinumab": { "id": "GTOPDB:8965", "name": "fasinumab" } }, "Drug (biolink:Drug)": { "Zoledronate": { "id": "UMLS:C2700333", "name": "Zoledronate Trisodium" }, "Analgesics": { "id": "UMLS:C4722089", "name": "Analgesics [TC]" }, "Sumatriptan": { "id": "PUBCHEM.COMPOUND:5358", "name": "Sumatriptan" }, "Buprenorphine": { "id": "PUBCHEM.COMPOUND:644073", "name": "Buprenorphine" }, "Pimavanserin": { "id": "PUBCHEM.COMPOUND:10071196", "name": "Pimavanserin" }, "Lorcaserin": { "id": "PUBCHEM.COMPOUND:11658860", "name": "Lorcaserin" }, "Opioid": { "id": "UMLS:C1883695", "name": "Opioid Agonist [EPC]" }, "Codeine": { "id": "PUBCHEM.COMPOUND:5284371", "name": "Codeine" }, "Alternative opioid": { "id": "UMLS:C1883695", "name": "Opioid Agonist [EPC]" }, "Cocaine": { "id": "PUBCHEM.COMPOUND:446220", "name": "Cocaine" }, "Naltrexone long-acting injection": { "id": "UMLS:C4067409", "name": "Injection, pasireotide long acting, 1 mg" }, "Duloxetine": { "id": "UMLS:C5141349", "name": "DULoxetine/Creatinine" }, "Buprenorphine/naloxone (B/N)": { "id": "UMLS:C1169989", "name": "buprenorphine / naloxone" }, "Medication for opioid use disorder (MOUD)": { "id": "UMLS:C0700163", "name": "cholera vaccine for injectable use" }, "Methadone treatment (MT)": { "id": "PUBCHEM.COMPOUND:4095", "name": "Methadone" }, "reSET-O": { "id": "UMLS:C5557710", "name": "HOVENIA DULCIS WHOLE 19 g in 100 mL TOPICAL LIQUID [Reset U]" }, "Therapeutic Education System": { "id": "UMLS:C0872370", "name": "therapeutic enzyme" }, "Benzodiazepines": { "id": "UMLS:C0682799", "name": "benzodiazepines for alcohol withdrawal" }, "Pioglitazone": { "id": "PUBCHEM.COMPOUND:4829", "name": "Pioglitazone" }, "Azithromycin": { "id": "PUBCHEM.COMPOUND:447043", "name": "Azithromycin" }, "Clonidine": { "id": "PUBCHEM.COMPOUND:2803", "name": "Clonidine" }, "Meloxicam": { "id": "PUBCHEM.COMPOUND:54677470", "name": "Meloxicam" }, "Cyclooxygenase 2 inhibitor (celecoxib)": { "id": "UMLS:C3536910", "name": "Cyclooxygenase Inhibitor [EPC]" }, "Propranolol": { "id": "PUBCHEM.COMPOUND:4946", "name": "Propranolol" }, "Guanethidine": { "id": "PUBCHEM.COMPOUND:3518", "name": "Guanethidine" }, "Hydromorphone": { "id": "PUBCHEM.COMPOUND:5284570", "name": "Hydromorphone" }, "Injection naltrexone": { "id": "PUBCHEM.COMPOUND:5360515", "name": "Naltrexone" }, "Extended-release injection naltrexone (XR-NTX)": { "id": "RXCUI:863844", "name": "" }, "Extended-release naltrexone (XR-NTX)": { "id": "RXCUI:863844", "name": "" }, "Buprenorphine-naloxone (BUP-NX)": { "id": "UMLS:C1169989", "name": "buprenorphine / naloxone" }, "Antidepressant medication": { "id": "UMLS:C0003289", "name": "Antidepressive Agents" }, "Buprenorphine/naloxone": { "id": "UMLS:C4067597", "name": "Buprenorphine/naloxone, oral, greater than 10 mg buprenorphine" }, "Methadone": { "id": "PUBCHEM.COMPOUND:4095", "name": "Methadone" }, "Buprenorphine/Naloxone": { "id": "UMLS:C4067597", "name": "Buprenorphine/naloxone, oral, greater than 10 mg buprenorphine" }, "Heroin": { "id": "PUBCHEM.COMPOUND:5462328", "name": "Heroin" }, "Hydrocodone": { "id": "PUBCHEM.COMPOUND:5284569", "name": "Hydrocodone" }, "Oxycodone": { "id": "PUBCHEM.COMPOUND:5284603", "name": "Oxycodone" }, "Opioid analgesics": { "id": "UMLS:C0242937", "name": "Analgesics, Non-Narcotic" }, "Extended-release naltrexone": { "id": "UMLS:C4720160", "name": "Naltrexone and Bupropion Hydrochlorides Extended-Release Tablets" }, "Extended-release injectable naltrexone (XR-NTX)": { "id": "RXCUI:863844", "name": "" }, "Buprenorphine-naloxone": { "id": "UMLS:C1169989", "name": "buprenorphine / naloxone" }, "Naloxone": { "id": "PUBCHEM.COMPOUND:5284596", "name": "Naloxone" }, "Naltrexone": { "id": "PUBCHEM.COMPOUND:5360515", "name": "Naltrexone" }, "Medications for opioid use disorder (MOUD)": { "id": "UMLS:C0849171", "name": "medications for the reproductive system" }, "Medications for alcohol use disorder (MAUD)": { "id": "UMLS:C0849171", "name": "medications for the reproductive system" }, "Extended release (XR) injectable naltrexone": { "id": "UMLS:C4720160", "name": "Naltrexone and Bupropion Hydrochlorides Extended-Release Tablets" }, "Sublingual buprenorphine-naloxone": { "id": "RXCUI:378762", "name": "" }, "Sublingual buprenorphine-naloxone (BUP-NX)": { "id": "RXCUI:378762", "name": "" }, "Extended-Release Naltrexone": { "id": "UMLS:C4720160", "name": "Naltrexone and Bupropion Hydrochlorides Extended-Release Tablets" }, "Oral naltrexone": { "id": "UMLS:C5777566", "name": "Naltrexone Hydrochloride 4.5 MG Oral Capsule" }, "Tramadol": { "id": "UMLS:C4301630", "name": "tramadol, dexketoprofen drug combination" }, "Olanzapine": { "id": "PUBCHEM.COMPOUND:135398745", "name": "Olanzapine" }, "Mirtazapine": { "id": "PUBCHEM.COMPOUND:4205", "name": "Mirtazapine" }, "Bupropion": { "id": "PUBCHEM.COMPOUND:444", "name": "Bupropion" }, "Atomoxetine": { "id": "PUBCHEM.COMPOUND:54840", "name": "Atomoxetine hydrochloride" }, "Long-acting injectable buprenorphine": { "id": "UMLS:C4055994", "name": "Buprenorphine 0.3 MG/ML Injection includes Cartridge" }, "Extended-Release Naltrexone (XR-NTX)": { "id": "RXCUI:863844", "name": "" }, "Buprenorphine-Naloxone (BUP-NX)": { "id": "UMLS:C1169989", "name": "buprenorphine / naloxone" }, "Buprenorphine-naloxone (BUP)": { "id": "UMLS:C1169989", "name": "buprenorphine / naloxone" }, "Methadone (MET)": { "id": "PUBCHEM.COMPOUND:4095", "name": "Methadone" }, "Extended release naltrexone": { "id": "UMLS:C4720160", "name": "Naltrexone and Bupropion Hydrochlorides Extended-Release Tablets" }, "Buprenorphine/naloxone (Suboxone\u00ae; BUP)": { "id": "RXCUI:352990", "name": "" }, "Naltrexone (XR-NTX)": { "id": "PUBCHEM.COMPOUND:5360515", "name": "Naltrexone" }, "Buprenorphine-Naloxone": { "id": "UMLS:C1169989", "name": "buprenorphine / naloxone" }, "Injection Naltrexone": { "id": "PUBCHEM.COMPOUND:5360515", "name": "Naltrexone" }, "Injectable Extended-release Naltrexone": { "id": "UMLS:C4720160", "name": "Naltrexone and Bupropion Hydrochlorides Extended-Release Tablets" }, "Intranasal Nalmefene": { "id": "UMLS:C0745378", "name": "intranasal drug" }, "Methocinnamox": { "id": null, "name": null }, "Fentanyl": { "id": "PUBCHEM.COMPOUND:3345", "name": "Fentanyl" }, "Liraglutide": { "id": "PUBCHEM.COMPOUND:16134956", "name": "Liraglutide" }, "Prescription opioid": { "id": "UMLS:C0304227", "name": "Prescription Drugs" }, "naloxone": { "id": "PUBCHEM.COMPOUND:5284596", "name": "Naloxone" }, "Food and Drug Administration-approved buprenorphine products": { "id": "UMLS:C1169989", "name": "buprenorphine / naloxone" }, "Serotonin reuptake inhibitors (SRI)": { "id": "UMLS:C0360105", "name": "Selective Serotonin Reuptake Inhibitors" }, "Hydroxyzine": { "id": "PUBCHEM.COMPOUND:3658", "name": "Hydroxyzine" }, "Opioids": { "id": "UMLS:C3653647", "name": "Opioids in combination with antispasmodics" }, "Benzodiazepines/sedatives": { "id": "UMLS:C0036557", "name": "Sedatives" }, "Naltrexone (NTX)": { "id": "PUBCHEM.COMPOUND:5360515", "name": "Naltrexone" }, "Buprenorphine (BUP)": { "id": "PUBCHEM.COMPOUND:644073", "name": "Buprenorphine" }, "Medications for opioid use disorder treatment (MOUD)": { "id": "UMLS:C3653798", "name": "AGENTS FOR TREATMENT OF HEMORRHOIDS AND ANAL FISSURES FOR TOPICAL USE" }, "Medications for OUD (MOUD)": { "id": "UMLS:C0849171", "name": "medications for the reproductive system" }, "Agonist medications": { "id": "UMLS:C0849171", "name": "medications for the reproductive system" }, "Medication for Opioid Use Disorder (MOUD)": { "id": "UMLS:C0700163", "name": "cholera vaccine for injectable use" }, "FDA approved medications for opioid use disorder (MOUD)": { "id": "UMLS:C0849171", "name": "medications for the reproductive system" }, "Medication for opioid use disorder": { "id": "UMLS:C0700163", "name": "cholera vaccine for injectable use" }, "Nifedipine": { "id": "PUBCHEM.COMPOUND:4485", "name": "Nifedipine" }, "Anxiolytics": { "id": "UMLS:C4722091", "name": "Anxiolytics [TC]" }, "Stimulants": { "id": "UMLS:C0242977", "name": "Stimulants, Historical" }, "Controlled medications": { "id": "UMLS:C0849171", "name": "medications for the reproductive system" }, "Benzodiazepine": { "id": "UMLS:C3536850", "name": "Benzodiazepine [EPC]" } }, "Chemical (biolink:ChemicalEntity)": { "Capsaicin": { "id": "PUBCHEM.COMPOUND:1548943", "name": "Capsaicin" }, "Algogenic factors": { "id": "UMLS:C0000779", "name": "ABO Factors" }, "Paclitaxel": { "id": "PUBCHEM.COMPOUND:36314", "name": "Paclitaxel" }, "TLR4 antagonist (LPS-RS)": { "id": "MESH:C000722692", "name": "TLR4 antagonist ApTOLL" }, "Paclitaxel (PAC)": { "id": "PUBCHEM.COMPOUND:36314", "name": "Paclitaxel" }, "XAV-939": { "id": "MESH:C000716507", "name": "XAV-19" }, "LGK-974": { "id": "MESH:C097468", "name": "HS 974" }, "iCRT14": { "id": "PUBCHEM.COMPOUND:5967294", "name": "(5Z)-5-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione" }, "Small molecule": { "id": "UMLS:C1328819", "name": "Small Molecule" }, "Anthrax toxins": { "id": "UMLS:C0162477", "name": "Toxins, Deactivated" }, "Edema toxin (ET (PA\u2009+\u2009EF))": { "id": "UMLS:C0105042", "name": "Anthrax toxin edema factor" }, "Botulinum toxin": { "id": "UNII:UC95NQ339C", "name": "BOTULINUM TOXIN" }, "Reactive oxygen species": { "id": "KEGG.COMPOUND:C22381", "name": "Reactive oxygen species" }, "Cannabigerol (CBG)": { "id": "PUBCHEM.COMPOUND:5315659", "name": "Cannabigerol" }, "Cyclo-CBG": { "id": "UMLS:C1452313", "name": "CBG brand of calcium gluconate" }, "Oxidized CBG metabolites": { "id": "UMLS:C1452313", "name": "CBG brand of calcium gluconate" }, "Opioid": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Social Support (SS)": { "id": "PUBCHEM.COMPOUND:178094", "name": "(SS)-(+)-Pseudoephedrinium salicylate" }, "Heroin": { "id": "PUBCHEM.COMPOUND:5462328", "name": "Heroin" }, "Alcohol": { "id": "CHEBI:30879", "name": "alcohol" }, "Cannabis": { "id": "UMLS:C0678449", "name": "Cannabis substance" }, "Oral morphine equivalents": { "id": "UMLS:C0360459", "name": "Morphine oral granules" }, "Tobacco": { "id": "MESH:D062789", "name": "Tobacco Products" }, "Arachidonic acid (AA)-containing diacylglycerols": { "id": "PUBCHEM.COMPOUND:6442096", "name": "Arachidonic acid-edta" }, "Triazole urea inhibitor KT109": { "id": "PUBCHEM.COMPOUND:66986262", "name": "2H-triazole;urea" }, "Liposome encapsulated KT109": { "id": "UMLS:C0935868", "name": "paclitaxel liposome" }, "Buprenorphine\u2009+\u2009naloxone": { "id": "UMLS:C1169989", "name": "buprenorphine / naloxone" }, "Morphine": { "id": "PUBCHEM.COMPOUND:5288826", "name": "Morphine" }, "2-arachidonyolglycerol": { "id": "PUBCHEM.COMPOUND:161187799", "name": "2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-Methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate;2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate;2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate;2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate;2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate;2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate" }, "JZL184": { "id": "PUBCHEM.COMPOUND:25021165", "name": "4-nitrophenyl 4-[bis(2H-1,3-benzodioxol-5-yl)(hydroxy)methyl]piperidine-1-carboxylate" }, "MJN110": { "id": "MESH:C587716", "name": "MJN110yne" }, "Opioids": { "id": "UMLS:C0242402", "name": "Opioids" }, "Opiate": { "id": "MESH:D053610", "name": "Opiate Alkaloids" }, "Opioid analgesics": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Methadone": { "id": "PUBCHEM.COMPOUND:4095", "name": "Methadone" }, "Buprenorphine": { "id": "PUBCHEM.COMPOUND:644073", "name": "Buprenorphine" }, "OUD medications": { "id": "UMLS:C2093625", "name": "medications and vaccines" }, "Analgesics": { "id": "UMLS:C4722089", "name": "Analgesics [TC]" }, "2at-LIGRL-NH2": { "id": "MESH:C000602226", "name": "2at-LIGRL-PEG3-Hdc" }, "Compound 48-80": { "id": "UMLS:C0009574", "name": "Compound 48-80" }, "C391": { "id": "PUBCHEM.COMPOUND:126970682", "name": "(2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[(3S)-1-(furan-2-carbonyl)-3-(3-methylbutanoylamino)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidin-8-yl]hexanoyl]amino]-4-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid" }, "Mobile health apps": { "id": "UMLS:C0079483", "name": "health hazards" }, "Substance Abuse Research Assistant (SARA)": { "id": "UMLS:C0687130", "name": "Substance of abuse" }, "Hydrocodone": { "id": "PUBCHEM.COMPOUND:5284569", "name": "Hydrocodone" }, "Oxycodone": { "id": "PUBCHEM.COMPOUND:5284603", "name": "Oxycodone" }, "Oral morphine equivalents (OME)": { "id": "UMLS:C0360459", "name": "Morphine oral granules" }, "Opioid prescriptions": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Oral morphine equivalents (OMEs)": { "id": "UMLS:C0360459", "name": "Morphine oral granules" }, "Substance use": { "id": "GTOPDB:2098", "name": "substance P" }, "Benzodiazepine": { "id": "CHEBI:22720", "name": "benzodiazepine" }, "Fentanyl": { "id": "PUBCHEM.COMPOUND:3345", "name": "Fentanyl" }, "Fentanyl analogs (FAs)": { "id": "UMLS:C1656695", "name": "fentanyl / ropivacaine" }, "Prescription opioids": { "id": "UMLS:C0242402", "name": "Opioids" }, "Alprazolam": { "id": "PUBCHEM.COMPOUND:2118", "name": "Alprazolam" }, "Ethanol": { "id": "PUBCHEM.COMPOUND:702", "name": "Ethanol" }, "Cocaine": { "id": "PUBCHEM.COMPOUND:446220", "name": "Cocaine" }, "Diazepam": { "id": "PUBCHEM.COMPOUND:3016", "name": "Diazepam" }, "Prescription Opioid": { "id": "UMLS:C0304227", "name": "Prescription Drugs" }, "Medical Marijuana": { "id": "MESH:D064086", "name": "Medical Marijuana" }, "IV-drug use": { "id": "UMLS:C0678506", "name": "schedule iv drugs" }, "Amphetamine": { "id": "PUBCHEM.COMPOUND:3007", "name": "Amphetamine" }, "Sedative": { "id": "UMLS:C0036557", "name": "Sedatives" }, "Mixed drug use": { "id": "CHEBI:37716", "name": "mixed diacylamine" }, "Activated Charcoal Bag": { "id": "PUBCHEM.COMPOUND:5462310", "name": "Activated Charcoal" }, "Unused Opioids": { "id": "UMLS:C0242402", "name": "Opioids" }, "Sodium Nitroprusside": { "id": "PUBCHEM.COMPOUND:11953895", "name": "Sodium nitroprusside" }, "Naltrexone (NTX)": { "id": "PUBCHEM.COMPOUND:5360515", "name": "Naltrexone" }, "Buprenorphine (BUP)": { "id": "PUBCHEM.COMPOUND:644073", "name": "Buprenorphine" }, "Placebo": { "id": "RXCUI:8375", "name": "" }, "Nocebo": { "id": null, "name": null }, "[C]-Carfentanil": { "id": "PUBCHEM.COMPOUND:449698", "name": "Carfentanil, C-11" }, "Hydrocodone-acetaminophen": { "id": "UMLS:C0717367", "name": "acetaminophen / hydrocodone" }, "Infrared Thermography": { "id": "UMLS:C1513912", "name": "Near-Infrared Fluorescence Imaging Probe" }, "Serotonin (5-hydroxytryptamine, 5-HT)": { "id": "UMLS:C0036753", "name": "Serotonin Antagonists" }, "Marijuana": { "id": "UMLS:C0304395", "name": "marijuana derivative" }, "Illicit drugs": { "id": "MESH:D013287", "name": "Illicit Drugs" }, "Multiple Opioids": { "id": "UMLS:C0242402", "name": "Opioids" }, "Stimulants": { "id": "UMLS:C0242977", "name": "Stimulants, Historical" }, "Cannabinoid": { "id": "UMLS:C0972645", "name": "Reagents, Immunoassay, Drug-of-Abuse, Cannabinoid/Cannabinoid Metabolite" }, "\u0394-9-tetrahydrocannabinol": { "id": "PUBCHEM.COMPOUND:2977", "name": "delta-8-Tetrahydrocannabinol" }, "Cannabidiol": { "id": "PUBCHEM.COMPOUND:644019", "name": "Cannabidiol" }, "Naloxone": { "id": "PUBCHEM.COMPOUND:5284596", "name": "Naloxone" }, "Opioid Prescription": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Opiates": { "id": "UMLS:C0376196", "name": "Opiates" }, "Medication": { "id": "UMLS:C0947324", "name": "Medication XXX" }, "THC": { "id": "UMLS:C2744379", "name": "THC 002" }, "Amphetamines": { "id": "CHEBI:35338", "name": "amphetamines" }, "Benzodiazepines": { "id": "UMLS:C0682799", "name": "benzodiazepines for alcohol withdrawal" }, "Medications": { "id": "UMLS:C2093625", "name": "medications and vaccines" }, "C660": { "id": "UMLS:C0663059", "name": "AR-C66096" }, "Ca2+": { "id": "PUBCHEM.COMPOUND:69472592", "name": "Ca2+ channel agonist 1" }, "Carrageenan": { "id": "CHEMBL.COMPOUND:CHEMBL2108264", "name": "CARRAGEENAN" }, "Dexmedetomidine": { "id": "PUBCHEM.COMPOUND:5311068", "name": "Dexmedetomidine" }, "Prescription opioid": { "id": "UMLS:C0304227", "name": "Prescription Drugs" }, "Methamphetamine": { "id": "PUBCHEM.COMPOUND:10836", "name": "Methamphetamine" }, "Buprenorphine/Naloxone": { "id": "PUBCHEM.COMPOUND:6321408", "name": "Buprenorphine/naloxone" }, "Ibuprofen": { "id": "PUBCHEM.COMPOUND:3672", "name": "Ibuprofen" }, "Acetaminophen": { "id": "PUBCHEM.COMPOUND:1983", "name": "Acetaminophen" }, "Serotonin (5-HT)": { "id": "PUBCHEM.COMPOUND:5202", "name": "Serotonin" }, "Local Anesthetic": { "id": "UMLS:C3536836", "name": "Local Anesthetic [EPC]" }, "Opioid use": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Prescription opioids (POs)": { "id": "UMLS:C5425812", "name": "Prescription opioids (fentanyl, oxycodone [OxyContin, Percocet], hydrocodone [Vicodin], methadone, buprenorphine, etc.)" }, "Nicotine": { "id": "PUBCHEM.COMPOUND:89594", "name": "Nicotine" }, "Mood disorder medication": { "id": "UMLS:C2917435", "name": "Mood Stabilizer" }, "Medication for OUD treatment": { "id": "UMLS:C2945846", "name": "medication for anaphylaxis" }, "Opioid medications": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Non-opioid analgesics": { "id": "UMLS:C0242937", "name": "Analgesics, Non-Narcotic" }, "Over-the-counter medications": { "id": "UMLS:C3176469", "name": "Over the counter medications" }, "Sedatives": { "id": "UMLS:C0036557", "name": "Sedatives" }, "Skeletal muscle relaxants": { "id": "UMLS:C0037250", "name": "skeletal muscle relaxants" }, "Substance P": { "id": "GTOPDB:2098", "name": "substance P" }, "Phenobarbital": { "id": "PUBCHEM.COMPOUND:4763", "name": "Phenobarbital" }, "Clonidine": { "id": "PUBCHEM.COMPOUND:2803", "name": "Clonidine" }, "CB-13": { "id": "UMLS:C4548695", "name": "CB-13" }, "Prostaglandin E 2": { "id": "PUBCHEM.COMPOUND:10274197", "name": "2-glyceryl-Prostaglandin F2alpha" }, "T1\u03c1": { "id": null, "name": null }, "T2": { "id": "PUBCHEM.COMPOUND:91398517", "name": "beta(T2-T2-T2)" }, "T2*": { "id": "PUBCHEM.COMPOUND:91398517", "name": "beta(T2-T2-T2)" }, "Bone marrow fat fraction (BMF)": { "id": "UMLS:C1292130", "name": "Bone marrow iron (substance)" }, "Water-fat MRI": { "id": "UNII:4G8X27X87A", "name": "MRI-1891" }, "Chemical shift encoding-based water-fat MRI (CSE-MRI)": { "id": "UMLS:C0043054", "name": "Water Pollutants, Chemical" }, "PSM fat fraction (FF)": { "id": "UNII:WX89LN81E5", "name": "E-PSM" }, "Visual analogue scale (VAS)": { "id": "UMLS:C2698965", "name": "Camptothecin Analogue TLC388" }, "MRI": { "id": "UNII:4G8X27X87A", "name": "MRI-1891" }, "Microgravity": { "id": null, "name": null }, "Buprenorphine/naloxone": { "id": "PUBCHEM.COMPOUND:6321408", "name": "Buprenorphine/naloxone" }, "Medications for Opioid Use Disorder": { "id": "UMLS:C0849171", "name": "medications for the reproductive system" }, "Glucocorticoids (GC)": { "id": "UMLS:C3540777", "name": "Glucocorticoids, Systemic" }, "Methylprednisolone (MP)": { "id": "UMLS:C2928989", "name": "aspirin / methylprednisolone" }, "Naltrexone": { "id": "PUBCHEM.COMPOUND:5360515", "name": "Naltrexone" }, "11C-Carfentanil (CFN)": { "id": "UMLS:C1609384", "name": "11C-CARFENTANIL" }, "Carfentanil": { "id": "PUBCHEM.COMPOUND:62156", "name": "Carfentanil" }, "Cyclopropyl fentanyl": { "id": "PUBCHEM.COMPOUND:123162", "name": "Cyclopropyl" }, "Para-fluorofentanyl": { "id": "UMLS:C4699935", "name": "Para-Fluorofentanyl" }, "Furanyl fentanyl": { "id": "PUBCHEM.COMPOUND:137699902", "name": "Furanyl fentanyl-d5" }, "Fentanyl-based haptens": { "id": "UMLS:C2348670", "name": "Fentanyl Citrate Pectin-Based Nasal Spray" }, "Alum": { "id": "MESH:C016975", "name": "alum hematoxylin" }, "Heroin Vaccine": { "id": "PUBCHEM.COMPOUND:5462328", "name": "Heroin" }, "6-AmHap": { "id": "PUBCHEM.COMPOUND:88949721", "name": "[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-(6-Dodeca-1,3,5,7,9,11-hexaynoxy-6-oxohexoxy)-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexyl] 6-hydroxyhexanoate" }, "Army Liposome Formulation adsorbed to aluminum hydroxide-ALFA": { "id": "UMLS:C2057668", "name": "tetanus toxoid, aluminum hydrate adsorbed" }, "DTaP vaccine": { "id": "UMLS:C0717716", "name": "DTaP-Haemophilus influenzae type b conjugate vaccine" }, "TT-6-AmHap vaccine": { "id": "MESH:C527605", "name": "Hib-MenCY-TT vaccine" }, "Complete Freund's adjuvant (CFA)": { "id": "MESH:D005620", "name": "Freund's Adjuvant" }, "IEM-1460": { "id": "PUBCHEM.COMPOUND:6604954", "name": "5-(1-Adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide" }, "CP-AMPAR antagonist naspm": { "id": "UMLS:C5392623", "name": "naspm" }, "Methylglyoxal (MG)": { "id": "PUBCHEM.COMPOUND:880", "name": "Methylglyoxal" }, "GERP10": { "id": null, "name": null }, "HC030031": { "id": "UMLS:C2976730", "name": "HC 030031" }, "NB001": { "id": "UMLS:C4045526", "name": "NB001" }, "HJC-0197": { "id": "PUBCHEM.COMPOUND:89154427", "name": "US9315491, Mtr-0197" }, "Cholesterol": { "id": "PUBCHEM.COMPOUND:5997", "name": "Cholesterol" }, "Lipid rafts": { "id": "CHEBI:18059", "name": "lipid" }, "Inflammaraft (i-raft)": { "id": "PUBCHEM.COMPOUND:102282820", "name": "RAFT Agent" }, "Redox molecules": { "id": "UMLS:C0961693", "name": "Redox Sensor Red" }, "Sphingolipid": { "id": "CHEBI:26739", "name": "sphingolipid" }, "Opioid Use": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Morphine Intake": { "id": "PUBCHEM.COMPOUND:5288826", "name": "Morphine" }, "Indomethacin": { "id": "PUBCHEM.COMPOUND:3715", "name": "Indomethacin" }, "NASPM": { "id": "UMLS:C5392623", "name": "naspm" }, "Antisense Oligonucleotide (ASO)": { "id": "UMLS:C4018803", "name": "Antisense Oligonucleotide [EPC]" }, "Sucrose": { "id": "PUBCHEM.COMPOUND:5988", "name": "Sucrose" }, "Complete Freund's Adjuvant (CFA)": { "id": "MESH:D005620", "name": "Freund's Adjuvant" }, "General anesthesia (GA)": { "id": "UMLS:C3540034", "name": "Ethers for general anesthesia" }, "Ketamine": { "id": "PUBCHEM.COMPOUND:3821", "name": "Ketamine" }, "Glutamate": { "id": "PUBCHEM.COMPOUND:4525487", "name": "Glutamate" }, "NPY-conjugated saporin neurotoxin": { "id": "MESH:C085696", "name": "192 IgG-saporin" }, "Y1 agonists": { "id": "UMLS:C0243192", "name": "agonists" }, "Histamine": { "id": "PUBCHEM.COMPOUND:774", "name": "Histamine" }, "LI-1": { "id": "PUBCHEM.COMPOUND:131801548", "name": "Li-Li Auxiliary, >=95%" }, "cAMP": { "id": "PUBCHEM.COMPOUND:71312192", "name": "cAMP AM" }, "Calcium": { "id": "PUBCHEM.COMPOUND:5460341", "name": "Calcium" }, "INCB3344": { "id": "PUBCHEM.COMPOUND:53419504", "name": "INCB3344 (stereoisomer 1)" }, "Liposomal clodronate": { "id": "UMLS:C0162357", "name": "Clodronate" }, "Allosteric modulators": { "id": "UMLS:C4743781", "name": "Allosteric Potentiator" }, "Cisplatin": { "id": "PUBCHEM.COMPOUND:5460033", "name": "Cisplatin" }, "Isosakuranetin": { "id": "PUBCHEM.COMPOUND:160481", "name": "Isosakuranetin" }, "Primidone": { "id": "PUBCHEM.COMPOUND:4909", "name": "Primidone" }, "CIM0216": { "id": "PUBCHEM.COMPOUND:42887770", "name": "N-(5-methyl-1,2-oxazol-3-yl)-2-phenyl-2-(1,2,3,4-tetrahydroquinolin-1-yl)acetamide" }, "Spantide I (Span)": { "id": "GTOPDB:2096", "name": "spantide I" }, "Cholestanol (Chol)": { "id": "PUBCHEM.COMPOUND:3240", "name": "Cholestanol" }, "Span-Chol": { "id": "MESH:C038777", "name": "chol-1 antigen" }, "Light": { "id": "GTOPDB:5070", "name": "LIGHT" }, "Red light (660 nm)": { "id": "PUBCHEM.COMPOUND:23677992", "name": "Alizarine Light Red R" }, "Green light": { "id": "PUBCHEM.COMPOUND:71586897", "name": "Light green CF yellowish" }, "Prostaglandin E2": { "id": "UMLS:C3813211", "name": "Prostaglandin E2" }, "Dimethyl Fumarate": { "id": "PUBCHEM.COMPOUND:637568", "name": "Dimethyl Fumarate" }, "Dimethyl Fumarate activity": { "id": "PUBCHEM.COMPOUND:637568", "name": "Dimethyl Fumarate" }, "(\u00b1)-N-(3-fluoro-1-phenethylpiperidine-4-yl)-N-phenyl propionamide (NFEPP)": { "id": "PUBCHEM.COMPOUND:154584403", "name": "N-(3-fluoro-1-phenethylpiperidine-4-yl)-N-phenyl propionamide" }, "Interleukin-2": { "id": "KEGG.COMPOUND:C07903", "name": "Interleukin-2" }, "RNA N6-methyladenosine": { "id": "KEGG.COMPOUND:C00046", "name": "RNA" }, "Meclofenamic acid": { "id": "PUBCHEM.COMPOUND:4037", "name": "Meclofenamic acid" }, "High-fat diet (HFD)": { "id": "UMLS:C0475907", "name": "Rite-Diet GF high fibre bread" }, "Plasmids encoding mouse CLR/CTR and RAMPs": { "id": "MESH:C000657484", "name": "MEDI0457" }, "Ligands": { "id": "UMLS:C0023688", "name": "Ligands" }, "Prostaglandin E2 (PGE2)": { "id": "UMLS:C3813211", "name": "Prostaglandin E2" }, "pegvisomant": { "id": "UNII:N824AOU5XV", "name": "PEGVISOMANT" }, "LY2456302": { "id": "UMLS:C3886583", "name": "LY2456302" }, "MK-801": { "id": "UMLS:C0813872", "name": "MK-801" }, "ESI-09": { "id": "UMLS:C3661133", "name": "ESI-09" }, "8-CPT": { "id": "PUBCHEM.COMPOUND:23672705", "name": "8-Cpt-camp" }, "H89": { "id": "MESH:C424122", "name": "FN-H89 fibronectin fragment" }, "6-bnz-cAMP": { "id": "PUBCHEM.COMPOUND:23672707", "name": "6-Bnz-cAMP sodium salt" }, "LY3000328": { "id": "PUBCHEM.COMPOUND:67475270", "name": "N-((3R,4S)-3,4-Dihydro-3-(((methylamino)carbonyl)oxy)-6-(4-(3-oxetanyl)-1-piperazinyl)-2H-1-benzopyran-4-yl)-4-fluorobenzamide" }, "5HT": { "id": "MESH:C098814", "name": "5HT-dro2B receptor" }, "AP2 inhibitor peptide": { "id": "MESH:C000606949", "name": "peptide-based inhibitor R9LF-1" }, "Adenosinergic mechanisms": { "id": "UMLS:C3825331", "name": "Dopaminergic mechanisms" }, "LTD": { "id": "GTOPDB:3353", "name": "LTD4" }, "Norepinephrine": { "id": "PUBCHEM.COMPOUND:439260", "name": "Norepinephrine" }, "Proinflammatory mediators": { "id": "UMLS:C0243042", "name": "Inflammation Mediators" }, "Anti-inflammatory mediators": { "id": "UMLS:C0002773", "name": "Analgesics, Anti-Inflammatory" }, "Endogenous opioids": { "id": "UMLS:C0205752", "name": "Endogenous Opiates" }, "Pro-nociceptive neurotransmitters": { "id": "UMLS:C0027908", "name": "Neurotransmitters" }, "ML204": { "id": "PUBCHEM.COMPOUND:49786978", "name": "ML204 hydrochloride" }, "Nitroglycerin (NTG)": { "id": "PUBCHEM.COMPOUND:4510", "name": "Nitroglycerin" }, "Nanomedicine": { "id": null, "name": null }, "Nanoparticle-based drug delivery": { "id": "MESH:D000090783", "name": "Nanoparticle Drug Delivery System" }, "NO": { "id": "GTOPDB:2509", "name": "NO" }, "ROS": { "id": "UMLS:C2352482", "name": "ROS 203" }, "CLR/RAMP1 antagonist": { "id": "PUBCHEM.COMPOUND:59513071", "name": "CLR-1502 cation" }, "Naltrindole": { "id": "GTOPDB:1641", "name": "naltrindole" }, "Pitstop 2": { "id": "PUBCHEM.COMPOUND:136227331", "name": "Pitstop 2" }, "Oxytocin (OT)": { "id": "PUBCHEM.COMPOUND:439302", "name": "Oxytocin" }, "Atosiban": { "id": "PUBCHEM.COMPOUND:5311010", "name": "Atosiban" }, "analgesic effect of OT": { "id": "UMLS:C3539971", "name": "otologic analgesic and anesthetic combinations" }, "Ritanserin": { "id": "PUBCHEM.COMPOUND:5074", "name": "Ritanserin" }, "SAFit2": { "id": "PUBCHEM.COMPOUND:86277887", "name": "SAFit2" }, "CCDC": { "id": "PUBCHEM.COMPOUND:44592018", "name": "CCDC 710249, HCl salt" }, "5\u03b1-pregnan-3\u03b2-ol-20-one sulphate, Pg5\u03b1": { "id": "PUBCHEM.COMPOUND:9910204", "name": "5alpha-Pregnan-3beta,20beta-diol 3-sulfate" }, "NIS-lncRNA ASOs": { "id": "PUBCHEM.COMPOUND:86598967", "name": "Nis dmf" }, "Methamphetamine (MA)": { "id": "PUBCHEM.COMPOUND:10836", "name": "Methamphetamine" }, "Carbon monoxide": { "id": "PUBCHEM.COMPOUND:281", "name": "Carbon Monoxide" }, "Crack cocaine (crack)": { "id": "MESH:D016578", "name": "Crack Cocaine" }, "Drug": { "id": "UMLS:C0304223", "name": "Drug flavoring" }, "Medication assisted treatment (MAT)": { "id": "UMLS:C2012940", "name": "tetrahydrocannabinol (medication)" }, "Pharmacotherapy": { "id": null, "name": null }, "Codeine": { "id": "PUBCHEM.COMPOUND:5284371", "name": "Codeine" }, "Tramadol": { "id": "UMLS:C1302924", "name": "Tramadol Hydrochloride/ Acetaminophen" }, "Fentanyl-laced heroin": { "id": "UMLS:C1656695", "name": "fentanyl / ropivacaine" }, "Prescription medication": { "id": "UMLS:C0304227", "name": "Prescription Drugs" }, "Illicit opioids": { "id": "MESH:D013287", "name": "Illicit Drugs" }, "Medications for opioid use disorder": { "id": "UMLS:C0849171", "name": "medications for the reproductive system" }, "Prescription opioid (PO)": { "id": "UMLS:C0304227", "name": "Prescription Drugs" }, "6-monoacetylmorphine (6-MAM)": { "id": "PUBCHEM.COMPOUND:520352", "name": "6-Monoacetylmorphine" }, "Benzoylecgonine": { "id": "PUBCHEM.COMPOUND:448223", "name": "Benzoylecgonine" }, "Amphetamine-Type Stimulants": { "id": "UMLS:C5188640", "name": "CNS stimulants amphetamine" }, "Buprenorphine-naloxone": { "id": "UMLS:C1169989", "name": "buprenorphine / naloxone" }, "Extended-release naltrexone": { "id": "UMLS:C4720160", "name": "Naltrexone and Bupropion Hydrochlorides Extended-Release Tablets" }, "Other drug use": { "id": "UMLS:C0813975", "name": "other specific drug of abuse" }, "Bupropion": { "id": "PUBCHEM.COMPOUND:444", "name": "Bupropion" }, "Sublingual Buprenorphine": { "id": "UMLS:C1169913", "name": "buprenorphine 2 MG / naloxone 0.5 MG Sublingual Tablet [Suboxone]" }, "7-day extended-release injectable Buprenorphine": { "id": "UMLS:C5433203", "name": "Buprenorphine Extended-Release Injection" }, "XR-NTX": { "id": "UMLS:C5418096", "name": "DNMT1 Inhibitor NTX-301" }, "Illicit/Rx drug": { "id": "UMLS:C0086190", "name": "Illicit Drugs" }, "Hallucinogens": { "id": "UMLS:C0018533", "name": "Hallucinogens" }, "P-FIBS": { "id": "MESH:C021190", "name": "FIBS" }, "Stimulant": { "id": "UMLS:C0304402", "name": "Stimulant" }, "Extended-release naltrexone (XR-NTX)": { "id": "RXCUI:863844", "name": "" }, "Cigarette": { "id": "UMLS:C0239059", "name": "Cigarette smoke (substance)" }, "Injection equipment (e.g. syringes, needles, cookers, cottons)": { "id": "UMLS:C2981124", "name": "GADOBUTROL 604.72 mg in 1 mL INTRAVENOUS INJECTION [Gadavist]" }, "Sublingual buprenorphine-naloxone": { "id": "RXCUI:378762", "name": "" }, "Injection naltrexone": { "id": "PUBCHEM.COMPOUND:5360515", "name": "Naltrexone" }, "Oxygen": { "id": "PUBCHEM.COMPOUND:977", "name": "Oxygen" }, "Opioid Agonist": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Opioid maintenance medication": { "id": "UMLS:C0947324", "name": "Medication XXX" }, "Central nervous system depressants": { "id": "UMLS:C0007681", "name": "Central Nervous System Depressants" }, "Alcohol Use Disorder Identification Test": { "id": "UMLS:C3688833", "name": "Test Kits, Home Use" }, "Drug Abuse Screening Tool": { "id": "UMLS:C1139705", "name": "Control Reagents, Drug-of-Abuse Test" }, "Opioid antagonists": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Morphine milligram equivalents (MMEs)": { "id": "PUBCHEM.COMPOUND:21124582", "name": "Morphine methiodide" }, "Methocinnamox (MCAM)": { "id": "PUBCHEM.COMPOUND:46877713", "name": "Methocinnamox" }, "Corynantheidine": { "id": "PUBCHEM.COMPOUND:3000341", "name": "Corynantheidine" }, "Corynoxine": { "id": "PUBCHEM.COMPOUND:10475115", "name": "Corynoxine" }, "Corynoxine B": { "id": "PUBCHEM.COMPOUND:10091424", "name": "Corynoxine B" }, "7-hydroxymitragynine": { "id": "PUBCHEM.COMPOUND:44301524", "name": "7-Hydroxymitragynine" }, "Isocorynantheidine": { "id": "PUBCHEM.COMPOUND:10948612", "name": "Isocorynantheidine" }, "Mitragynine": { "id": "PUBCHEM.COMPOUND:3034396", "name": "Mitragynine" }, "Mitraphylline": { "id": "PUBCHEM.COMPOUND:94160", "name": "Mitraphylline" }, "Paynantheine": { "id": "PUBCHEM.COMPOUND:3037629", "name": "Paynantheine" }, "Speciociliatine": { "id": "PUBCHEM.COMPOUND:15560576", "name": "Speciociliatine" }, "Speciogynine": { "id": "PUBCHEM.COMPOUND:15560577", "name": "Speciogynine" }, "\u03ba-Opioid Receptor Agonist Spiradoline": { "id": "UMLS:C1883695", "name": "Opioid Agonist [EPC]" }, "Indole-based kratom alkaloids": { "id": "UMLS:C4547828", "name": "kratom alkaloids" }, "Opioid vaccines": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Nonopioid medications": { "id": "UMLS:C2093625", "name": "medications and vaccines" }, "Azido Aryl Analogs of IBNtxA": { "id": "PUBCHEM.COMPOUND:51003467", "name": "IBNtxA" }, "3'-iodobenzoylnaltrexamide (IBNtxA)": { "id": "PUBCHEM.COMPOUND:51003467", "name": "IBNtxA" }, "Allyl and alkyne arylazido derivatives of IBNtxA": { "id": "PUBCHEM.COMPOUND:51003467", "name": "IBNtxA" }, "Salvinorin A": { "id": "KEGG.COMPOUND:C20196", "name": "Salvinorin A" }, "Collybolide": { "id": "PUBCHEM.COMPOUND:21669398", "name": "1-Hydroxy-collybolide" }, "Epoxy-fatty acids (EpFAs)": { "id": "CHEBI:61498", "name": "epoxy fatty acid" }, "1,3-disubstituted urea": { "id": "CHEBI:52534", "name": "5,15-disubstituted porphyrin" }, "Analgesic treatments": { "id": "CHEBI:35480", "name": "analgesic" }, "Covalent Naloxone Nanoparticles": { "id": "PUBCHEM.COMPOUND:71774987", "name": "(+)-Naloxone" }, "Fentanyl-binding Cyclodextrin Scaffolds": { "id": "UMLS:C1656695", "name": "fentanyl / ropivacaine" }, "Biomimetic 'Nanosponge' Decoy Receptors": { "id": "UMLS:C2699258", "name": "STAT3 Decoy Oligonucleotide" }, "Kindolor": { "id": null, "name": null }, "Investigational new drug (IND)": { "id": "UMLS:C0013230", "name": "Investigational New Drugs" }, "Carfentanyl": { "id": "PUBCHEM.COMPOUND:12297992", "name": "Butyryl-carfentanyl" }, "MP135": { "id": null, "name": null }, "Therapeutic and Prophylactic Vaccines": { "id": "MESH:D014612", "name": "Vaccines" }, "Prophylactic vaccination": { "id": "UMLS:C2052680", "name": "penicillin (oral) prophylactic" }, "Therapeutic vaccination": { "id": "UMLS:C0358509", "name": "Therapeutic radioisotope (product)" }, "Vaccines": { "id": "MESH:D014612", "name": "Vaccines" }, "pharmacological effects of commonly used anesthetics nor with methadone, naloxone, oxycodone, or heroin": { "id": "UMLS:C3848704", "name": "naloxone / oxycodone" }, "Saccharin": { "id": "PUBCHEM.COMPOUND:5143", "name": "Saccharin" }, "7-Hydroxymitragynine": { "id": "PUBCHEM.COMPOUND:44301524", "name": "7-Hydroxymitragynine" }, "Soluble Epoxide Hydrolase Inhibitor EC5026": { "id": "PUBCHEM.COMPOUND:46861626", "name": "Soluble epoxide hydrolase inhibitor" }, "Epoxides of polyunsaturated fatty acids (EpFA)": { "id": "UMLS:C0032615", "name": "Polyunsaturated Fatty Acids" }, "Bitopic modulators": { "id": "UMLS:C0242976", "name": "GABA Modulators" }, "3-hydroxy group": { "id": "CHEBI:195212", "name": "Group A carbohydrate" }, "Phenolic moiety": { "id": "CHEBI:139520", "name": "phenolic donor" }, "Lyophilized kratom tea (LKT)": { "id": "UMLS:C4547828", "name": "kratom alkaloids" }, "OPMS liquid shot": { "id": "MESH:C450828", "name": "shot protein, Drosophila" }, "Psychostimulants": { "id": "UMLS:C3653645", "name": "Psychostimulants in combination with psycholeptics" }, "Naltrexamine derivatives": { "id": "MESH:C576919", "name": "NAP naltrexamine" }, "Azaindole": { "id": "PUBCHEM.COMPOUND:56949332", "name": "Azaindole derivative 7" }, "Epoxymorphinan": { "id": "PUBCHEM.COMPOUND:22853338", "name": "Epoxymorphinan" }, "Opioid Ligands": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "RM1490": { "id": null, "name": null }, "Poly(lactide-co-glycolide) (PLGA)": { "id": "MESH:C000595637", "name": "poly(lactide-co-glycolide)-block-poly(ethylene glycol)-block-poly(lactide-co-glycolide)" }, "DAMGO": { "id": "PUBCHEM.COMPOUND:5462471", "name": "Damgo" }, "CFA": { "id": "PUBCHEM.COMPOUND:146035648", "name": "CFA-L-isoleucine" }, "Mitragyna speciosa (Kratom) Alkaloids": { "id": "UMLS:C4547828", "name": "kratom alkaloids" }, "9-O-desmethylspeciogynine": { "id": "MESH:C530420", "name": "9-O,9'-O-demethylvirgatusin" }, "9-O-desmethylpaynantheine": { "id": "MESH:C530420", "name": "9-O,9'-O-demethylvirgatusin" }, "Kratom Alkaloids": { "id": "UMLS:C4547828", "name": "kratom alkaloids" }, "Medications for OUD (MOUD)": { "id": "UMLS:C0849171", "name": "medications for the reproductive system" }, "mu opioids": { "id": "UMLS:C0242402", "name": "Opioids" }, "Nociceptin opioid peptide agonist Ro 64-6198": { "id": "UMLS:C1883695", "name": "Opioid Agonist [EPC]" }, "SB612111": { "id": null, "name": null }, "NAP": { "id": "PUBCHEM.COMPOUND:194599", "name": "Nap-nornicotine" }, "Methylnaltrexone": { "id": "PUBCHEM.COMPOUND:16088038", "name": "Methylnaltrexone, (17S)-" }, "Compound 19": { "id": "MESH:C506845", "name": "195A compound" }, "Kratom alkaloids": { "id": "UMLS:C4547828", "name": "kratom alkaloids" }, "Oxy(Gly)4-sKLH Conjugate Vaccine, Adsorbed (Oxy(Gly)4-sKLH)": { "id": "UMLS:C1329979", "name": "Anthrax Vaccine Adsorbed" }, "Aluminum adjuvant (alum)": { "id": "MESH:D005620", "name": "Freund's Adjuvant" }, "Kratom": { "id": "UMLS:C4547828", "name": "kratom alkaloids" }, "9-O-desmethyl metabolites": { "id": "PUBCHEM.COMPOUND:45270535", "name": "9-O-desmethyl kabiramide B" }, "2,5-dimethoxy-4-methylamphetamine (DOM)": { "id": "PUBCHEM.COMPOUND:85875", "name": "2,5-Dimethoxy-4-methylamphetamine" }, "Monovalent and bivalent vaccination strategies": { "id": "UMLS:C5392193", "name": "Bivalent Vaccines" }, "Alfentanil": { "id": "PUBCHEM.COMPOUND:51263", "name": "Alfentanil" }, "Sufentanil": { "id": "PUBCHEM.COMPOUND:41693", "name": "Sufentanil" }, "Acetylfentanyl": { "id": "PUBCHEM.COMPOUND:527015", "name": "Acetylfentanyl" }, "Liraglutide": { "id": "PUBCHEM.COMPOUND:16134956", "name": "Liraglutide" }, "Yohimbine": { "id": "UMLS:C1875867", "name": "yohimbine / zinc sulfate" }, "Suvorexant": { "id": "PUBCHEM.COMPOUND:24965990", "name": "Suvorexant" }, "GTP\u03b3S": { "id": null, "name": null }, "PLGA": { "id": "PUBCHEM.COMPOUND:59434218", "name": "PLGA(1k)-PEG(1k)-PLGA(1k)" }, "Dichloromethane": { "id": "PUBCHEM.COMPOUND:159383461", "name": "Dilithium;carbanide;dichloromethane;dichloromethane" }, "Benzyl alcohol": { "id": "PUBCHEM.COMPOUND:123147", "name": "Benzyl" }, "Non-opioid treatments": { "id": "UMLS:C0242937", "name": "Analgesics, Non-Narcotic" }, "Antibiotics": { "id": "UMLS:C0003232", "name": "Antibiotics" }, "Polysubstance": { "id": null, "name": null }, "Drugs": { "id": "UMLS:C0282568", "name": "Drugs, Essential" }, "Addictive Substances": { "id": "UMLS:C0242182", "name": "addictive analgesics" }, "Prenatal opioid exposure": { "id": "UMLS:C0772413", "name": "Prenatal vitamin" }, "Serotonin": { "id": "PUBCHEM.COMPOUND:5202", "name": "Serotonin" }, "Medications for opioid use disorder (MOUD)": { "id": "UMLS:C0849171", "name": "medications for the reproductive system" }, "Topical analgesics": { "id": "UMLS:C1874237", "name": "ANALGESICS,TOPICAL" }, "Gabapentinoids": { "id": null, "name": null }, "Serotonin-norepinephrine reuptake inhibitors": { "id": "UMLS:C1579361", "name": "Serotonin and Norepinephrine Reuptake Inhibitors (SNRIs)" }, "TCA": { "id": "MESH:C118440", "name": "TCA protein, Trichosanthes anguina" }, "NSAIDs": { "id": "PUBCHEM.COMPOUND:151249528", "name": "Nsaidswyowahas-uhfffaoysa-N" }, "Hydromorphone": { "id": "PUBCHEM.COMPOUND:5284570", "name": "Hydromorphone" }, "Illicit opioid": { "id": "MESH:D013287", "name": "Illicit Drugs" }, "Morphine milligram equivalents": { "id": "PUBCHEM.COMPOUND:21124582", "name": "Morphine methiodide" }, "Medications for OUD": { "id": "UMLS:C0849171", "name": "medications for the reproductive system" }, "Medications for Treatment of Opioid Use Disorder (MOUD)": { "id": "UMLS:C3540707", "name": "Antibiotics FOR TREATMENT OF HEMORRHOIDS AND ANAL FISSURES FOR TOPICAL USE" }, "Synthetic narcotics": { "id": "UMLS:C2039663", "name": "synthetic narcotics (medication)" }, "Contraception": { "id": "MESH:C115438", "name": "contraception associated protein 1" }, "Non-prescribed opioid": { "id": "UMLS:C0556027", "name": "Opioid - non-pharmaceutical" }, "Non-opioid injection drug": { "id": "UMLS:C3653526", "name": "Drugs used in opioid dependence" }, "Extended-release buprenorphine (XR-BUP)": { "id": "UMLS:C5433203", "name": "Buprenorphine Extended-Release Injection" }, "Endogenous Opioids": { "id": "UMLS:C0205752", "name": "Endogenous Opiates" }, "Biosensors": { "id": null, "name": null }, "Blood Alcohol Content (BAC)": { "id": "MESH:D000067401", "name": "Blood Alcohol Content" }, "Transdermal biosensors": { "id": "UMLS:C4722547", "name": "Transdermal CR1447" }, "Physical activity trackers": { "id": "UMLS:C1519072", "name": "Physical Carcinogens" }, "Physiological arousal sensors": { "id": "UMLS:C0311439", "name": "Simple physiological organic compound" }, "Direct channel blockers": { "id": "UMLS:C3653552", "name": "SELECTIVE CALCIUM CHANNEL BLOCKERS WITH DIRECT CARDIAC EFFECTS" }, "1,3,4-Oxadiazoles": { "id": "CHEBI:46810", "name": "1,3,4-oxadiazoles" }, "5-Chloro-N-(5- phenyl-1,3,4-oxadiazol-2-yl)thiophene-2-carboxamide (11)": { "id": "PUBCHEM.COMPOUND:69380568", "name": "5-[2-Chloro-5-(1,3,4-oxadiazol-2-yl)phenyl]thiophene-2-carboxamide" }, "morphine": { "id": "PUBCHEM.COMPOUND:5288826", "name": "Morphine" }, "Streptozotocin (STZ)": { "id": "PUBCHEM.COMPOUND:159859", "name": "Streptozotocin tetraacetate" }, "MSC-laden hyaluronic acid hydrogel": { "id": "UMLS:C5555775", "name": "Paclitaxel and Hyaluronic Acid" }, "Wnt/\u03b2-catenin inhibitor XAV939": { "id": "UMLS:C0591170", "name": "\u03b2-cardone" }, "Analgesic compounds": { "id": "CHEBI:35480", "name": "analgesic" }, "Pharmacological compounds": { "id": "UMLS:C1955886", "name": "Biomarkers, Pharmacological" }, "Lidocaine": { "id": "PUBCHEM.COMPOUND:3676", "name": "Lidocaine" }, "Graphene oxide (GO)": { "id": "CHEBI:132889", "name": "graphene oxide" }, "Silica-coated graphene oxide (SiGO)": { "id": "MESH:C000628730", "name": "graphene oxide" }, "LDN-193189": { "id": "PUBCHEM.COMPOUND:54613581", "name": "LDN-193189 monohydrochloride" }, "Neurotransmitter": { "id": "CHEBI:35942", "name": "neurotransmitter agent" }, "Thieno[2,3-d]pyrimidine": { "id": "PUBCHEM.COMPOUND:12225304", "name": "Thieno[2,3-d]pyrimidine" }, "Positive allosteric modulators (PAMs)": { "id": "UMLS:C0242976", "name": "GABA Modulators" }, "6-(tert-butyl)-5-(3,4-dichlorophenyl)-4-(2-(trifluoromethoxy)phenoxy)thieno[2,3-d]pyrimidine (1t)": { "id": "PUBCHEM.COMPOUND:163391881", "name": "6-Tert-butyl-5-(3,4-dichlorophenyl)-4-[4-(trifluoromethoxy)phenoxy]thieno[2,3-d]pyrimidine" }, "[D-Ala2, N-MePhe4, Gly-ol]-enkephalin": { "id": "PUBCHEM.COMPOUND:101981638", "name": "D-Ala2,MePhe4,Met5(O))enkephalinol" }, "Prescription Stimulants": { "id": "UMLS:C0242977", "name": "Stimulants, Historical" }, "NMUPS": { "id": null, "name": null }, "Controlled prescription medications": { "id": "UMLS:C0304227", "name": "Prescription Drugs" }, "Tranquilisers": { "id": "CHEBI:35474", "name": "anxiolytic drug" }, "Tranquillisers": { "id": "UMLS:C0040614", "name": "Tranquilizing Agents" }, "Medication-assisted treatment": { "id": "UMLS:C4020575", "name": "Treatment-Resistant" }, "Narcotics": { "id": "UMLS:C0027415", "name": "Narcotics" }, "Painkillers": { "id": "UMLS:C3843968", "name": "Painkillers, for example, codeine, darvon, percodan, oxycontin, dilaudid, demerol, celebrex or vioxx" }, "Prescription Opioids": { "id": "UMLS:C0242402", "name": "Opioids" }, "Prescription drug": { "id": "UMLS:C0013231", "name": "Drugs, Non-Prescription" }, "Chronic opioid prescriptions": { "id": "CHEBI:35482", "name": "opioid analgesic" }, "First-time opioid prescriptions": { "id": "CHEBI:35482", "name": "opioid analgesic" }, "Morphine milligram equivalents (MME)": { "id": "PUBCHEM.COMPOUND:21124582", "name": "Morphine methiodide" }, "Benzodiazepine prescriptions": { "id": "UMLS:C4048284", "name": "Benzodiazepine" }, "Long-acting opioids": { "id": "UMLS:C0309728", "name": "LONG ACTING PENICILLIN" }, "Opioid misuse": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Prescription opioid misuse": { "id": "UMLS:C0304227", "name": "Prescription Drugs" }, "Natural and semi-synthetic opioids": { "id": "CHEBI:87633", "name": "statin (semi-synthetic)" }, "Nonmedical cannabis use": { "id": "UMLS:C0678449", "name": "Cannabis substance" }, "Medical cannabis laws (MCLs)": { "id": "UMLS:C0813973", "name": "Medical Marijuana" }, "Substance": { "id": "UMLS:C2733550", "name": "Coagulation related substance" }, "Prescription medications": { "id": "UMLS:C0304227", "name": "Prescription Drugs" }, "Medical cannabis laws (MCL)": { "id": "UMLS:C0813973", "name": "Medical Marijuana" }, "Medication for opioid use disorder (MOUD)": { "id": "UMLS:C5700350", "name": "anthrax vaccine, for intramuscular use (medication)" }, "Drug treatment programs": { "id": "UMLS:C4287420", "name": "Substance Abuse Treatment Drug Pharmacogenetic Test Reagents" }, "Non-opioid pain medications": { "id": "UMLS:C0722136", "name": "Non-Aspirin Pain" }, "Non-steroidal anti-inflammatory drugs": { "id": "CHEBI:35475", "name": "non-steroidal anti-inflammatory drug" }, "Antidepressants": { "id": "UMLS:C1579362", "name": "ANTIDEPRESSANTS,OTHER" }, "Prescription drugs": { "id": "UMLS:C0304227", "name": "Prescription Drugs" }, "Tranquilizers": { "id": "UMLS:C0541496", "name": "Tranquilizers and Antidepressant Drugs" }, "Chondroitin Sulfate": { "id": "PUBCHEM.COMPOUND:53477707", "name": "Chondroitin" }, "Dopamine": { "id": "PUBCHEM.COMPOUND:681", "name": "Dopamine" }, "GABA": { "id": "CHEBI:51374", "name": "GABA agent" }, "Injectrode": { "id": null, "name": null }, "Stainless-steel electrode": { "id": "UNII:F0T1G9Y758", "name": "STAINLESS STEEL 316L" } }, "Biological Structure (biolink:AnatomicalEntity)": { "Peripheral nerves": { "id": "UMLS:C1184301", "name": "Set of peripheral nerves" }, "Meningeal nociceptors": { "id": "UBERON:0003474", "name": "meningeal artery" }, "Dural afferents": { "id": "UMLS:C0449764", "name": "Dural material" }, "Cartilage endplate (CEP)": { "id": "UBERON:0014386", "name": "vertebral endplate" }, "L4-S1 CEPs": { "id": "UMLS:C0447845", "name": "L4/S1 disc" }, "Pfirrmann grade II-III discs": { "id": "UBERON:8440000", "name": "cortical layer II/III" }, "Intervertebral disc": { "id": "UMLS:C0442106", "name": "Intervertebral" }, "Vertebral bone marrow fat (BMFF)": { "id": "NCIT:C77692", "name": "Bone Marrow, Vertebral" }, "Gut architecture": { "id": "UMLS:C0699819", "name": "Gut" }, "Microneuromas": { "id": null, "name": null }, "Lipid rafts": { "id": "UMLS:C1167250", "name": "lipid raft" }, "Sympathetic nerves": { "id": "UMLS:C0459521", "name": "Sympathetic nerve structure" }, "Dorsal root ganglia": { "id": "UBERON:0000044", "name": "dorsal root ganglion" }, "Spinal nociceptive circuitry": { "id": "UBERON:0035017", "name": "nociceptor" }, "Peptidergic afferents": { "id": "CL:0000110", "name": "peptidergic neuron" }, "Spinal sensory pathways": { "id": "CL:0009000", "name": "sensory neuron of spinal nerve" }, "Descending motor circuits": { "id": "UBERON:0001158", "name": "descending colon" }, "Dynamic functional connections": { "id": "GO:0099071", "name": "dynamic microtubule bundle" }, "Static functional connections": { "id": "UMLS:C4328790", "name": "static microtubule bundle" }, "Visual, subcortical, and default mode networks": { "id": "UMLS:C5380443", "name": "Default Mode Network" }, "Brain regions": { "id": "UBERON:0000955", "name": "brain" }, "Neural features": { "id": "UMLS:C0027792", "name": "Neural Pathways" } }, "Symptom (biolink:PhenotypicFeature)": { "Pain": { "id": "EFO:0003843", "name": "pain" }, "Disability": { "id": "UMLS:C0231170", "name": "Disability" }, "Joint damage": { "id": "EFO:0005413", "name": "joint damage measurement" }, "Nerve damage": { "id": "UMLS:C0235928", "name": "Vestibular nerve damage" }, "Joint pain": { "id": "UMLS:C0838224", "name": "Pain in joint involving forearm" }, "Chronic pain": { "id": "HP:0012532", "name": "Chronic pain" }, "Acute pain": { "id": "NCIT:C27003", "name": "Acute Pain" }, "Chronic persistent pain": { "id": "UMLS:C4546311", "name": "Chronic visceral pain due to persistent inflammation" }, "Patient-reported pain": { "id": "UMLS:C4047502", "name": "Patient reported problems" }, "Pain interference": { "id": "HP:0012531", "name": "Pain" }, "Facial grimacing": { "id": "HP:0000273", "name": "Facial grimacing" }, "Spinal stiffness": { "id": "UMLS:C0427008", "name": "Stiffness" }, "Surgical site pain": { "id": "UMLS:C0458087", "name": "Pain finding at anatomical site" }, "Pain in other body areas": { "id": "UMLS:C2370969", "name": "Pain in body part, other specified" }, "Combined pain": { "id": "UMLS:C0234250", "name": "Pain, Referred" }, "Headache": { "id": "HP:0002315", "name": "Headache" }, "Photosensitivity": { "id": "NCIT:C58005", "name": "Photosensitivity, CTCAE" }, "Hyperacusis": { "id": "UMLS:C2881988", "name": "Hyperacusis of right ear" }, "Insomnia": { "id": "NCIT:C146771", "name": "Insomnia, CTCAE 5.0" }, "Cutaneous allodynia": { "id": "UMLS:C1274924", "name": "Cutaneous allodynia" }, "Itch": { "id": "UMLS:C0858708", "name": "Itch burning" }, "Irritability": { "id": "HP:0000737", "name": "Irritability" }, "Panic": { "id": "NCIT:C94438", "name": "Panic" }, "Trauma": { "id": "UMLS:C1387429", "name": "trauma; history" }, "Suicide": { "id": "UMLS:C0038661", "name": "Suicide" }, "Pain intensity": { "id": "HP:0012531", "name": "Pain" }, "Distress": { "id": "NCIT:C37942", "name": "Distress" }, "Craving": { "id": "NCIT:C41365", "name": "Craving" }, "Movement-evoked pain": { "id": "UMLS:C0239430", "name": "Pain on eye movement" }, "Movement-evoked fatigue": { "id": "UMLS:C1406736", "name": "fatigue syndrome" }, "Hyperalgesia": { "id": "UMLS:C0751212", "name": "Hyperalgesia, Secondary" } }, "Biological Process (biolink:None)": { "Nociceptive drive": { "id": "UMLS:C3178766", "name": "Nociceptive Pain" }, "Central sensitization": { "id": "UMLS:C0205099", "name": "Central" }, "Structural reorganization of joint afferents": { "id": "UMLS:C3157427", "name": "regulation of actin cytoskeleton reorganization" }, "Low-grade inflammation": { "id": "UMLS:C1282907", "name": "Low Grade" }, "Neuroplasticity": { "id": "UMLS:C0027880", "name": "Neuronal Plasticity" }, "Innate immunity": { "id": "UMLS:C0020969", "name": "Immunity, Innate" }, "Nociceptor sensitization": { "id": "UBERON:0035017", "name": "nociceptor" }, "Peripheral neuronal pathways": { "id": "UMLS:C3544063", "name": "Pathways and sources of exposure" }, "Pain pathways": { "id": "HP:0012531", "name": "Pain" }, "Degenerating joint tissues": { "id": "UMLS:C3280565", "name": "Degenerating fibers" }, "Inflammation": { "id": "NCIT:C3137", "name": "Inflammation" }, "Injury": { "id": "UMLS:C4531571", "name": "Skin and pressure injury &or injury treatments during assessment period" }, "Neuroinflammation": { "id": "HP:0033429", "name": "Neuroinflammation" }, "Pregnancy": { "id": "UMLS:C0032961", "name": "Pregnancy" }, "Medication metabolism": { "id": "UMLS:C2198196", "name": "metabolism medication toxicity" }, "Treatment outcomes": { "id": "UMLS:C3665547", "name": "outcomes otolaryngology swallowing (treatment)" }, "Adverse events": { "id": "UMLS:C4288300", "name": "Report Adverse Events" }, "Mast cell degranulation": { "id": "UMLS:C1622891", "name": "Mast Cell Degranulation" }, "\u00b5-Opioid Activity": { "id": "GO:0001515", "name": "opioid peptide activity" }, "mu-opioid mechanisms": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Opioidergic system": { "id": "UMLS:C0449913", "name": "System" }, "Physical activity and health maintenance activities (PAHM)": { "id": "UMLS:C0811661", "name": "Monitor parental health status and health maintenance activities" }, "Multifidus muscle activation": { "id": "UMLS:C0224319", "name": "Structure of multifidus muscle" }, "Opioid Consumption": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Cardiovascular measures": { "id": "UMLS:C3887460", "name": "Cardiovascular" }, "Plasma cocaine levels": { "id": "UMLS:C4736669", "name": "cocaine in serum or plasma" }, "Visual analog scale (VAS) ratings": { "id": "UMLS:C3536884", "name": "Visual Analog Scale" }, "Thalamic functional connectivity": { "id": "UMLS:C3896579", "name": "Functional Connectivity Magnetic Resonance Imaging" }, "Thalamocortical connectivity": { "id": "UMLS:C3499251", "name": "thalamocortical systems" }, "Neurodevelopmental outcomes": { "id": "UMLS:C0086750", "name": "Outcomes Research" }, "Intestinal tissue protection": { "id": "UMLS:C0445096", "name": "Non-intestinal tissue" }, "Nociception": { "id": "UMLS:C0234194", "name": "Nociception" }, "Intestinal homeostasis": { "id": "GO:0036335", "name": "intestinal stem cell homeostasis" }, "Fat infiltration (FI)": { "id": "EFO:0020900", "name": "thigh muscle fat infiltration measurement\"@e" }, "Immune-metabolic response": { "id": "GO:0052572", "name": "response to host immune response" }, "Genetics": { "id": "UMLS:C4035178", "name": "Genetics/Genetics Counseling Clinic" }, "Interoceptive pathways": { "id": "UMLS:C0234416", "name": "Interoceptive conditioning" }, "interoceptive signals": { "id": "UMLS:C0234416", "name": "Interoceptive conditioning" }, "Interventions": { "id": "UMLS:C5443886", "name": "Interventions or enabling services provided" }, "interoception": { "id": "UMLS:C3850156", "name": "Interoception" }, "respiratory rate and depth": { "id": "UMLS:C0513708", "name": "Monitor respiratory rate and rhythm (e.g., depth and symmetry)" }, "functioning and adaptive behavior": { "id": "UMLS:C0085880", "name": "Behavior, Adaptive" }, "Immune response": { "id": "UMLS:C0439662", "name": "Immune" }, "Adaptive compartments": { "id": "UMLS:C0231193", "name": "adaptive" }, "Adaptive immune responses": { "id": "UMLS:C1749719", "name": "Adaptive Immune Response" }, "Nerve damage": { "id": "UBERON:0001021", "name": "nerve" }, "Peak alpha frequency (PAF)": { "id": "EFO:0006883", "name": "alpha peak frequency measurement" }, "Corticomotor excitability (CME)": { "id": "UMLS:C0235169", "name": "Excitability" }, "Immune Responses": { "id": "UMLS:C0439662", "name": "Immune" }, "Pain Development": { "id": "HP:0012531", "name": "Pain" }, "Microglial Activation": { "id": "UMLS:C0521398", "name": "microglial" }, "Pain Sensation": { "id": "HP:0012531", "name": "Pain" }, "Angiogenesis": { "id": "GO:0001525", "name": "angiogenesis" }, "Neuronal activity": { "id": "UMLS:C0521390", "name": "neuronal" }, "Optogenetic activation": { "id": "UMLS:C3494301", "name": "Optogenetics" }, "Locomotor function": { "id": "UMLS:C0023946", "name": "Locomotion" }, "Peripheral nerve regeneration": { "id": "UMLS:C0262593", "name": "Peripheral Nerve Injuries" }, "Sympathetic blockade": { "id": "UMLS:C0039043", "name": "Sympathetic Nerve Block" }, "Microsympathectomy": { "id": null, "name": null }, "Immune function": { "id": "UMLS:C0439662", "name": "Immune" }, "Subchondral sensory innervation": { "id": "UMLS:C0038529", "name": "Subchondral Cysts" }, "Transforming growth factor \u03b2 signaling": { "id": "UMLS:C0040691", "name": "Transforming Growth Factors" }, "Oxidative Stress": { "id": "UMLS:C0311404", "name": "Oxidative" }, "Pronociceptive Immune Responses": { "id": "UMLS:C2936254", "name": "Plant Immune Response" }, "Antioxidant systems": { "id": "CHEBI:22586", "name": "antioxidant" }, "Immune system activation": { "id": "UBERON:0002405", "name": "immune system" }, "MOPr endocytosis": { "id": "UniProtKB:B3PDA2", "name": "B3PDA2_CELJU MopR (trembl)" }, "nerve regeneration": { "id": "UMLS:C0027756", "name": "Nerve Regeneration" }, "Pain neurobiology": { "id": "HP:0012531", "name": "Pain" }, "Bone formation": { "id": "UMLS:C0176025", "name": "Formation of cranial bone flap" }, "Sensory nerve innervation": { "id": "UMLS:C0501385", "name": "Sensory nerve" }, "Endocytosis": { "id": "GO:0006897", "name": "endocytosis" }, "Sex differences": { "id": "UMLS:C1522384", "name": "sex" }, "Pain development": { "id": "HP:0012531", "name": "Pain" }, "Sympathetic activity": { "id": "UMLS:C2267065", "name": "Sympathetic Activity Alteration" }, "Pain": { "id": "EFO:0003843", "name": "pain" }, "Exocytosis": { "id": "GO:0006887", "name": "exocytosis" }, "Interoception": { "id": "UMLS:C3850156", "name": "Interoception" }, "Feeding behaviors": { "id": "UMLS:C0015745", "name": "Feeding behaviors" }, "Glucose balance": { "id": "UMLS:C4046080", "name": "Balance Sheet" }, "Lipid metabolism": { "id": "UMLS:C0598783", "name": "Lipid Metabolism" }, "Skeletal remodeling": { "id": "UMLS:C0521324", "name": "Skeletal" }, "Muscle movement": { "id": "UMLS:C0517907", "name": "muscle movement" }, "Hematopoiesis": { "id": "UMLS:C0018951", "name": "Hematopoiesis" }, "Skeletal metabolism": { "id": "UMLS:C0521324", "name": "Skeletal" }, "Skeletal interoception": { "id": "UMLS:C0521324", "name": "Skeletal" }, "Bone homeostasis": { "id": "UMLS:C0019868", "name": "Homeostasis" }, "Peripheral Sensitization": { "id": "UMLS:C0205100", "name": "Peripheral" }, "Synaptic transmission": { "id": "UMLS:C0027793", "name": "Synaptic Transmission" }, "Virologic non-suppression": { "id": "UMLS:C0205466", "name": "virologic" }, "Low CD4 Cell Count": { "id": "UMLS:C1855068", "name": "Low CD4+ count" }, "Immunological Functioning": { "id": "UMLS:C1579312", "name": "Immunological Agents" }, "Endocrine function": { "id": "UMLS:C0678896", "name": "Endocrine function" }, "Metabolic function": { "id": "UMLS:C0311400", "name": "Metabolic" }, "Hormonal factors": { "id": "UMLS:C0458083", "name": "Hormonal" }, "Viral Suppression": { "id": "UMLS:C0521026", "name": "Viral" }, "Antinociception": { "id": null, "name": null }, "Withdrawal": { "id": "UMLS:C0235097", "name": "Withdrawal convulsions" }, "CNS-mediated behavior": { "id": "UMLS:C2095770", "name": "CNS-mediated antiadrenergic agents" }, "Resting state functional connectivity (rsFC) of the periaqueductal gray (PAG) and ventral tegmental area (VTA)": { "id": "UMLS:C4288291", "name": "Resting State Functional Connectivity Magnetic Resonance Imaging" }, "Antinociceptive effects": { "id": "UMLS:C1704390", "name": "Antinociceptive Agents" }, "Regional homogeneity (ReHo)": { "id": "UMLS:C1881065", "name": "Homogeneity" }, "Functional connectivity (FC)": { "id": "UMLS:C3896579", "name": "Functional Connectivity Magnetic Resonance Imaging" }, "Antibody-based Strategies": { "id": "UMLS:C3896750", "name": "VAY736" }, "Endoplasmic reticulum stress": { "id": "UMLS:C3178870", "name": "Endoplasmic Reticulum Stress" }, "Cellular senescence": { "id": "UMLS:C0178539", "name": "Cellular" }, "Heart Rate Variability (HRV)": { "id": "HP:0031861", "name": "Decreased heart rate variability" }, "Sensory information": { "id": "UMLS:C0150311", "name": "Preparatory sensory information" }, "Motor impulses": { "id": "UMLS:C0850336", "name": "suicidal impulses" }, "Orexin/hypocretin signaling": { "id": "NCBIGene:613239", "name": "hcrt" }, "Neurodevelopment": { "id": "UMLS:C0599855", "name": "neurodevelopment" }, "Brain networks": { "id": "UBERON:0000955", "name": "brain" }, "Primary visual network": { "id": "UMLS:C0234723", "name": "Primary visual deviation" }, "Executive control networks": { "id": "UMLS:C0935584", "name": "Executive Function" }, "Offspring brain development": { "id": "UMLS:C0455679", "name": "Alcoholic offspring" }, "Offspring neurodevelopment": { "id": "UMLS:C0680063", "name": "Offspring" }, "Fetal brain development": { "id": "UMLS:C0440731", "name": "Fetal brain" }, "Breech position": { "id": "UMLS:C1867893", "name": "Breech position" }, "Increased amniotic fluid volume": { "id": "UMLS:C3278039", "name": "Increased amniotic fluid" }, "Hemispheric emotional valence (HEV)": { "id": "UMLS:C0301840", "name": "Antigenic valence" }, "Gait": { "id": "UMLS:C0016928", "name": "Gait" }, "Sweat": { "id": "UBERON:0001089", "name": "sweat" }, "Neuronal excitability": { "id": "UMLS:C0521390", "name": "neuronal" }, "Pain processing": { "id": "HP:0012531", "name": "Pain" }, "Post-translational modifications": { "id": "UMLS:C0033666", "name": "Post-Translational Protein Processing" }, "Stem cell\u2013derived neuronal-based screening approaches": { "id": "GO:0036445", "name": "neuronal stem cell division" }, "Hypoglossal Motor Activity": { "id": "UMLS:C0235012", "name": "Activity motor exaggerated" }, "Metabolic rate": { "id": "UMLS:C0311400", "name": "Metabolic" }, "Opioid Misuse": { "id": "UMLS:C5392920", "name": "Opioid Misuse" }, "Lifetime Cannabis Use": { "id": "UMLS:C3160814", "name": "Cannabis use" }, "Heavy Drinking": { "id": "UMLS:C0687132", "name": "heavy drinking" }, "Alcohol Consumption": { "id": "UMLS:C0001948", "name": "Alcohol consumption" }, "Sleep": { "id": "GO:0030431", "name": "sleep" }, "NREM sleep": { "id": "UMLS:C0234451", "name": "Sleep, Slow-Wave" }, "REM sleep": { "id": "NCBIGene:82261700", "name": "rem" }, "Sleep health": { "id": "UMLS:C0037313", "name": "Sleep" }, "Sleep disturbance": { "id": "HP:0002360", "name": "Sleep disturbance" }, "Opioid withdrawal": { "id": "UMLS:C0029104", "name": "Opioid withdrawal" }, "Chronic stress": { "id": "UMLS:C1510527", "name": "Chronic stress" }, "Stress reactivity": { "id": "NCIT:C35041", "name": "Stress" }, "Positive affect": { "id": "UMLS:C1446409", "name": "Positive" }, "Negative affect": { "id": "UMLS:C0205160", "name": "Negative" }, "Drug craving": { "id": "NCIT:C41365", "name": "Craving" }, "Cognitive Function": { "id": "UMLS:C1516691", "name": "Cognitive" }, "Mood": { "id": "UMLS:C3889585", "name": "Mood (attribute)" }, "Pain Perception": { "id": "UMLS:C3714605", "name": "Pain Perception" }, "Autonomic Activity": { "id": "UMLS:C0741308", "name": "AUTONOMIC OVER ACTIVITY" }, "Sleep Quality": { "id": "EFO:0005272", "name": "sleep quality" }, "Sleep Architecture": { "id": "UMLS:C0037313", "name": "Sleep" }, "Ventilatory Control": { "id": "UMLS:C0231922", "name": "ventilatory functions" }, "Circadian Disruption": { "id": "UMLS:C0332453", "name": "Disruption" }, "Poor Sleep Quality": { "id": "UMLS:C1262141", "name": "Poor quality sleep" }, "Therapeutic Targets": { "id": "UMLS:C0302350", "name": "Therapeutic" }, "Circadian rhythms": { "id": "UMLS:C0008810", "name": "Circadian Rhythms" }, "Gene transcription": { "id": "UMLS:C1336778", "name": "Transcription Coregulator Gene" } }, "Cell Type (biolink:Cell)": { "Inflammatory cells": { "id": "UMLS:C0440752", "name": "Inflammatory cell" }, "Dorsal root ganglion nociceptive neurons": { "id": "CL:1001451", "name": "sensory neuron of dorsal root ganglion" }, "Nociceptors": { "id": null, "name": null }, "Immune cells": { "id": "UMLS:C4329351", "name": "Antineoplastic Immune Cell" }, "Macrophages": { "id": "UMLS:C0085236", "name": "Macrophages, Alveolar" }, "Mast cells": { "id": "UMLS:C3484293", "name": "Basophils+Mast cells" }, "CD4+ lymphocytes": { "id": "UMLS:C0039215", "name": "CD4 Positive T Lymphocytes" }, "F4/80+ macrophages": { "id": "CL:0002478", "name": "F4/80-negative adipose macrophage" }, "Neurons": { "id": "UMLS:C0027882", "name": "Neurons" }, "Macrophage": { "id": "CL:0000235", "name": "macrophage" }, "Fibroblasts": { "id": "UMLS:C0016030", "name": "Fibroblasts" }, "Dendritiform cell (DC)": { "id": "CL:0000782", "name": "myeloid dendritic cell" }, "Immune cell subsets": { "id": "UMLS:C4330475", "name": "Immune Cell" }, "Antibody secreting cells": { "id": "UMLS:C0085820", "name": "Antibody-Secreting Cells" }, "Glutamate (GluS1) Neurons": { "id": "UMLS:C0027882", "name": "Neurons" }, "Monocytes/macrophages": { "id": "UMLS:C1148382", "name": "Monocytes+Macrophages" }, "GABAergic neurons": { "id": "UMLS:C0815002", "name": "GABAergic Neurons" }, "Nestin+ mesenchymal stromal cells": { "id": "UMLS:C3178844", "name": "Mesenchymal Stromal Cells" }, "Dorsal root ganglion neurons": { "id": "CL:1001451", "name": "sensory neuron of dorsal root ganglion" }, "CGRP+ nociceptors": { "id": null, "name": null }, "Sensory neuron": { "id": "CL:0000101", "name": "sensory neuron" }, "Dorsal root ganglion (DRG) neurons": { "id": "CL:1001451", "name": "sensory neuron of dorsal root ganglion" }, "Sympathetic nerves": { "id": "UMLS:C0001646", "name": "Adrenergic Fibers" }, "T cells": { "id": "UMLS:C4267792", "name": "Cells.CD25+CD127-" }, "Astrocytes": { "id": "UMLS:C0004112", "name": "Astrocytes" }, "CD8+ T cells": { "id": "UMLS:C4697029", "name": "Cells.CD3+CD8+CD27-" }, "TIM3+CD8+ T cells": { "id": "UMLS:C4697029", "name": "Cells.CD3+CD8+CD27-" }, "Microglia": { "id": "UMLS:C0206116", "name": "Microglia" }, "Nonpeptidergic nociceptive neurons": { "id": "UMLS:C0027882", "name": "Neurons" }, "Peptidergic nociceptive neurons": { "id": "CL:0000110", "name": "peptidergic neuron" }, "Adult Dorsal Root Ganglion Neurons": { "id": "CL:1001451", "name": "sensory neuron of dorsal root ganglion" } }, "Protein Fragment (biolink:None)": { "32-amino-acid aggrecan fragment (32-mer)": { "id": "PUBCHEM.COMPOUND:139682652", "name": "32-Amino-32-oxodotriacontanoic acid" } }, "Biological process (biolink:None)": { "Nociceptive innervation": { "id": "UMLS:C3178766", "name": "Nociceptive Pain" }, "Oxidative stress": { "id": "UMLS:C0311404", "name": "Oxidative" }, "Mitotoxicity": { "id": null, "name": null }, "DSFs": { "id": "PUBCHEM.COMPOUND:11433102", "name": "Dsfsozzyufkndl-uhfffaoysa-N" }, "Action potentials": { "id": "UMLS:C0001272", "name": "Action Potentials" }, "TLR4, MyD88, IL-6, CCL2 responses": { "id": "REACT:R-CEL-166166", "name": "MyD88-independent TLR4 cascade (Caenorhabditis elegans)" }, "Gene therapy": { "id": "UMLS:C0017296", "name": "gene therapy" }, "Depolarizing spontaneous fluctuations of membrane potential (DSFs)": { "id": "UMLS:C2350342", "name": "Spontaneous Postsynaptic Potentials" }, "Spontaneous activity (SA)": { "id": "UMLS:C5569529", "name": "Spontaneous activity" }, "Inflammation-associated transcripts": { "id": "UMLS:C0021384", "name": "Inflammation, immune complex associated" }, "Inflammation": { "id": "NCIT:C3137", "name": "Inflammation" }, "Signaling pathways": { "id": "GO:0023052", "name": "signaling" }, "Mast cell activation": { "id": "GO:0045576", "name": "mast cell activation" }, "Peripheral nociceptor sensitization": { "id": "UBERON:0035017", "name": "nociceptor" }, "Maladaptation of spinal signals": { "id": "UMLS:C0412248", "name": "Angiography of spinal artery" }, "Central sensitization": { "id": "UMLS:C0205099", "name": "Central" }, "Modulation of neural circuits": { "id": "UMLS:C0814033", "name": "neural circuits" }, "Spinal stiffness": { "id": "UMLS:C0521329", "name": "Spinal" }, "Lumbar multifidus activation": { "id": "UMLS:C0816093", "name": "Lumbar part of multifidus muscle" }, "Spine mobilizing": { "id": "UMLS:C0203995", "name": "Mobilizing exercises" }, "Multifidus activating": { "id": "UMLS:C0224319", "name": "Structure of multifidus muscle" }, "Mood": { "id": "UMLS:C3889585", "name": "Mood (attribute)" }, "Stress levels": { "id": "NCIT:C35041", "name": "Stress" }, "Loneliness": { "id": "NCIT:C34785", "name": "Loneliness" }, "Hopefulness": { "id": "UMLS:C3540843", "name": "Hopefulness" }, "Reaction time": { "id": "UMLS:C0034746", "name": "Reaction Time" }, "Spatial memory": { "id": "UMLS:C0814087", "name": "Spatial Memory" }, "Myelinization (white matter microstructure)": { "id": "EFO:0005674", "name": "white matter microstructure measurement" }, "nociception": { "id": "UMLS:C0234194", "name": "Nociception" }, "Protein synthesis": { "id": "PR:000000001", "name": "protein" }, "G protein signaling": { "id": "REACT:R-CFA-9674555", "name": "Signaling by CSF3 (G-CSF) (Canis familiaris)" }, "Global imbalance parameters": { "id": "UMLS:C1397022", "name": "imbalance; labyrinth" }, "Shape parameters": { "id": "UMLS:C0522512", "name": "With shape" }, "Opioid craving": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Positive affect": { "id": "UMLS:C1446409", "name": "Positive" }, "Immune function": { "id": "UMLS:C0439662", "name": "Immune" }, "Endogenous opioid release in the left nucleus accumbens": { "id": "UMLS:C2329576", "name": "Left nucleus accumbens" }, "Endogenous opioid release in the left amygdala": { "id": "UMLS:C0205752", "name": "Endogenous Opiates" }, "Sympathetic neuron excitability": { "id": "CL:0011103", "name": "sympathetic neuron" }, "Mechanical sensitivity": { "id": "UMLS:C3694301", "name": "mechanical ventilation sensitivity" }, "Cold sensitivity": { "id": "NCBIGene:33237", "name": "cold" }, "LPS-induced TLR4 dimerization": { "id": "REACT:R-MMU-2562541", "name": "TLR4-induced ripoptosome assembly (Mus musculus)" }, "DNA methylation": { "id": "UMLS:C0376452", "name": "DNA Methylation" }, "Histone methylation": { "id": "UMLS:C1156205", "name": "Histone Methylation" }, "RNA methylation": { "id": "GO:0001510", "name": "RNA methylation" }, "Protein translation initiation": { "id": "UMLS:C0680360", "name": "Initiation Rites" }, "Transcriptional processes": { "id": "GO:0007545", "name": "processes downstream of sex determination signal" }, "Translational processes": { "id": "GO:0007545", "name": "processes downstream of sex determination signal" }, "Neuroinflammation": { "id": "HP:0033429", "name": "Neuroinflammation" }, "Axonal degeneration": { "id": "HP:0040078", "name": "Axonal degeneration" }, "Small-fiber degeneration": { "id": "UMLS:C4011712", "name": "Degeneration and fibrosis of muscularis propria of small bowel" }, "CGRP signaling": { "id": "GTOPDB:681", "name": "α-CGRP" }, "Viral suppression": { "id": "UMLS:C0521026", "name": "Viral" }, "Abstinence": { "id": "UMLS:C3843422", "name": "Abstinence" }, "Traditional healing": { "id": "UMLS:C0443324", "name": "Traditional origin" }, "Cultural identity": { "id": "UMLS:C0814544", "name": "cultural identity" }, "Mortality": { "id": "EFO:0004352", "name": "mortality" }, "Drug overdose": { "id": "UMLS:C0029944", "name": "Drug Overdose" }, "Opioid-related overdoses": { "id": "UMLS:C3888438", "name": "Overdoses NEC" }, "Mechanical pain sensitivity": { "id": "UMLS:C0234252", "name": "Mechanical pain" }, "Dopaminergic dysregulations": { "id": "UMLS:C1512035", "name": "Dopaminergic Neurons" }, "Antinociceptive efficacy": { "id": "UMLS:C1704390", "name": "Antinociceptive Agents" }, "Sedation": { "id": "UMLS:C5400562", "name": "Sedation" }, "Physical health": { "id": "UMLS:C0205485", "name": "Physical" }, "Mental health": { "id": "UMLS:C0025353", "name": "mental health" }, "Sleep": { "id": "GO:0030431", "name": "sleep" }, "Quality of life": { "id": "UMLS:C0034380", "name": "Quality of life" }, "Negative affect": { "id": "UMLS:C0205160", "name": "Negative" }, "Craving": { "id": "NCIT:C41365", "name": "Craving" }, "Sleep duration": { "id": "EFO:0005271", "name": "sleep duration" }, "Sleep continuity": { "id": "UMLS:C0037313", "name": "Sleep" }, "Sleep onset latency": { "id": "UMLS:C0871908", "name": "sleep onset" }, "\u03bc-Opioid Receptor (MOR) signaling": { "id": "NCBIGene:18390", "name": "Oprm1" }, "Heart rate": { "id": "UBERON:0000948", "name": "heart" }, "Pain": { "id": "EFO:0003843", "name": "pain" }, "Weight-bearing pain": { "id": "UMLS:C5765411", "name": "pain increased by weight bearing" }, "Non-weight-bearing pain": { "id": "UMLS:C0445100", "name": "Non-weight-bearing" }, "Nociceptive signal alterations": { "id": "UMLS:C3178766", "name": "Nociceptive Pain" }, "Pressure pain threshold (PPT)": { "id": "UMLS:C0456440", "name": "Decreased pain threshold" }, "Mechanical temporal summation (TS)": { "id": "UMLS:C0234110", "name": "Temporal summation" }, "Conditioned pain modulation (CPM)": { "id": "UMLS:C3251122", "name": "pain reprocessing by transcutaneous electrical modulation" }, "Breastfeeding outcomes": { "id": "UMLS:C0516847", "name": "Breastfeeding weaning" }, "Functional connectivity": { "id": "UMLS:C0205245", "name": "Functional" }, "Endogenous opioid pathways": { "id": "UMLS:C0205752", "name": "Endogenous Opiates" }, "Socioemotional development": { "id": "UMLS:C0011751", "name": "Development Planning" }, "Reward processing": { "id": "UMLS:C0035397", "name": "Rewards" }, "Psychosocial interventions": { "id": "UMLS:C0542298", "name": "Psychosocial" }, "Acupuncture": { "id": "UMLS:C0181956", "name": "Acupuncture needle" }, "Interdisciplinary pain management programs": { "id": "UMLS:C0747141", "name": "pain chronic management" }, "Health services use": { "id": "UMLS:C0018747", "name": "Health Services" }, "Reproductive health": { "id": "UMLS:C1136000", "name": "Reproductive Health Services" }, "Preventive health": { "id": "UMLS:C0847035", "name": "Health maintenance/preventive medicine" }, "Stress": { "id": "NCIT:C35041", "name": "Stress" }, "Drug craving": { "id": "NCIT:C41365", "name": "Craving" }, "High voltage-activated (HVA) Ca2+ currents": { "id": "UniProtKB:A0A068WIZ4", "name": "A0A068WIZ4_ECHGR High voltage activated calcium channel beta (trembl)" }, "Constitutive current inhibition": { "id": "UMLS:C4232562", "name": "inhibition of generation of L-type calcium current" }, "Excitatory postsynaptic currents": { "id": "UMLS:C2350764", "name": "Excitatory Postsynaptic Currents" }, "Jaw function": { "id": "ZFIN:ZDB-GENE-070117-84", "name": "jaw" }, "Psychological unease": { "id": "UMLS:C0033898", "name": "Psychological Factors" }, "Positive valence factors": { "id": "UMLS:C0301840", "name": "Antigenic valence" }, "Sleep efficiency": { "id": "UMLS:C0518595", "name": "Sleep Efficiency" }, "Opioid abstinence": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Normalization of sleep deficiency": { "id": "UMLS:C1291475", "name": "Deficiency of glycosulfatase" }, "Improvements in sleep": { "id": "UMLS:C5697162", "name": "Sleep study in sleep lab" }, "Glycemic control": { "id": "UMLS:C5392125", "name": "Glycemic Control" }, "Neuroplasticity": { "id": "UMLS:C0027880", "name": "Neuronal Plasticity" }, "Gait": { "id": "UMLS:C0016928", "name": "Gait" }, "Neuronal correlation": { "id": "UMLS:C0521390", "name": "neuronal" } }, "Procedure (biolink:Procedure)": { "Destabilization of the medial meniscus (DMM)": { "id": "UMLS:C0559814", "name": "Arthroscopic trimming of medial meniscus" }, "Cancer treatment": { "id": "UMLS:C0920425", "name": "cancer treatment" }, "Opioid prescription refill": { "id": "UMLS:C1411103", "name": "Prescription of contraception" }, "Wound care procedures (WCPs)": { "id": "UMLS:C0886052", "name": "wound care" }, "Dressing changes": { "id": "UMLS:C0085671", "name": "Dressing change" }, "Laparoscopic appendectomy": { "id": "UMLS:C0372525", "name": "Laparoscopic appendectomy" }, "Laparoscopic inguinal hernia repair": { "id": "UMLS:C0521293", "name": "Laparoscopic repair of inguinal hernia" }, "Laparoscopic sleeve gastrectomy": { "id": "UMLS:C1960816", "name": "Laparoscopic sleeve gastrectomy" }, "Thyroidectomy/parathyroidectomy": { "id": "UMLS:C0193696", "name": "Complete parathyroidectomy" }, "Laparoscopic cholecystectomy": { "id": "UMLS:C0162522", "name": "Cholecystectomy, Laparoscopic" }, "Lung Resection": { "id": "UMLS:C3520384", "name": "Resection of apical lung tumor" }, "Neoadjuvant therapy": { "id": "UMLS:C0600558", "name": "Neoadjuvant Therapy" }, "Adjuvant therapy": { "id": "UMLS:C0677850", "name": "Adjuvant therapy" }, "Thoracotomy": { "id": "UMLS:C0039991", "name": "Thoracotomy" }, "Surgery": { "id": "UMLS:C0748275", "name": "RENAL CALCULUS SURGERY SURGERY" }, "Procedure type": { "id": "UMLS:C1304832", "name": "Type III allergen test" }, "Inpatient surgery status": { "id": "UMLS:C0242673", "name": "Filtering Surgery" }, "Total Joint Replacement (TJR)": { "id": "UMLS:C4279925", "name": "Total Joint Replacement" }, "Prescription Drug Monitoring Programs": { "id": "UMLS:C4537649", "name": "prescription drug monitoring in saliva" }, "Outpatient Surgical Procedure": { "id": "UMLS:C1299353", "name": "Outpatient procedure" }, "Total joint replacement (TJR)": { "id": "UMLS:C4279925", "name": "Total Joint Replacement" }, "Total hip replacement (THR)": { "id": "UMLS:C0040508", "name": "Total Hip Replacement" }, "Total knee replacement (TKR)": { "id": "UMLS:C0086511", "name": "Knee Replacement Arthroplasty" }, "Total Knee Replacement (TKR)": { "id": "UMLS:C0086511", "name": "Knee Replacement Arthroplasty" }, "Enhanced Recovery After Surgery Protocols": { "id": "UMLS:C5197734", "name": "Enhanced Recovery After Surgery" }, "Postoperative Opioid Use": { "id": "UMLS:C0842499", "name": "Caudal injection of opioid, postoperative" }, "Cholecystectomy": { "id": "UMLS:C0162522", "name": "Cholecystectomy, Laparoscopic" }, "Hysterectomy": { "id": "UMLS:C0020699", "name": "Hysterectomy" }, "Inpatient procedures": { "id": "UMLS:C0841184", "name": "Procedures for reproductive medicine" }, "Outpatient procedures": { "id": "UMLS:C1299353", "name": "Outpatient procedure" }, "Anesthesia": { "id": "UMLS:C0002922", "name": "Anesthesia, Obstetrical" }, "Surgical Procedure": { "id": "UMLS:C0457783", "name": "Procedure related to surgical arteriovenous connection" }, "Anesthetic Course": { "id": "UMLS:C0020588", "name": "Hypnosis, Anesthetic" }, "Postoperative Pain Management": { "id": "UMLS:C0853389", "name": "Postoperative analgesia" }, "Postdischarge Pain Management": { "id": "UMLS:C0747141", "name": "pain chronic management" }, "Liver Transplantation": { "id": "UMLS:C0023911", "name": "Transplantation of liver" }, "Total Hip Arthroplasty (THA)": { "id": "UMLS:C1719285", "name": "Total hip resurfacing arthroplasty" }, "Colectomy": { "id": "UMLS:C0009274", "name": "Colectomy" }, "Tonsillectomy": { "id": "UMLS:C0040423", "name": "Tonsillectomy" }, "Supracondylar humeral fracture fixation": { "id": "UMLS:C2052948", "name": "percutaneous fixation of supracondylar humeral fracture" }, "Appendectomy": { "id": "UMLS:C0003611", "name": "Appendectomy" }, "Logistic regression models": { "id": "UMLS:C0237461", "name": "Hypnotic Age Regression" }, "Inguinal Hernia Repair": { "id": "UMLS:C0021446", "name": "Repair of inguinal hernia" }, "Minor Outpatient Surgery": { "id": "UMLS:C0002428", "name": "Ambulatory Surgical Procedures" }, "Surgical oncology procedures": { "id": "UMLS:C0870064", "name": "Radiation Oncology Procedures: Computerized Planning" }, "Spinal manipulative therapy (SMT)": { "id": "UMLS:C0949742", "name": "Manipulation Therapy" }, "Anorectal surgery": { "id": "UMLS:C4763853", "name": "Ambulatory Anorectal Surgery" }, "Multifidus activating exercise": { "id": "UMLS:C0454291", "name": "Exercise regime" }, "Telehealth booster contacts": { "id": "UMLS:C0020975", "name": "Secondary Immunization" }, "Percutaneous peripheral nerve stimulation (PNS)": { "id": "UMLS:C1524011", "name": "Peripheral Nerve Stimulation" }, "Electrical stimulation": { "id": "UMLS:C0013786", "name": "Electric stimulation technique" }, "Sham": { "id": "UMLS:C0430168", "name": "Sham feeding test" }, "Screening, Brief Intervention, and Referral to Treatment for Pain Management (SBIRT-PM)": { "id": "UMLS:C5392901", "name": "Screening and Brief Intervention" }, "Chiropractic care": { "id": "UMLS:C0600577", "name": "Chiropractic manipulation" }, "Physical Therapy (PT)": { "id": "UMLS:C0949766", "name": "Physical therapy" }, "Clinical Practice Guidelines (CPGs)": { "id": "UMLS:C0695275", "name": "Clinical practice management" }, "Resolving the Burden of Low Back Pain in Military Service Members and Veterans (RESOLVE)": { "id": "UMLS:C0741423", "name": "back surgery low back pain" }, "Oswestry Disability Index": { "id": "UMLS:C0012605", "name": "Disability Evaluation" }, "Defense and Veterans Pain Rating Scale": { "id": "UMLS:C0002777", "name": "Analogue Pain Scale" }, "UCTDA": { "id": null, "name": null }, "Pharmacotherapy": { "id": "UMLS:C0013216", "name": "Pharmacotherapy" }, "Pragmatic clinical trials (PCTs)": { "id": "UMLS:C1882104", "name": "Agent Combination Not Indexed in Open Clinical Trials" }, "Pediatric Tonsillectomy and/or Adenoidectomy (T/A)": { "id": "UMLS:C0810112", "name": "Tonsillectomy and/or adenoidectomy" }, "Minor hernia repair": { "id": "UMLS:C0198457", "name": "Repair of diaphragmatic hernia" }, "Dental Extractions": { "id": "UMLS:C0011425", "name": "Dental Veneer Application" }, "Percutaneous Peripheral Nerve Stimulation": { "id": "UMLS:C1524011", "name": "Peripheral Nerve Stimulation" }, "Electrical Stimulation": { "id": "UMLS:C0013786", "name": "Electric stimulation technique" }, "Ophthalmic Surgery": { "id": "UMLS:C0749355", "name": "surgery of thigh" }, "Screening, Brief Intervention, and Referral to Treatment for Pain Management intervention (SBIRT-PM)": { "id": "UMLS:C5392901", "name": "Screening and Brief Intervention" }, "Pain treatment modalities": { "id": "UMLS:C2367759", "name": "Assessing Pain" }, "Percutaneous Peripheral Nerve Stimulation (PNS)": { "id": "UMLS:C1524011", "name": "Peripheral Nerve Stimulation" }, "Rotator Cuff Repair": { "id": "UMLS:C0186666", "name": "Repair of musculotendinous cuff of shoulder" }, "Foot/Ankle Surgery": { "id": "UMLS:C2224457", "name": "surgery of right foot" }, "Total Knee and Hip Arthroplasty (THA and TKA)": { "id": "UMLS:C1719285", "name": "Total hip resurfacing arthroplasty" }, "Minimally invasive hysterectomy": { "id": "UMLS:C4505038", "name": "Transanal Minimally Invasive Surgery" }, "Third molar dental extractions": { "id": "UMLS:C0577760", "name": "Surgical removal of third molar tooth" }, "Head and neck free flap reconstruction": { "id": "UMLS:C0191595", "name": "Reconstruction of head and neck using fasciocutaneous flap" }, "Surgical procedures": { "id": "UMLS:C3850085", "name": "Prophylactic Surgical Procedures" }, "Implant-based breast reconstruction": { "id": "UMLS:C2224572", "name": "reconstruction of breast with implant prosthesis" }, "Vasectomy": { "id": "UMLS:C0042387", "name": "Vasectomy" }, "Cystourethroscopy": { "id": "UMLS:C2164084", "name": "cystourethroscopy with ureteroscopy" }, "Prostate biopsy": { "id": "UMLS:C0194804", "name": "Biopsy of prostate" }, "Circumcision": { "id": "UMLS:C0742417", "name": "circumcision adult" }, "Transurethral destruction of prostate tissue": { "id": "UMLS:C2145597", "name": "transurethral destruction of prostatic tissue" }, "Sequential Multiple-Assignment Randomization Trial for Low Back Pain (SMART LBP)": { "id": "UMLS:C0741423", "name": "back surgery low back pain" }, "Deep learning algorithm": { "id": "UMLS:C0150267", "name": "Learning facilitation" }, "Statistical shape model": { "id": "UMLS:C4048785", "name": "Model for end stage liver disease score" }, "Office-Based Opioid Treatment": { "id": "UMLS:C5541642", "name": "office-based treatment for opioid use disorder" }, "Group-Based Opioid Treatment": { "id": "UMLS:C0679732", "name": "treatment-facility-based prevention" }, "Shared Medical Appointment": { "id": "UMLS:C0418981", "name": "Medical therapy" }, "Group Psychotherapy": { "id": "UMLS:C0033971", "name": "Group Psychotherapy" }, "Behavioral activation (BA) intervention": { "id": "UMLS:C4535964", "name": "intervention using behavioral activation" }, "Cognitive Behavioral Therapy": { "id": "UMLS:C0009244", "name": "Cognitive Therapy" }, "Contingency Management": { "id": "UMLS:C0683476", "name": "Contingency Management" }, "Urine Drug Screens": { "id": "UMLS:C0202274", "name": "Urine drug screen" }, "Hub and Spoke model of care": { "id": "UMLS:C0496663", "name": "Care and examination of lactating mother" }, "Refractive surgery (RS-NCP)": { "id": "UMLS:C1531708", "name": "Adjustable refractive surgery" }, "In vivo confocal microscopy (IVCM)": { "id": "UMLS:C0242842", "name": "Microscopy, Confocal" }, "Electroencephalography (EEG)": { "id": "UMLS:C0013819", "name": "Electroencephalography" }, "Transcranial magnetic stimulation (TMS)": { "id": "UMLS:C0436548", "name": "Transcranial magnetic stimulation" }, "Spinal manipulative therapy": { "id": "UMLS:C0949742", "name": "Manipulation Therapy" }, "Low-velocity variable-amplitude spinal manipulation (LVVA-SM)": { "id": "UMLS:C1562781", "name": "Osteopathic manipulation, high velocity, low amplitude forces" }, "Fourth Lumbar Spinal Nerve Ligation (SNL)": { "id": "UMLS:C2314948", "name": "CT guided injection of lumbar spinal nerve root" }, "Chronic Compression of DRG (CCD)": { "id": "UMLS:C2919480", "name": "Compression of lymphedema using nonelastic compression device" }, "Microsympathectomy": { "id": null, "name": null }, "Sympathectomy": { "id": "UMLS:C0039038", "name": "Sympathectomy" }, "Gene therapy": { "id": "UMLS:C0017296", "name": "gene therapy" }, "Nanomaterials-based scavenging": { "id": "UMLS:C5544373", "name": "Mentalization-Based Therapy" }, "Contingency management (CM) intervention": { "id": "UMLS:C0683476", "name": "Contingency Management" }, "Inpatient detoxification": { "id": "UMLS:C0919045", "name": "ALCOHOL AND/OR DRUG SERVICES; ACUTE DETOXIFICATION (HOSPITAL INPATIENT)" }, "Rehabilitation": { "id": "UMLS:C0034991", "name": "Rehabilitation therapy" }, "Discharges against medical advice (DAMA)": { "id": "UMLS:C0557993", "name": "Legal advice" }, "Internet-delivered community reinforcement approach (CRA)": { "id": "UMLS:C0027561", "name": "Negative Reinforcement" }, "Behavioral Health Integration (BHI)": { "id": "UMLS:C0815183", "name": "behavioral health care" }, "Electronic health record": { "id": "UMLS:C2959336", "name": "Physician providing a service in a dental health professional shortage area for the purpose of an electronic health record incentive payment" }, "Symptom Checklist for DSM-5 SUDs": { "id": "UMLS:C3695208", "name": "DSM-5 criteria for major depressive disorder documented" }, "Emergency department visits": { "id": "UMLS:C2236611", "name": "aspirin received within 24 hours before emergency department arrival or during emergency department stay" }, "Hospitalizations": { "id": "UMLS:C0547102", "name": "Assess usual sleeping habits or patterns at home or during previous hospitalizations." }, "ICD-10 diagnosis": { "id": "UMLS:C0011900", "name": "Diagnosis" }, "Substance Use Intervention Team (SUIT) consultation service": { "id": "UMLS:C2065311", "name": "work restrictions no protective suit use" }, "Addiction medicine consultation services (ACS)": { "id": "UMLS:C0519707", "name": "Miscellaneous Medicine Services" }, "Routine hospital discharge": { "id": "UMLS:C3837211", "name": "hospital discharge orders routine equipment charge" }, "Interdisciplinary Primary Care (IPC)": { "id": "UMLS:C2169879", "name": "referred to primary care physician" }, "Emergency Department (ED)": { "id": "UMLS:C2236611", "name": "aspirin received within 24 hours before emergency department arrival or during emergency department stay" }, "Inpatient": { "id": "UMLS:C5452896", "name": "Inpatient rehab/physio" }, "Behavioral Health": { "id": "UMLS:C0815183", "name": "behavioral health care" }, "Primary Care": { "id": "UMLS:C2169879", "name": "referred to primary care physician" }, "Acupuncture": { "id": "UMLS:C0394664", "name": "Acupuncture procedure" }, "Video-guided acupuncture imagery treatment (VGAIT)": { "id": "UMLS:C0150627", "name": "Guided imagery" }, "Home cage wheel running": { "id": "UMLS:C0454384", "name": "Running backwards" }, "Deep brain stimulation (DBS)": { "id": "UMLS:C0394162", "name": "Deep Brain Stimulation" }, "Guided Imagery": { "id": "UMLS:C0150627", "name": "Guided imagery" }, "Cognitive behavioral therapy (CBT)": { "id": "UMLS:C0009244", "name": "Cognitive Therapy" }, "Transcutaneous cervical vagus nerve stimulation (tcVNS)": { "id": "UMLS:C4544496", "name": "Transcutaneous stimulation of cervical branch of vagus nerve" }, "Pelvic Examination (PEX)": { "id": "UMLS:C0200045", "name": "Manual pelvic examination (procedure)" }, "Infant Assessments": { "id": "UMLS:C2317425", "name": "Bathing infant" }, "Maintenance haemodialysis (HD)": { "id": "UMLS:C4040576", "name": "Maintenance hemodialysis" }, "Long-term opioid therapy": { "id": "UMLS:C2114400", "name": "therapy prescribed for long-term asthma management" }, "Brain Imaging": { "id": "UMLS:C0203860", "name": "Imaging of brain" }, "High-throughput molecular screening techniques": { "id": "UMLS:C0872187", "name": "High-Throughput Screening" }, "Omics": { "id": null, "name": null }, "Quantitative sensory testing": { "id": "UMLS:C0430838", "name": "Quantitative sensory test" }, "Patient-reported outcome assessments": { "id": "UMLS:C4274941", "name": "Assessment using Therapy Outcome Measure" }, "Functional assessments": { "id": "UMLS:C0278372", "name": "Functional assessment" }, "Knee arthroplasty": { "id": "UMLS:C0864243", "name": "Arthroplasty, Replacement, Partial Knee" }, "Thoracic surgery": { "id": "UMLS:C5685659", "name": "thoracic nerve surgery" }, "Substance use prevention (SUP)": { "id": "UMLS:C0150358", "name": "Substance use prevention" }, "Behavioral health (BH)": { "id": "UMLS:C0815183", "name": "behavioral health care" }, "Community supervision (CS)": { "id": "UMLS:C0038842", "name": "Supervision (regime/therapy)" }, "Mental health treatment": { "id": "UMLS:C0184647", "name": "Mental health treatment" }, "Unilateral transcranial photobiomodulation (t-PBM)": { "id": "UMLS:C0206077", "name": "Ultrasonography, Doppler, Transcranial" }, "Dual Brain Psychology (DBP)": { "id": "UMLS:C0542300", "name": "Analytical psychology" }, "Unilateral transcranial photobiomodulation (UtPBM)": { "id": "UMLS:C0206077", "name": "Ultrasonography, Doppler, Transcranial" }, "Psychotherapy": { "id": "UMLS:C0033968", "name": "Psychotherapy" }, "Transcutaneous Auricular Neurostimulation (tAN)": { "id": "UMLS:C5766704", "name": "transcutaneous auricular stimulation with setup, calibration, patient education on equipment use" }, "Spinal fusion surgery": { "id": "UMLS:C0919636", "name": "Spinal fusion surgery" }, "Mindfulness-based stress reduction (MBSR)": { "id": "UMLS:C5769522", "name": "Mindfulness Based Stress Reduction program" }, "Non-pharmacological pain care (NPPC)": { "id": "UMLS:C2367775", "name": "pain care plan documented" }, "Transcutaneous electrical nerve stimulation (TENS)": { "id": "UMLS:C0040654", "name": "Transcutaneous Electric Nerve Stimulation" }, "Physical Therapy": { "id": "UMLS:C0949766", "name": "Physical therapy" }, "Opioid Safety Clinic (OSC)": { "id": "UMLS:C1269689", "name": "Safety procedure" }, "Chronic Opioid Therapy (COT)": { "id": "UMLS:C0203628", "name": "Radionuclide therapy for chronic leukemia" }, "Medicaid naloxone prescriptions": { "id": "UMLS:C0430135", "name": "Naloxone test" }, "Behavioral and mental health interventions": { "id": "UMLS:C2551345", "name": "Mental Health @ None @ Psychological Tests @ Personality and Behavioral" }, "Perinatal mental health interventions": { "id": "UMLS:C2551393", "name": "mental health counseling" }, "Trust-Based Relational Intervention\u00ae (TBRI\u00ae)": { "id": "UMLS:C5691412", "name": "Play-based Mental Health Intervention" }, "Major surgery": { "id": "UMLS:C0679637", "name": "major surgery" }, "Inpatient medically managed withdrawal programs": { "id": "UMLS:C3812880", "name": "Withdrawal - birth control" }, "Outpatient care": { "id": "UMLS:C1299353", "name": "Outpatient procedure" }, "Detox programs": { "id": "UMLS:C1511595", "name": "Cyclophosphamide/Detox/Interleukin-2" }, "Drug toxicology testing": { "id": "UMLS:C4292005", "name": "Testing for presence of drug, by chemistry analyzers" }, "Counseling requirements": { "id": "UMLS:C1136220", "name": "Directive Counseling" }, "Neuroimaging": { "id": "UMLS:C0679575", "name": "Neuroimaging" }, "Spinal cord stimulation": { "id": "UMLS:C0394477", "name": "Neurostimulation procedures of spinal cord tissue" }, "Epidural electrical stimulation": { "id": "UMLS:C0013786", "name": "Electric stimulation technique" }, "Physical therapy": { "id": "UMLS:C0949766", "name": "Physical therapy" }, "Electromyography (EMG)": { "id": "UMLS:C0013839", "name": "Electromyography" }, "Spinal cord stimulation (SCS)": { "id": "UMLS:C0394477", "name": "Neurostimulation procedures of spinal cord tissue" }, "Deep Brain Stimulation": { "id": "UMLS:C0394162", "name": "Deep Brain Stimulation" }, "Neuromodulation": { "id": "UMLS:C1518963", "name": "Percutaneous Neuromodulation Therapy" }, "Transcranial Focused Ultrasound (tFUS)": { "id": "UMLS:C1517281", "name": "Focused Ultrasound Therapy" }, "Intraoperative neurophysiological monitoring (IONM)": { "id": "UMLS:C0430853", "name": "Intraoperative Neurophysiological Monitoring" }, "High-resolution spinal cord stimulation (HR-SCS)": { "id": "UMLS:C0394477", "name": "Neurostimulation procedures of spinal cord tissue" }, "Intraoperative neuromonitoring": { "id": "UMLS:C4042812", "name": "Intraoperative Electrocorticography" }, "Thoracic SCS surgeries": { "id": "UMLS:C0752151", "name": "Thoracic Surgery, Video-Assisted" }, "Transcranial ultrasound neuromodulation": { "id": "UMLS:C3164085", "name": "Transcranial Doppler ultrasound velocimetry" } }, "Proteins (biolink:Protein)": { "Toll-like receptors (TLRs)": { "id": "UMLS:C0670896", "name": "Toll-like receptors" } }, "Cells (biolink:None)": { "Pain-sensing neurons": { "id": "UBERON:0035017", "name": "nociceptor" }, "Connective tissue cells": { "id": "UMLS:C0009781", "name": "Connective Tissue Cells" } }, "Biological Molecules (biolink:None)": { "Damage-associated molecular patterns (DAMPs)": { "id": "UMLS:C4046037", "name": "Pathogen-Associated Molecular Patterns" } }, "Organism Part (biolink:AnatomicalEntity)": { "Dorsal root ganglia (DRG)": { "id": "UBERON:0000044", "name": "dorsal root ganglion" }, "Medial meniscus": { "id": "UMLS:C0348073", "name": "Medial meniscus structure" }, "Central nervous system": { "id": "UBERON:0001017", "name": "central nervous system" }, "Peripheral nervous system": { "id": "UBERON:0000010", "name": "peripheral nervous system" }, "Cortex": { "id": "UBERON:0001851", "name": "cortex" }, "Meninges": { "id": "UMLS:C1268202", "name": "Meninges part" }, "Brain": { "id": "UBERON:0000955", "name": "brain" }, "Peripheral organs": { "id": "UMLS:C2936599", "name": "Organs at Risk" }, "Neural systems": { "id": "UMLS:C0027792", "name": "Neural Pathways" }, "Immune system": { "id": "UBERON:0002405", "name": "immune system" }, "Peripheral nociceptor termini": { "id": "UBERON:0035017", "name": "nociceptor" }, "Dorsal root ganglia": { "id": "UBERON:0000044", "name": "dorsal root ganglion" }, "Spinal cord": { "id": "UBERON:0002240", "name": "spinal cord" }, "Supraspinal areas": { "id": "UBERON:0002882", "name": "supraspinal nucleus" }, "Primary Somatosensory Cortical (S1)": { "id": "UBERON:0008933", "name": "primary somatosensory cortex" }, "Sympathetic nerves": { "id": "UMLS:C0459521", "name": "Sympathetic nerve structure" }, "Trigeminal Sensory System": { "id": "UBERON:0004132", "name": "trigeminal sensory nucleus" }, "Vertebral endplates": { "id": "UBERON:0001535", "name": "vertebral artery" }, "Vertebral endplate porosity": { "id": "UBERON:0014386", "name": "vertebral endplate" }, "Trigeminal ganglia": { "id": "UBERON:0001675", "name": "trigeminal ganglion" }, "Bladder": { "id": "UMLS:C0552337", "name": "bladder cells" }, "Lumbosacral dorsal root ganglia (DRG)": { "id": "UBERON:0000044", "name": "dorsal root ganglion" }, "Spinal dorsal horn neurons": { "id": "UMLS:C0752062", "name": "Posterior Horn Cells" }, "DRG": { "id": "UMLS:C1761610", "name": "Entire spinal nerve ganglion" }, "spinal cord": { "id": "UBERON:0002240", "name": "spinal cord" }, "Brain structure and function": { "id": "UMLS:C1300310", "name": "Brain and spinal cord structure" }, "Nucleus accumbens shell": { "id": "UBERON:0001882", "name": "nucleus accumbens" }, "Vagus Nerve": { "id": "UBERON:0001759", "name": "vagus nerve" }, "Trigeminal Nerve": { "id": "UBERON:0001645", "name": "trigeminal nerve" }, "Muscles": { "id": "UMLS:C2371064", "name": "Muscles of shoulder region" }, "Respiratory system": { "id": "UBERON:0001004", "name": "respiratory system" }, "Dorsolateral prefrontal cortex (DLPFC)": { "id": "UMLS:C4019080", "name": "Dorsolateral Prefrontal Cortex" }, "Ventral striatum": { "id": "UBERON:0005403", "name": "ventral striatum" }, "Paraventricular nucleus of the thalamus (PVT)": { "id": "UBERON:0001920", "name": "paraventricular nucleus of thalamus" }, "Central nucleus of the amygdala (CeA)": { "id": "UBERON:0002883", "name": "central amygdaloid nucleus" }, "Nucleus accumbens (NAc)": { "id": "UBERON:0001882", "name": "nucleus accumbens" }, "Lateral hypothalamus (LH)": { "id": "UMLS:C3499155", "name": "motor lateral hypothalamus" }, "Dorsolateral Prefrontal Cortex": { "id": "UMLS:C4019080", "name": "Dorsolateral Prefrontal Cortex" }, "Nucleus Accumbens": { "id": "UBERON:0001882", "name": "nucleus accumbens" }, "Extracellular Matrix": { "id": "UMLS:C0521119", "name": "Extracellular" }, "Dorsal root ganglion (DRG)": { "id": "UBERON:0000044", "name": "dorsal root ganglion" }, "L6 and L7 DRG": { "id": "UMLS:C0447704", "name": "Entire intervertebral symphysis between L6 and S1" } }, "organism (biolink:None)": { "Peripheral sensory neurons": { "id": "MONDO:0002321", "name": "sensory peripheral neuropathy" }, "Mouse": { "id": "PUBCHEM.COMPOUND:91976823", "name": "Mouse obestatin; Obestatin (mouse)" }, "Human dorsal root ganglion (DRG)": { "id": "GO:1990791", "name": "dorsal root ganglion development" }, "Lamina 1-2": { "id": "UBERON:0000957", "name": "lamina" }, "Substantia gelatinosa": { "id": "UBERON:0002181", "name": "substantia gelatinosa" }, "Primate nociceptors": { "id": "MONDO:0025013", "name": "non-human primate disease" }, "Dorsal horn neurons": { "id": "UMLS:C0752062", "name": "Posterior Horn Cells" }, "MC903 mouse model": { "id": "UMLS:C2986594", "name": "Mouse Model" }, "Urban American Indian/Alaska Native (AI/AN) young adults": { "id": "UMLS:C1515945", "name": "American Indian or Alaska Native" }, "Parents": { "id": "UMLS:C0425164", "name": "Parents separated" }, "Health providers": { "id": "UMLS:C0018684", "name": "Health" }, "American Indian/Alaska Native (AI/AN) emerging adults": { "id": "UMLS:C1515945", "name": "American Indian or Alaska Native" }, "Central nervous system": { "id": "UBERON:0001017", "name": "central nervous system" }, "alcohol-dependent cohort (AD)": { "id": "UMLS:C0086027", "name": "Analysis, Cohort" }, "healthy control cohort (HC)": { "id": "UMLS:C2986479", "name": "Healthy Control" }, "West Virginia": { "id": "UMLS:C0043127", "name": "West Virginia" }, "Teredinibacter turnerae": { "id": "NCBITaxon:2426", "name": "Teredinibacter turnerae" }, "Staphylococcus epidermidis": { "id": "NCBITaxon:1279", "name": "Staphylococcus" }, "Veterans": { "id": "UMLS:C0042610", "name": "Veterans" }, "Military Service Members": { "id": "UMLS:C3714797", "name": "Military service" }, "\u03bcMT mice": { "id": "MESH:D008816", "name": "Mice, Jimpy" }, "mice": { "id": "NCBIGene:4280", "name": "MICE" }, "TRESK global knock-out mice": { "id": "MESH:D018345", "name": "Mice, Knockout" }, "GABAergic neurons": { "id": "UMLS:C0815002", "name": "GABAergic Neurons" }, "central nucleus of the amygdala (GABACeA)": { "id": "UBERON:0002883", "name": "central amygdaloid nucleus" }, "GABACeA": { "id": null, "name": null }, "glutamatergic neurons": { "id": "GO:0035249", "name": "synaptic transmission, glutamatergic" }, "parafascicular nucleus (GluPF)": { "id": "UBERON:0001922", "name": "parafascicular nucleus" }, "GluPF neurons": { "id": "UMLS:C0027882", "name": "Neurons" }, "neurons in the second somatosensory cortex (S2)": { "id": "UBERON:0008930", "name": "somatosensory cortex" }, "GABACeA\u2192GluPF\u2192S2 pathway": { "id": "UMLS:C1705987", "name": "Pathway (interactions)" }, "K/BxN transgenic mouse": { "id": "MESH:D008822", "name": "Mice, Transgenic" }, "muMT fracture mice": { "id": "MESH:D008816", "name": "Mice, Jimpy" }, "T cells": { "id": "NCBIGene:20997", "name": "T" }, "Immune system": { "id": "UBERON:0002405", "name": "immune system" }, "popliteal lymph nodes": { "id": "UBERON:0001543", "name": "popliteal lymph node" }, "Pregnant and Postpartum Women": { "id": "UMLS:C0033011", "name": "Pregnant Women" }, "Primary care providers (PCPs)": { "id": "UMLS:C0497107", "name": "Consult between primary care providers" }, "Hepatitis C virus (HCV)": { "id": "UMLS:C0220847", "name": "hepatitis C virus" }, "primary care clinicians": { "id": "UMLS:C0033137", "name": "Primary Health Care" }, "squirrel monkeys": { "id": "NCBITaxon:9520", "name": "Saimiri" }, "rhesus monkeys": { "id": "NCBITaxon:9544", "name": "Macaca mulatta" }, "Kratom (Mitragyna speciosa Korth.)": { "id": "UMLS:C1197867", "name": "Mitragyna speciosa" }, "Rats": { "id": "MESH:D020303", "name": "Rats, Inbred Dahl" }, "Kratom": { "id": "UMLS:C4547828", "name": "kratom alkaloids" }, "Human": { "id": "UniProtKB:Q4R497", "name": "Q4R497_MACFA Testis cDNA clone: QtsA-11487, similar to human human immunodeficiency virus type I enhancer bindingprotein 3 (HIVEP3) (trembl)" }, "Rodent": { "id": "MONDO:0024981", "name": "rodent disease" }, "Monkey": { "id": "MONDO:0025102", "name": "monkey disease" }, "Sprague-Dawley rats": { "id": "MESH:D017207", "name": "Rats, Sprague-Dawley" }, "Malaysian Mitragyna speciosa (Kratom)": { "id": "UMLS:C1197867", "name": "Mitragyna speciosa" }, "M. speciosa leaf": { "id": "UMLS:C3282410", "name": "Prunus speciosa leaf extract" }, "Human Immunodeficiency Virus (HIV)": { "id": "NCBITaxon:12721", "name": "Human immunodeficiency virus" }, "Rhesus Monkeys": { "id": "NCBITaxon:9544", "name": "Macaca mulatta" }, "Rat": { "id": "UMLS:C0034685", "name": "Rat Nematode" }, "Rhesus monkeys": { "id": "NCBITaxon:9544", "name": "Macaca mulatta" }, "Hepatitis C Virus (HCV)": { "id": "UMLS:C0220847", "name": "hepatitis C virus" }, "SARS-CoV-2": { "id": "UNII:B6L4N5Z4GH", "name": "SARS-COV-2" }, "Mice": { "id": "NCBIGene:4280", "name": "MICE" }, "Rat models of chronic and thermal pain": { "id": "UMLS:C0747141", "name": "pain chronic management" }, "American Indians": { "id": "UMLS:C0002460", "name": "American Indians" }, "Alaska Natives": { "id": "UMLS:C0001905", "name": "Alaska" }, "Medicaid": { "id": "UMLS:C0025071", "name": "Medicaid" } }, "protein (biolink:Protein)": { "CGRP": { "id": "UMLS:C0002251", "name": "alpha-CGRP" }, "P2X3R": { "id": null, "name": null }, "TrpV1": { "id": "UMLS:C1564816", "name": "TRPV1 receptor" }, "Nav1.7": { "id": "UMLS:C3503759", "name": "NAV1.7 Voltage-Gated Sodium Channel" }, "CysLT2R receptor": { "id": "UMLS:C0597357", "name": "receptor" }, "S1PR": { "id": "UniProtKB:S1PRY7", "name": "S1PRY7_ECOLX N-acetyl-D-glucosamine kinase (trembl)" }, "S1PR1": { "id": "UMLS:C3179991", "name": "S1pr1 protein, mouse" }, "G protein": { "id": "UMLS:C0086870", "name": "Protein Phosphatase G" }, "kappa opioid receptors (KOR)": { "id": "UMLS:C0064239", "name": "Receptors, Opioid, kappa" }, "mu opioid receptor system": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "delta opioid receptor system": { "id": "UMLS:C0140057", "name": "Receptors, Opioid, delta" }, "LTA1": { "id": "UniProtKB:Q9M7Z1", "name": "ODB2_ARATH Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial (sprot)" }, "tetanus toxoid, TT": { "id": "UMLS:C0296638", "name": "tetanus toxoid (830-843)" }, "antibodies": { "id": "UMLS:C0003241", "name": "Antibodies" }, "tetanus toxoid carrier protein": { "id": "UMLS:C0305062", "name": "tetanus toxoid vaccine, inactivated" }, "Tetanus toxoid (TT)": { "id": "UMLS:C0305062", "name": "tetanus toxoid vaccine, inactivated" }, "Antibody": { "id": "UMLS:C1566673", "name": "Antibody Fragments" }, "DOP-KOP": { "id": "UMLS:C1688508", "name": "kop protein, zebrafish" }, "D-Pen2,5]-enkephalin [DPDPE]": { "id": "UMLS:C0525856", "name": "Enkephalin, D-Penicillamine (2,5)-" }, "U50488": { "id": null, "name": null }, "ERK": { "id": "UMLS:C5771958", "name": "ERK-IN-3" }, "DPDPE": { "id": "UMLS:C0123817", "name": "iodo-DPDPE" }, "12/15-lipoxgenases (LOX)": { "id": "PR:000003959", "name": "polyunsaturated fatty acid lipoxygenase ALOX15" }, "TWIK-related spinal cord K+ (TRESK) channel": { "id": "UMLS:C1452083", "name": "Trik protein, mouse" }, "Neurokinin 1 receptor (NK1R)": { "id": "UMLS:C0531978", "name": "neurokinin receptor 4" }, "GluA1": { "id": "UniProtKB:P07728", "name": "GLUA1_ORYSJ Glutelin type-A 1 (sprot)" }, "Group II metabotropic glutamate receptor": { "id": "UMLS:C0206529", "name": "Receptors, Metabotropic Glutamate" }, "IgM": { "id": "UMLS:C5168913", "name": "IgM IgM | Serum or Plasma | Chemistry - non-challenge" }, "CGRP+": { "id": "UMLS:C0002251", "name": "alpha-CGRP" }, "TH+": { "id": "UMLS:C0667343", "name": "TH 332" }, "C5a complement": { "id": "UMLS:C0009521", "name": "Complement C5a" }, "Cytokine": { "id": "UMLS:C0079189", "name": "cytokine" }, "Chronic CRPS patient IgM": { "id": "UMLS:C1308027", "name": "crps-7 protein, Neurospora crassa" }, "Chronic CRPS patient IgG": { "id": "UMLS:C1308027", "name": "crps-7 protein, Neurospora crassa" }, "CRPS IgM antibodies": { "id": "UMLS:C1308027", "name": "crps-7 protein, Neurospora crassa" }, "neoantigens": { "id": "UMLS:C4724988", "name": "Lm-tLLO-neoantigens Vaccine ADXS-NEO" }, "C5a complement signaling": { "id": "UMLS:C0009521", "name": "Complement C5a" }, "CRMP2": { "id": "UniProtKB:A0A1R4ABV0", "name": "A0A1R4ABV0_BABMR CRMP2 (trembl)" }, "NaV1.7": { "id": "UMLS:C3503759", "name": "NAV1.7 Voltage-Gated Sodium Channel" }, "Numb": { "id": "UniProtKB:P16554", "name": "NUMB_DROME Protein numb (sprot)" }, "Nedd4-2": { "id": "PR:000010938", "name": "NEDD4-binding protein 2" }, "Eps15": { "id": "UMLS:C2351807", "name": "Eps15 protein, rat" }, "Clathrin": { "id": "UMLS:C0008905", "name": "Clathrin" }, "Sodium channels": { "id": "UMLS:C0037492", "name": "Sodium Channel" }, "CRISPR-dCas9": { "id": "UMLS:C3658352", "name": "CRISPR-Associated Proteins" }, "zinc finger proteins": { "id": "UMLS:C0086174", "name": "Proteins, Recombinant DNA" }, "Cocaine- and amphetamine-regulated transcript peptide": { "id": "UMLS:C0390137", "name": "cocaine- and amphetamine-regulated transcript protein" }, "CART peptide": { "id": "UniProtKB:C1J7W0", "name": "C1J7W0_LEUOC CART (trembl)" }, "G protein-coupled receptor": { "id": "UMLS:C4318433", "name": "Receptors, Kisspeptin-1" }, "GPR160": { "id": "UMLS:C5543974", "name": "Gpr160 protein, rat" }, "Calcitonin": { "id": "UMLS:C0006668", "name": "calcitonin" }, "Amylin": { "id": "UMLS:C0063684", "name": "Amylin" }, "Adrenomedullin": { "id": "UMLS:C0215825", "name": "adrenomedullin" }, "Adrenomedullin 2": { "id": "UMLS:C0215825", "name": "adrenomedullin" }, "Transient Receptor Potential Vanilloid 4 (TRPV4)": { "id": "UniProtKB:A0A0D3MTH6", "name": "A0A0D3MTH6_ONCMY Transient receptor potential vanilloid 4 (trembl)" }, "Transient receptor potential (TRP) ion channels": { "id": "UMLS:C1563722", "name": "Transient Receptor Potential Channels" }, "TRPV1": { "id": "UMLS:C1564816", "name": "TRPV1 receptor" }, "TRPA1": { "id": "UMLS:C4505180", "name": "TRPA1 Cation Channel" }, "IgM deposition": { "id": "UMLS:C1442151", "name": "Ab.IgG & IgM" }, "Ubc9": { "id": "UniProtKB:Q9NGP4", "name": "UBC9_DICDI Sumo-conjugating enzyme ubc9 (sprot)" }, "Small ubiquitin-like modifier (SUMO)": { "id": "UniProtKB:A0A1V9YAZ7", "name": "A0A1V9YAZ7_9STRA Small ubiquitin-like modifier (SUMO) (trembl)" }, "Opioid receptor": { "id": "UMLS:C0034801", "name": "Opioid Receptor" }, "HDAC6": { "id": "UMLS:C3252835", "name": "HDAC6 protein, zebrafish" }, "IL-10 receptor": { "id": "UMLS:C1721056", "name": "Receptors, Interleukin-17" }, "Macrophage HDAC6": { "id": "UMLS:C3252835", "name": "HDAC6 protein, zebrafish" }, "IL-10": { "id": "UMLS:C0912462", "name": "IL-10-related T cell-derived inducible factor, IL-TIF" }, "CRMP2-Ubc9": { "id": "UniProtKB:A0A1R4ABV0", "name": "A0A1R4ABV0_BABMR CRMP2 (trembl)" }, "Neurotensin receptor 2 (NTSR2)": { "id": "PR:000001628", "name": "neurotensin receptor type 2" }, "R-type calcium channel (Cav2.3)": { "id": "UMLS:C0752275", "name": "Calcium Channels, R-Type" }, "PAR2": { "id": "UMLS:C2000133", "name": "PAR2 protein, Arabidopsis" }, "muGFP": { "id": null, "name": null }, "GPCRs": { "id": "UniProtKB:A0A8G0LMA4", "name": "A0A8G0LMA4_9HYPO PTH11-type GPCRs protein (trembl)" }, "Proinflammatory proteases": { "id": "UniProtKB:Q6T5I5", "name": "Q6T5I5_HELPX Proinflammatory outer membrane protein (Fragment) (trembl)" }, "G\u03b1q": { "id": null, "name": null }, "G\u03b1i": { "id": null, "name": null }, "\u03b2-arrestin": { "id": "UMLS:C0379339", "name": "beta-arrestin 1" }, "dynamin-2 (Dnm2)": { "id": "PR:000006603", "name": "dynamin-2" }, "Proinflammatory cytokine": { "id": "UMLS:C0079189", "name": "cytokine" }, "Nrf2": { "id": "UniProtKB:A0A2H4G8G8", "name": "A0A2H4G8G8_HELAM Nrf2 (trembl)" }, "superoxide dismutases 1 and 2": { "id": "UniProtKB:A0A0S3QR29", "name": "A0A0S3QR29_LABRO Iron/manganese superoxide dismutases (Fragment) (trembl)" }, "14-3-3\u03b3": { "id": "UMLS:C0090388", "name": "14-3-3 Proteins" }, "KOR": { "id": "UMLS:C1448855", "name": "KorA protein, bacteria" }, "JNK": { "id": "UniProtKB:Q8WQG9", "name": "JNK1_CAEEL Stress-activated protein kinase jnk-1 (sprot)" }, "mu-opioid receptor": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "MOR/KOR": { "id": "UniProtKB:D2KKV9", "name": "D2KKV9_9ACTN Kor (trembl)" }, "P-gp": { "id": "UMLS:C0119822", "name": "glycoprotein GP 68" }, "MOR": { "id": "UMLS:C4043330", "name": "MOR-103" }, "DOR": { "id": "UMLS:C2713953", "name": "DOR protein, Arabidopsis" }, "mu opioid receptor": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "mu-opioid receptors": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Kappa Opioid Receptor (KOR)": { "id": "UMLS:C0064239", "name": "Receptors, Opioid, kappa" }, "\u03bc Opioid Receptor (MOR)": { "id": "PR:000001612", "name": "mu-type opioid receptor" }, "opioid ligand": { "id": "UMLS:C0815090", "name": "Ligand-Gated Ion Channels" }, "\u03bc-opioid receptor": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Opioid receptors": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Kappa opioid receptor": { "id": "UMLS:C0064239", "name": "Receptors, Opioid, kappa" }, "Mu opioid receptor": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Human Opioid Receptors": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "\u03bc-opioid receptors": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Mu opioid receptor (MOR)": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "mu-delta opioid receptor heterodimer (MDOR)": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Src": { "id": "UMLS:C0282625", "name": "src-Family Kinases" }, "calcium/calmodulin-dependent protein kinase II (CaMKII)": { "id": "PR:000003197", "name": "calcium/calmodulin-dependent protein kinase type II chain" }, "\u00b5-opioid receptors": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "\u03bc opioid receptor": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "Insulin": { "id": "UMLS:C0021641", "name": "Insulin" }, "opioid receptors": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "mouse MOR": { "id": "UMLS:C1261572", "name": "Morc1 protein, mouse" }, "5-HT2A receptors": { "id": "UMLS:C0289174", "name": "Receptor, Serotonin, 5-HT2A" }, "Chemokine receptors": { "id": "UMLS:C0282554", "name": "chemokine" }, "OPRM1 receptors": { "id": "UniProtKB:A0A7R8CHW1", "name": "A0A7R8CHW1_LEPSM OPRM1 (trembl)" }, "Ca V 3.2 calcium channels": { "id": "UMLS:C0054481", "name": "calcium potassium ATPase" }, "eIF5A": { "id": "UMLS:C1453871", "name": "Eif5a protein, mouse" }, "PKA": { "id": "UMLS:C0243459", "name": "PKA inhibitor" }, "Sarcomeric proteins": { "id": "UMLS:C0086174", "name": "Proteins, Recombinant DNA" }, "NaV1.7 channel": { "id": "UMLS:C3503759", "name": "NAV1.7 Voltage-Gated Sodium Channel" }, "ProTx-II": { "id": "UMLS:C1173733", "name": "ProTx-II peptide" }, "Human NaV1.7": { "id": "UMLS:C3503759", "name": "NAV1.7 Voltage-Gated Sodium Channel" }, "PTx2-3127": { "id": "UniProtKB:Q3S8Z9", "name": "Q3S8Z9_PSESH Ptx2 (trembl)" }, "hNaV1.7": { "id": null, "name": null }, "PTx2-3258": { "id": "UniProtKB:Q3S8Z9", "name": "Q3S8Z9_PSESH Ptx2 (trembl)" } }, "chemical (biolink:ChemicalEntity)": { "mRNA": { "id": "UMLS:C0026661", "name": "mRNA Precursor" }, "Leukotriene C4": { "id": "PUBCHEM.COMPOUND:5280493", "name": "leukotriene C4" }, "NMLTC4": { "id": "PUBCHEM.COMPOUND:101589051", "name": "Nmltc4" }, "FTY720": { "id": "PUBCHEM.COMPOUND:73673519", "name": "FTY720-Mitoxy" }, "CYM-5442": { "id": "UMLS:C2606019", "name": "CYM-5442" }, "SEW-2871": { "id": "UMLS:C0073137", "name": "REV 2871" }, "[11C]LY2795050": { "id": "UMLS:C3713821", "name": "11C-LY2795050" }, "Opioids": { "id": "UMLS:C0242402", "name": "Opioids" }, "Acetaminophen": { "id": "PUBCHEM.COMPOUND:1983", "name": "Acetaminophen" }, "Ibuprofen": { "id": "PUBCHEM.COMPOUND:3672", "name": "Ibuprofen" }, "opioid": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Alcohol": { "id": "CHEBI:30879", "name": "alcohol" }, "Fentanyl (FEN)": { "id": "PUBCHEM.COMPOUND:3345", "name": "Fentanyl" }, "Turneroic acid": { "id": "UMLS:C0001111", "name": "Acid Rain" }, "Oxylipins": { "id": "UMLS:C4704941", "name": "Bisacetylenic Oxylipins" }, "Epoxide moiety": { "id": "CHEBI:32955", "name": "epoxide" }, "oral morphine equivalents (OME)": { "id": "UMLS:C0360459", "name": "Morphine oral granules" }, "C781": { "id": null, "name": null }, "Nortriptyline": { "id": "PUBCHEM.COMPOUND:4543", "name": "Nortriptyline" }, "6-AmHap": { "id": "PUBCHEM.COMPOUND:88949721", "name": "[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-[6-(6-Dodeca-1,3,5,7,9,11-hexaynoxy-6-oxohexoxy)-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexoxy]-6-oxohexyl] 6-hydroxyhexanoate" }, "heroin vaccine": { "id": "PUBCHEM.COMPOUND:5462328", "name": "Heroin" }, "opioids": { "id": "UMLS:C0242402", "name": "Opioids" }, "heroin metabolites": { "id": "PUBCHEM.COMPOUND:5462328", "name": "Heroin" }, "methadone": { "id": "PUBCHEM.COMPOUND:4095", "name": "Methadone" }, "hydrocodone": { "id": "PUBCHEM.COMPOUND:5284569", "name": "Hydrocodone" }, "C14-linked 4,5-epoxymorphinan analogues": { "id": "PUBCHEM.COMPOUND:54238846", "name": "4,5-Epoxymorphinan" }, "6,14-AmidoHap, 14-AmidoMorHap, 14-AmidoHerHap": { "id": "PUBCHEM.COMPOUND:64876252", "name": "14-Butyl-6,14-diazadispiro[4.2.58.25]pentadecane" }, "heroin": { "id": "PUBCHEM.COMPOUND:5462328", "name": "Heroin" }, "heroin, 6-AM, and morphine": { "id": "UMLS:C3652947", "name": "morphine and antispasmodics" }, "14-AmidoHerHap": { "id": "PUBCHEM.COMPOUND:25125273", "name": "14-Deoxy-14-methylenetriptolide" }, "1-AmidoMorHap": { "id": "PUBCHEM.COMPOUND:101437392", "name": "1,1':1',1'':1'',1''':1''',1''''-Quinquecyclopropane-1-ol" }, "Heroin": { "id": "PUBCHEM.COMPOUND:5462328", "name": "Heroin" }, "1-AmidoMorHap epimer": { "id": "PUBCHEM.COMPOUND:23582940", "name": "Epimer A" }, "1 Amido-DihydroMorHap": { "id": "CHEMBL.COMPOUND:CHEMBL4526634", "name": "1" }, "1 Amido-DihydroMorHap epimer": { "id": "PUBCHEM.COMPOUND:23582940", "name": "Epimer A" }, "6-acetyl morphine": { "id": "PUBCHEM.COMPOUND:6428288", "name": "Morphine, 6-acetyl, propionyl" }, "Morphine": { "id": "PUBCHEM.COMPOUND:5288826", "name": "Morphine" }, "Methadone": { "id": "PUBCHEM.COMPOUND:4095", "name": "Methadone" }, "Naloxone": { "id": "PUBCHEM.COMPOUND:5284596", "name": "Naloxone" }, "Naltrexone": { "id": "PUBCHEM.COMPOUND:5360515", "name": "Naltrexone" }, "Buprenorphine": { "id": "PUBCHEM.COMPOUND:644073", "name": "Buprenorphine" }, "6'-guanidinonaltrindole (6'-GNTI)": { "id": "PUBCHEM.COMPOUND:9912633", "name": "6'-Guanidinonaltrindole" }, "6'-GNTI": { "id": "PUBCHEM.COMPOUND:90488790", "name": "6'-GNTI dihydrochloride" }, "cAMP": { "id": "PUBCHEM.COMPOUND:71312192", "name": "cAMP AM" }, "12- and 15- hydroxyeicosatetraenoic acid": { "id": "UMLS:C0206866", "name": "12-S-HETE" }, "pH-responsive nanoparticle": { "id": "CHEBI:50803", "name": "nanoparticle" }, "chemogenetic approaches": { "id": null, "name": null }, "optogenetic approaches": { "id": null, "name": null }, "FK506": { "id": "PUBCHEM.COMPOUND:87059324", "name": "FK506 Tacrolimus" }, "C5a receptor antagonist (PMX53)": { "id": "PUBCHEM.COMPOUND:5311121", "name": "C5a Receptor Antagonist, W-54011" }, "Global cytokine inhibitor (pentoxifylline)": { "id": "MESH:C560267", "name": "cytokine-induced apoptosis inhibitor 1, rat" }, "Immunosuppressive drugs": { "id": "MESH:D007166", "name": "Immunosuppressive Agents" }, "RNA m6A": { "id": "KEGG.COMPOUND:C00046", "name": "RNA" }, "6-hydroxydopamine (6-OHDA)": { "id": "PUBCHEM.COMPOUND:4624", "name": "Oxidopamine" }, "lofexidine": { "id": "CHEMBL.COMPOUND:CHEMBL1788132", "name": "LOFEXIDINE HYDROCHLORIDE" }, "nicotine": { "id": "PUBCHEM.COMPOUND:89594", "name": "Nicotine" }, "Compound 194": { "id": "UMLS:C1706082", "name": "Compound (substance)" }, "Analgesics": { "id": "UMLS:C4722089", "name": "Analgesics [TC]" }, "HDAC6 inhibitor": { "id": "PUBCHEM.COMPOUND:162679245", "name": "HDAC6 inhibitor XP5" }, "Cisplatin": { "id": "PUBCHEM.COMPOUND:5460033", "name": "Cisplatin" }, "Conotoxin contulakin-G (CGX)": { "id": "GTOPDB:1575", "name": "contulakin-G" }, "nitrotyrosine": { "id": "CHEBI:86267", "name": "nitrotyrosine" }, "peroxynitrite": { "id": "UMLS:C0136157", "name": "Peroxynitrite" }, "norBNI": { "id": "PUBCHEM.COMPOUND:44326617", "name": "Norbinaltorphimine (norBNI)" }, "Extended-Release Injectable Suspension": { "id": "UMLS:C5565852", "name": "cabotegravir extended-release injectable suspension" }, "Oral Naltrexone": { "id": "UMLS:C5777566", "name": "Naltrexone Hydrochloride 4.5 MG Oral Capsule" }, "Opioid Antagonist Naltrexone": { "id": "UMLS:C3536879", "name": "Opioid Antagonist [EPC]" }, "Long-Acting Injection Naltrexone (XR-naltrexone)": { "id": "UMLS:C4282509", "name": "naltrexone / oxycodone" }, "Opioid": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Buprenorphine-Naloxone": { "id": "UMLS:C1169989", "name": "buprenorphine / naloxone" }, "Extended-Release Naltrexone": { "id": "UMLS:C4720160", "name": "Naltrexone and Bupropion Hydrochlorides Extended-Release Tablets" }, "Heroin/Cocaine": { "id": "PUBCHEM.COMPOUND:5462328", "name": "Heroin" }, "Methamphetamine": { "id": "PUBCHEM.COMPOUND:10836", "name": "Methamphetamine" }, "Direct-acting antivirals": { "id": "UMLS:C3653501", "name": "DIRECT ACTING ANTIVIRALS" }, "naltrexone": { "id": "PUBCHEM.COMPOUND:5360515", "name": "Naltrexone" }, "buprenorphine": { "id": "PUBCHEM.COMPOUND:644073", "name": "Buprenorphine" }, "fentanyl": { "id": "PUBCHEM.COMPOUND:3345", "name": "Fentanyl" }, "cocaine": { "id": "PUBCHEM.COMPOUND:446220", "name": "Cocaine" }, "extended-release naltrexone (XR-NTX)": { "id": "RXCUI:863844", "name": "" }, "Opiate": { "id": "MESH:D053610", "name": "Opiate Alkaloids" }, "Methocinnamox (MCAM)": { "id": "PUBCHEM.COMPOUND:46877713", "name": "Methocinnamox" }, "Remifentanil": { "id": "PUBCHEM.COMPOUND:14873743", "name": "Remifentanil (oxalate)" }, "Food": { "id": "UMLS:C0016452", "name": "Food" }, "Cocaine": { "id": "PUBCHEM.COMPOUND:446220", "name": "Cocaine" }, "17-cyclopropylmethyl-3,14-dihydroxy-4,5-epoxy-6-[(3'-fluoro-4'-pyridyl)acetamido]morphinan (NFP)": { "id": "MESH:C550364", "name": "17-cyclopropylmethyl-3,14-dihydroxy-4,5-epoxy-6-((4'-pyridyl)acetamido)morphinan" }, "DAMGO": { "id": "PUBCHEM.COMPOUND:5462471", "name": "Damgo" }, "Etorphine": { "id": "PUBCHEM.COMPOUND:644209", "name": "Etorphine" }, "N-Phenethyl analogs": { "id": "PUBCHEM.COMPOUND:102233543", "name": "N-Phenethyl-Gly-N-phenethyl-Gly-N-phenethyl-Gly-OH" }, "N-norhydromorphone": { "id": "PUBCHEM.COMPOUND:10355824", "name": "Norhydromorphone" }, "N-p-chloro-phenethynorhydromorphone": { "id": "PUBCHEM.COMPOUND:435859", "name": "Phenethylamine, p-chloro-N-(p-chlorobenzyl)-" }, "morphine": { "id": "PUBCHEM.COMPOUND:5288826", "name": "Morphine" }, "Scopolamine": { "id": "CHEMBL.COMPOUND:CHEMBL1187846", "name": "SCOPOLAMINE" }, "N-methyl-D-aspartate antagonist phencyclidine": { "id": "UMLS:C3536824", "name": "N-methyl-D-aspartate Receptor Antagonist [EPC]" }, "sucrose": { "id": "PUBCHEM.COMPOUND:5988", "name": "Sucrose" }, "Mitragynine": { "id": "PUBCHEM.COMPOUND:3034396", "name": "Mitragynine" }, "7-hydroxymitragynine": { "id": "PUBCHEM.COMPOUND:44301524", "name": "7-Hydroxymitragynine" }, "Nalfurafine": { "id": "PUBCHEM.COMPOUND:6445230", "name": "Nalfurafine" }, "42B": { "id": "PUBCHEM.COMPOUND:5327318", "name": "Inhibitor 42b" }, "D24M": { "id": null, "name": null }, "3-dehydroxynaltrexamines": { "id": "PUBCHEM.COMPOUND:16133153", "name": "3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-[3-(3-Bromophenoxy)phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenoxy]phenol" }, "6\u03b1/\u03b2-3-dehydroxynaltrexamines": { "id": "UMLS:C0591170", "name": "\u03b2-cardone" }, "N-methyl-3-dehydroxynaltrexamines": { "id": "PUBCHEM.COMPOUND:113141800", "name": "N-methyl-3-(3-methyl-N-methylsulfonylanilino)-N-phenylpropanamide" }, "6\u03b1/\u03b2- N-methyl-3-dehydroxynaltrexamines": { "id": "UMLS:C0591170", "name": "\u03b2-cardone" }, "epoxymorphinan": { "id": "PUBCHEM.COMPOUND:22853338", "name": "Epoxymorphinan" }, "7-Hydroxymitragynine (7-HMG)": { "id": "PUBCHEM.COMPOUND:44301524", "name": "7-Hydroxymitragynine" }, "Mitragynine pseudoindoxyl": { "id": "PUBCHEM.COMPOUND:3034396", "name": "Mitragynine" }, "Fentanyl": { "id": "PUBCHEM.COMPOUND:3345", "name": "Fentanyl" }, "3-hydroxy of 17-cyclopropylmethyl-4,5\u03b1-epoxy-3,14\u03b2-dihydroxy-6\u03b2-[(4'-pyridyl) carboxamido]morphinan derivatives": { "id": "MESH:C587362", "name": "17-cyclopropylmethyl-3,14beta-dihydroxy-4,5alpha-epoxy-6alpha-(isoquinoline-3'-carboxamido)morphinan" }, "Analogues 1a-e": { "id": "UMLS:C5691273", "name": "Meglitinide Analogues" }, "3-dehydroxy ones 6a-e": { "id": "PUBCHEM.COMPOUND:118606281", "name": "E-Dehydroxy-Albicidin" }, "[35S]-GTP\u03b3S": { "id": "UMLS:C0887464", "name": "Cysteamine, 35S-Labeled" }, "Compound 1c (NCP)": { "id": "MESH:C511351", "name": "Red-1c compound" }, "3-dehydroxy analogue 6c": { "id": "PUBCHEM.COMPOUND:49798771", "name": "Dehydroxy xyloketal B" }, "Alkaloids": { "id": "UMLS:C3653469", "name": "Alkaloids, excl. rauwolfia, antihypertensives" }, "Oxindoles": { "id": "CHEBI:38459", "name": "oxindoles" }, "Mitragynine oxindole B (4)": { "id": "PUBCHEM.COMPOUND:3034396", "name": "Mitragynine" }, "Corynoxine (1)": { "id": "PUBCHEM.COMPOUND:10475115", "name": "Corynoxine" }, "Corynantheidine": { "id": "PUBCHEM.COMPOUND:3000341", "name": "Corynantheidine" }, "Corynoxine": { "id": "PUBCHEM.COMPOUND:10475115", "name": "Corynoxine" }, "Mitraciliatine": { "id": "PUBCHEM.COMPOUND:11741588", "name": "Mitraciliatine" }, "Isopaynantheine": { "id": "PUBCHEM.COMPOUND:101804033", "name": "Isopaynantheine" }, "Src-I1": { "id": "PUBCHEM.COMPOUND:10505737", "name": "epothilone I1" }, "KN93": { "id": "PUBCHEM.COMPOUND:5312122", "name": "Methoxybenzene-sulfonamide" }, "7-Hydroxymitragynine (7HMG)": { "id": "PUBCHEM.COMPOUND:44301524", "name": "7-Hydroxymitragynine" }, "Mitragynine (MTG)": { "id": "PUBCHEM.COMPOUND:3034396", "name": "Mitragynine" }, "Biased agonism": { "id": "UMLS:C5666966", "name": "Pegylated CD25/CD122-selective Interleukin-2 Mutein STK-012" }, "Allosteric modulators": { "id": "UMLS:C4743781", "name": "Allosteric Potentiator" }, "Heteromers": { "id": null, "name": null }, "PLGA": { "id": "PUBCHEM.COMPOUND:59434218", "name": "PLGA(1k)-PEG(1k)-PLGA(1k)" }, "Benzyl alcohol": { "id": "PUBCHEM.COMPOUND:123147", "name": "Benzyl" }, "Glucagon-like peptide-1 agonist": { "id": "UMLS:C2917359", "name": "GLP-1 Receptor Agonist [EPC]" }, "Liraglutide": { "id": "PUBCHEM.COMPOUND:16134956", "name": "Liraglutide" }, "Glucagon-like peptide-1 receptor agonists (GLP-1RAs)": { "id": "PUBCHEM.COMPOUND:16135499", "name": "Glucagon-like peptide 1" }, "Glucose": { "id": "PUBCHEM.COMPOUND:90470539", "name": "Uridine diphosphate glucose,[glucose-14c(u)]" }, "Poly(lactide-co-glycolide) (PLGA)": { "id": "MESH:C000595637", "name": "poly(lactide-co-glycolide)-block-poly(ethylene glycol)-block-poly(lactide-co-glycolide)" }, "Diastereomeric C9-alkenyl 5-phenylmorphans": { "id": "PUBCHEM.COMPOUND:24991635", "name": "Diastereomeric mix" }, "Forskolin": { "id": "PUBCHEM.COMPOUND:47936", "name": "Forskolin" }, "MOR antagonists": { "id": "UMLS:C5448087", "name": "MOR 210" }, "MOR full agonists": { "id": "UMLS:C3850134", "name": "Full Opioid Agonists" }, "2,5-Dimethoxy-4-Methylamphetamine (DOM)": { "id": "PUBCHEM.COMPOUND:85875", "name": "2,5-Dimethoxy-4-methylamphetamine" }, "2-Piperazin-1-yl-Quinoline (Quipazine)": { "id": "PUBCHEM.COMPOUND:5011", "name": "Quipazine" }, "Medications for Addiction Treatment": { "id": "UMLS:C0849171", "name": "medications for the reproductive system" }, "Drugs": { "id": "UMLS:C0282568", "name": "Drugs, Essential" }, "Substance use": { "id": "GTOPDB:2098", "name": "substance P" }, "RAP-103": { "id": "MESH:C571901", "name": "RAP-103" }, "Hypusine": { "id": "PUBCHEM.COMPOUND:65396", "name": "Hypusine" }, "Inflammatory mediators": { "id": "UMLS:C0002773", "name": "Analgesics, Anti-Inflammatory" }, "Calcium": { "id": "PUBCHEM.COMPOUND:5460341", "name": "Calcium" }, "Medications for OUD": { "id": "UMLS:C0849171", "name": "medications for the reproductive system" }, "alcohol": { "id": "CHEBI:30879", "name": "alcohol" }, "marijuana": { "id": "UMLS:C0304395", "name": "marijuana derivative" }, "nonmedical prescription drug": { "id": "UMLS:C0013231", "name": "Drugs, Non-Prescription" }, "punitive policies": { "id": null, "name": null }, "reporting policies": { "id": null, "name": null } }, "disease (biolink:Disease)": { "acute and chronic itch": { "id": "UMLS:C0302472", "name": "Acute and chronic cholecystitis" }, "Substance use": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Chronic constriction injury (CCI)": { "id": "UMLS:C0332680", "name": "Constriction injury" }, "alcoholism": { "id": "UMLS:C0856321", "name": "Alcoholism (excl psychosis)" }, "addictions": { "id": "UMLS:C5392818", "name": "Smartphone Addiction" }, "withdrawal": { "id": "UMLS:C0235097", "name": "Withdrawal convulsions" }, "depression": { "id": "UMLS:C0221745", "name": "Depression suicidal" }, "dependence": { "id": "UMLS:C0865351", "name": "dependence; phenmetrazine" }, "diversion into the community": { "id": "MONDO:0000707", "name": "diversion colitis" }, "pain": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "breakthrough pain": { "id": "UMLS:C3666010", "name": "Breakthrough Infections" }, "overdose": { "id": "UMLS:C0572066", "name": "Overdose of codeine" }, "Opioid Use Disorder (OUD)": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "drug use": { "id": "UMLS:C0013222", "name": "Drug Use Disorders" }, "Chronic pain": { "id": "UMLS:C0744939", "name": "hip pain chronic" }, "TMD": { "id": "MONDO:0010870", "name": "tibial muscular dystrophy" }, "Pain": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "Opioid Use Disorder": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Neuropathic corneal pain (NCP)": { "id": "UMLS:C0339223", "name": "Neuropathic corneal ulcer" }, "neurotoxicity": { "id": "EFO:0011057", "name": "neurotoxicity" }, "influenza (flu)": { "id": "MONDO:0005812", "name": "influenza" }, "H1N1 flu": { "id": "UMLS:C0948873", "name": "Flu symptoms" }, "Migraine": { "id": "MONDO:0005277", "name": "migraine disorder" }, "Headache": { "id": "UMLS:C1565107", "name": "Headache Disorders, Secondary" }, "chronic pain": { "id": "UMLS:C0744939", "name": "hip pain chronic" }, "comorbid pain in depression (CP)": { "id": "UMLS:C0871610", "name": "Winter Depression" }, "opioid withdrawal-induced aversion": { "id": "UMLS:C2013197", "name": "opioid-induced sleep disorder during withdrawal" }, "Inflammatory pain": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "Neuropathic pain": { "id": "UMLS:C1963916", "name": "Diabetic peripheral neuropathic pain" }, "Complex Regional Pain Syndrome (CRPS)": { "id": "MONDO:0019369", "name": "complex regional pain syndrome" }, "Arthritis": { "id": "UMLS:C0741233", "name": "arthritis reiter" }, "Joint inflammation": { "id": "UMLS:C0409205", "name": "Inflammation of joint of foot" }, "complex regional pain syndrome (CRPS)": { "id": "MONDO:0019369", "name": "complex regional pain syndrome" }, "Neuroinflammation": { "id": "MONDO:0004466", "name": "neuronitis" }, "inflammatory pain": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "neuropathic pain": { "id": "UMLS:C1963916", "name": "Diabetic peripheral neuropathic pain" }, "BzATP-induced pain": { "id": "UMLS:C0391976", "name": "Pain Disorder" }, "nerve injury-induced pain": { "id": "UMLS:C0262593", "name": "Peripheral Nerve Injuries" }, "Itch": { "id": "MONDO:0001951", "name": "Norwegian scabies" }, "hindpaw nociceptive sensitization": { "id": "UMLS:C0685477", "name": "Supernumerary hindpaw phalanx" }, "Chemotherapy-induced peripheral neuropathy (CIPN)": { "id": "UMLS:C3873567", "name": "Peripheral neuropathy due to and following antineoplastic therapy" }, "Mechanical allodynia": { "id": "MONDO:0004753", "name": "mechanical strabismus" }, "Nerve injury": { "id": "UMLS:C0161479", "name": "Nerve injury" }, "Colitis": { "id": "MONDO:0005292", "name": "colitis" }, "Chronic multisite musculoskeletal pain": { "id": "UMLS:C3178789", "name": "Widespread Chronic Pain" }, "COVID-19": { "id": "MONDO:0100096", "name": "COVID-19" }, "Opioid Withdrawal": { "id": "UMLS:C0029104", "name": "Opioid withdrawal" }, "Opioid Dependence": { "id": "MONDO:0005530", "name": "opiate dependence" }, "Opioid Relapse": { "id": "UMLS:C2959881", "name": "Relapse pulmonary tuberculosis" }, "Opioid use disorder": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "HIV": { "id": "UMLS:C4505456", "name": "HIV Coinfection" }, "Substance Use Disorder": { "id": "UMLS:C1405565", "name": "disorder; mental, due to use of, amfetamine (or related substance)" }, "Substance use disorders (SUD)": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Hepatitis C (HCV)": { "id": "MONDO:0012292", "name": "hepatitis C virus, susceptibility to" }, "Opioid use disorder (OUD)": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Substance Use Disorders": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Hepatitis C": { "id": "MONDO:0002251", "name": "hepatitis" }, "Human Immunodeficiency Virus (HIV)": { "id": "UMLS:C0338422", "name": "Human immunodeficiency virus leukoencephalopathy" }, "Substance Use": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Substance use disorder": { "id": "UMLS:C1405565", "name": "disorder; mental, due to use of, amfetamine (or related substance)" }, "HIV/HCV co-infected individuals": { "id": "UMLS:C1698259", "name": "HCV coinfection" }, "HIV/HCV co-infection": { "id": "UMLS:C0864665", "name": "symptomatic HIV infection" }, "Opioid Use Disorder Care Continuum": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "opioid use disorder (OUD)": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "opioid withdrawal": { "id": "UMLS:C0029104", "name": "Opioid withdrawal" }, "Antinociceptive": { "id": null, "name": null }, "Antiscratch": { "id": null, "name": null }, "Motor Incoordination": { "id": "UMLS:C0264673", "name": "Incoordination of papillary muscle" }, "Hypolocomotion": { "id": null, "name": null }, "Mental health disorders": { "id": "UMLS:C4061796", "name": "Mental health issue" }, "Substance use disorders": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Acquired Immunodeficiency Syndrome (AIDS)": { "id": "MONDO:0012268", "name": "AIDS" }, "Hyperalgesia": { "id": "UMLS:C3665909", "name": "Instillation site hyperalgesia" }, "Allodynia": { "id": null, "name": null }, "Respiratory depression": { "id": "UMLS:C1386218", "name": "depression; respiratory center" }, "Opium withdrawal symptoms": { "id": "UMLS:C1395824", "name": "drug withdrawal symptoms; syndrome" }, "Opioid withdrawal syndrome": { "id": "UMLS:C0029104", "name": "Opioid withdrawal" }, "Addiction": { "id": "UMLS:C1274914", "name": "Addiction to sun exposure" }, "Abuse liability": { "id": "UMLS:C0871049", "name": "patient abuse" }, "Opioid use disorders (OUD)": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Substance use disorders (SUDs)": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "Obesity": { "id": "MONDO:0011122", "name": "obesity disorder" }, "Type two diabetes": { "id": "UMLS:C3837972", "name": "diabetes mellitus type 1 - IDDM2" }, "Gastrointestinal malaise": { "id": "UMLS:C1720231", "name": "Malaise with AIDS (acquired immunodeficiency syndrome)" }, "U.S. opioid epidemic": { "id": "NCIT:C171452", "name": "Epidemic Disorder" }, "Opioid overdose deaths": { "id": "UMLS:C0572061", "name": "Morphinan opioid overdose" }, "opioid overdose deaths": { "id": "UMLS:C0572061", "name": "Morphinan opioid overdose" }, "opioid use disorder": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "Postincarceration Fatal Overdoses": { "id": "UMLS:C0206277", "name": "Fatal Outcome" }, "HIV (human immunodeficiency virus)": { "id": "UMLS:C0338422", "name": "Human immunodeficiency virus leukoencephalopathy" }, "opioid-related overdose": { "id": "UMLS:C0572061", "name": "Morphinan opioid overdose" }, "Sexually transmitted infections": { "id": "MONDO:0021681", "name": "sexually transmitted disease" }, "opioid-derived respiratory depression": { "id": "UMLS:C1386218", "name": "depression; respiratory center" }, "opioid reinforcement": { "id": "UMLS:C5392920", "name": "Opioid Misuse" }, "opioid physical dependence": { "id": "MONDO:0005530", "name": "opiate dependence" }, "opioid-induced dysregulation of mesolimbic chemokine receptors": { "id": "UMLS:C5447320", "name": "Immune Dysregulation Disorder" }, "heroin acquisition": { "id": "UMLS:C0858353", "name": "Addicted to heroin" }, "morphine-induced deficits in CCR2 and CCR5": { "id": "UMLS:C0454625", "name": "Deficits in attention motor control and perception" }, "facial pain": { "id": "MONDO:0001818", "name": "facial neuralgia" }, "hypoxia": { "id": "UMLS:C0520599", "name": "Hypoxia, in liveborn infant" }, "respiratory depression": { "id": "UMLS:C1386218", "name": "depression; respiratory center" }, "Inflammation": { "id": "UMLS:C0877467", "name": "Inflammation of mouth" }, "Depression": { "id": "UMLS:C0221745", "name": "Depression suicidal" }, "Posttraumatic stress disorder": { "id": "UMLS:C2733207", "name": "Complex posttraumatic stress disorder" }, "PTSD": { "id": "UMLS:C3166103", "name": "PhenX measure - posttraumatic stress disorder (PTSD)" }, "Infections": { "id": "UMLS:C0947879", "name": "Infections NEC" }, "Neonatal Abstinence Syndrome (NAS)": { "id": "MONDO:0005566", "name": "neonatal abstinence syndrome" }, "substance use": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" }, "neonatal abstinence syndrome (NAS)": { "id": "MONDO:0005566", "name": "neonatal abstinence syndrome" }, "Sleep/alertness disturbance": { "id": "UMLS:C0852566", "name": "Disturbances in sleep phase rhythm" } }, "gene (biolink:Gene)": { "Cysltr2 transcript": { "id": "NCBIGene:57105", "name": "CYSLTR2" }, "CYSLTR2": { "id": "NCBIGene:57105", "name": "CYSLTR2" }, "Cartpt": { "id": "NCBIGene:9607", "name": "CARTPT" }, "Cocaine- and amphetamine-regulated transcript": { "id": "NCBIGene:127153843", "name": "cart1" }, "FKBP5": { "id": "NCBIGene:2289", "name": "FKBP5" }, "STK25": { "id": "NCBIGene:10494", "name": "STK25" }, "PRKAR1A": { "id": "NCBIGene:5573", "name": "PRKAR1A" } }, "Biological System (biolink:None)": { "Nociceptive system": { "id": "UMLS:C3178766", "name": "Nociceptive Pain" }, "Innate immune system": { "id": "REACT:R-DRE-168249", "name": "Innate Immune System (Danio rerio)" }, "Immune system": { "id": "UBERON:0002405", "name": "immune system" }, "Peripheral sensory nervous system": { "id": "UMLS:C0869552", "name": "Procedure on peripheral nervous system" } }, "Anatomical Structure (biolink:AnatomicalEntity)": { "Peripheral nerve": { "id": "UBERON:0002464", "name": "nerve trunk" }, "Nerve trunk": { "id": "UBERON:0001021", "name": "nerve" }, "Dorsal root ganglion": { "id": "UBERON:0000044", "name": "dorsal root ganglion" }, "Spinal dorsal horn": { "id": "CL:0011000", "name": "dorsal horn interneuron" }, "Anterior cingulate cortex (ACC)": { "id": "UBERON:0009835", "name": "anterior cingulate cortex" }, "Hippocampus": { "id": "UBERON:0002310", "name": "hippocampus fimbria" }, "Left anterior cingulate cortex (ACC)": { "id": "UBERON:0009835", "name": "anterior cingulate cortex" }, "Right hippocampus": { "id": "UMLS:C2327364", "name": "Right hippocampus" }, "Paraspinal muscles (PSMs)": { "id": "UMLS:C0448353", "name": "Paraspinal Muscles" }, "L4L5 disc": { "id": "UMLS:C1556138", "name": "Disc - Body Part" }, "Multifidus (MF)": { "id": "UMLS:C0224319", "name": "Structure of multifidus muscle" }, "Erector spinae (ES)": { "id": "UBERON:0002462", "name": "erector spinae muscle group" }, "Psoas": { "id": "UBERON:0008450", "name": "psoas muscle" }, "Dorsal root ganglion (DRG)": { "id": "UBERON:0000044", "name": "dorsal root ganglion" }, "Dorsolateral prefrontal cortex (DLPFC)": { "id": "UMLS:C4019080", "name": "Dorsolateral Prefrontal Cortex" }, "Motor cortex (MC)": { "id": "UMLS:C2324518", "name": "Left primary motor cortex" }, "Amygdala": { "id": "UBERON:0001876", "name": "amygdala" }, "Nucleus Accumbens/Ventral anterior internal capsule (NAc/VC)": { "id": "UBERON:0002637", "name": "ventral anterior nucleus of thalamus" }, "Dorsolateral prefrontal and medial premotor cortices": { "id": "UMLS:C4019080", "name": "Dorsolateral Prefrontal Cortex" }, "Nucleus accumbens (NAc)": { "id": "UBERON:0001882", "name": "nucleus accumbens" }, "Subgenual Cingulate Cortex": { "id": "UMLS:C5450290", "name": "subgenual anterior cingulate cortex" }, "Anterior Cingulate Cortex": { "id": "UMLS:C5700070", "name": "Anterior Cingulate Cortex" }, "Medial Prefrontal Cortex": { "id": "UMLS:C3498368", "name": "medial prefrontal cortex - macaque" }, "Nucleus Accumbens": { "id": "UBERON:0001882", "name": "nucleus accumbens" }, "Dorsal columns": { "id": "UBERON:0005373", "name": "spinal cord dorsal column" }, "Medial-dorsal columns": { "id": "UMLS:C2322796", "name": "Subdivision of medial dorsal nucleus" }, "Thoracic T9-12": { "id": "UMLS:C1179693", "name": "T9 innervation" }, "Lower extremities": { "id": "UMLS:C0231130", "name": "Structure of fetal lower extremities" } }, "Organism System (biolink:None)": { "Immune system": { "id": "UBERON:0002405", "name": "immune system" }, "Nervous system": { "id": "UBERON:0001016", "name": "nervous system" } }, "Cell type (biolink:Cell)": { "Nociceptors": { "id": null, "name": null }, "Human induced pluripotent stem cell derived nociceptors": { "id": "UMLS:C3658289", "name": "Human Induced Pluripotent Stem Cells" }, "DRG sensory neurons": { "id": "UMLS:C0027883", "name": "Afferent neuron" }, "Sensory neurons": { "id": "UMLS:C0027883", "name": "Afferent neuron" }, "Human DRG neurons": { "id": "UMLS:C0027882", "name": "Neurons" }, "Human nociceptor somata": { "id": "CL:0000198", "name": "pain receptor cell" }, "Nociceptive sensory neurons": { "id": "UMLS:C0027883", "name": "Afferent neuron" }, "Macrophages": { "id": "UMLS:C0085236", "name": "Macrophages, Alveolar" }, "Nociceptive neurons": { "id": "UMLS:C0027882", "name": "Neurons" }, "Neurons": { "id": "UMLS:C0027882", "name": "Neurons" }, "Astroglia": { "id": "UMLS:C0004112", "name": "Astrocytes" }, "Oligodendrocytes": { "id": "UMLS:C0028944", "name": "Oligodendroglia" }, "Sensory neuron": { "id": "CL:0000101", "name": "sensory neuron" }, "Dorsal root ganglion neurons": { "id": "CL:1001451", "name": "sensory neuron of dorsal root ganglion" }, "Microglia": { "id": "UMLS:C0206116", "name": "Microglia" }, "Glial cells": { "id": "UMLS:C5417706", "name": "Allogeneic Glial Progenitor Cells" }, "Astrocytes": { "id": "UMLS:C0004112", "name": "Astrocytes" }, "Inflammatory cells": { "id": "UMLS:C0440752", "name": "Inflammatory cell" }, "Glutamatergic/somatostatinergic interneurons (Y1-INs)": { "id": "UMLS:C0021792", "name": "Interneurons" }, "Immune cells": { "id": "UMLS:C4329351", "name": "Antineoplastic Immune Cell" }, "Glia": { "id": "CL:0000125", "name": "glial cell" }, "Mesenchymal stem cells (MSC)": { "id": "UMLS:C1257975", "name": "Mesenchymal Stem Cells" }, "Peripheral sensory neurons": { "id": "CL:3000004", "name": "peripheral sensory neuron" }, "Primary afferent neurons": { "id": "UMLS:C2325162", "name": "Primary afferent neuron" }, "B cell": { "id": "CL:0000236", "name": "B cell" }, "Sciatic nerve resident M\u03a6s (rM\u03a6)": { "id": "CL:0000864", "name": "tissue-resident macrophage" }, "Regulatory T cells": { "id": "UMLS:C4267792", "name": "Cells.CD25+CD127-" }, "CD3+ total T cells": { "id": "UMLS:C3176906", "name": "Cells.cytoplasmic CD3" }, "Spinal microglia": { "id": "UMLS:C0206116", "name": "Microglia" }, "Dorsal root ganglion (DRG) nociceptor": { "id": "CL:1001451", "name": "sensory neuron of dorsal root ganglion" }, "Nav1.8-positive neurons": { "id": "UMLS:C0027882", "name": "Neurons" }, "Schwann cells": { "id": "UMLS:C0036387", "name": "Schwann Cells" }, "Trigeminal neurons": { "id": "UMLS:C0027882", "name": "Neurons" }, "spinal cord dorsal horn (DH) neurons": { "id": "CL:0011000", "name": "dorsal horn interneuron" }, "Neuropeptide Y (NPY) Y1 receptor-expressing interneuron (Y1-IN) population": { "id": "UMLS:C5688428", "name": "Population of all cells positive for progesterone receptor in portion of fluid" }, "Y1-INs": { "id": null, "name": null }, "DH neurons": { "id": "UMLS:C0027882", "name": "Neurons" }, "Peripheral afferent neurons": { "id": "UMLS:C0027883", "name": "Afferent neuron" }, "Mesenchymal stem cells": { "id": "UMLS:C1257975", "name": "Mesenchymal Stem Cells" }, "Trigeminal ganglia (TG) neurons": { "id": "UMLS:C0027882", "name": "Neurons" }, "Purkinje cells": { "id": "UMLS:C0034143", "name": "Purkinje Cells" } }, "Biological entity (biolink:None)": { "Genes": { "id": "UMLS:C0017337", "name": "Genes" }, "Gene": { "id": "UniProtKB:F6QVC4", "name": "F6QVC4_MOUSE RIKEN cDNA 1700049E17 gene, gene 1 (trembl)" }, "mRNA targets": { "id": "GO:0006402", "name": "mRNA catabolic process" }, "Biomarkers": { "id": "MESH:D054316", "name": "Biomarkers, Pharmacological" } }, "Neurons (biolink:None)": { "Nociceptors": { "id": "UBERON:0035017", "name": "nociceptor" } }, "Organ (biolink:AnatomicalEntity)": { "Dorsal root ganglia (DRG)": { "id": "UBERON:0000044", "name": "dorsal root ganglion" }, "Trigeminal ganglia": { "id": "UBERON:0001675", "name": "trigeminal ganglion" }, "Synovium": { "id": "UMLS:C0586585", "name": "Synovium biopsy specimen" }, "Dorsal root ganglia": { "id": "UBERON:0000044", "name": "dorsal root ganglion" }, "Dorsal horn": { "id": "UMLS:C0752062", "name": "Posterior Horn Cells" }, "Basal ganglia": { "id": "UMLS:C3498743", "name": "basal ganglia circuit" }, "Thalamus": { "id": "UMLS:C3498341", "name": "thalamus (Crosby)" }, "Cerebellar white matter": { "id": "UBERON:0002317", "name": "white matter of cerebellum" }, "Human fetal brain": { "id": "UMLS:C0872050", "name": "Human Fetal Tissue" }, "Human brain": { "id": "UBERON:0000955", "name": "brain" }, "Amygdala": { "id": "UBERON:0001876", "name": "amygdala" }, "Medial prefrontal cortex": { "id": "UMLS:C3498368", "name": "medial prefrontal cortex - macaque" }, "Fetal brain": { "id": "UMLS:C0440731", "name": "Fetal brain" }, "Postnatal brain": { "id": "UBERON:0004922", "name": "postnatal subventricular zone" }, "Neonatal brain": { "id": "UMLS:C3282679", "name": "foreskin keratinocyte, neonatal" }, "Infant brain": { "id": "UMLS:C0596208", "name": "brain cell" }, "Fetal cerebellar vermis": { "id": "UBERON:0004720", "name": "cerebellar vermis" }, "Pons": { "id": "UBERON:0000988", "name": "pons" }, "Brain": { "id": "UBERON:0000955", "name": "brain" }, "Lumbar spine": { "id": "UMLS:C5181546", "name": "Spine lumbar | Ultrasound | Radiology" }, "Right masseter muscle": { "id": "UMLS:C4248212", "name": "Muscle body of right masseter" }, "Dorsal root ganglion (DRG)": { "id": "UBERON:0000044", "name": "dorsal root ganglion" }, "Cerebellum": { "id": "UBERON:0002037", "name": "cerebellum" }, "Medial cerebellar nuclei (MN)": { "id": "UBERON:0002130", "name": "cerebellar nuclear complex" }, "Upper Airway": { "id": "UMLS:C0458827", "name": "Airway structure" }, "Conus medullaris": { "id": "UBERON:0005437", "name": "conus medullaris" } }, "Anatomical structure (biolink:AnatomicalEntity)": { "Dorsal root ganglia (DRG)": { "id": "UBERON:0000044", "name": "dorsal root ganglion" }, "L4 and L5 DRGs": { "id": "UMLS:C0447720", "name": "Entire intervertebral symphysis between L4 and L5" }, "Limbic and frontal connections": { "id": "UMLS:C0546015", "name": "temporal and frontal lobes" }, "Limbic and subcortical circuitry": { "id": "UMLS:C0815275", "name": "Subcortical" }, "Somatosensory cortex": { "id": "UBERON:0008930", "name": "somatosensory cortex" } }, "Organism/Model (biolink:None)": { "Rodent chronic pain models": { "id": "HP:0012532", "name": "Chronic pain" } }, "Genes (biolink:None)": { "Neuronally-related genes": { "id": "MESH:D036225", "name": "Receptor, EphB1" }, "Genes": { "id": "UMLS:C0017337", "name": "Genes" }, "Dynamin (Dnm) 1 to 3": { "id": "NCBIGene:448130", "name": "dnm1" }, "Opioid genes": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" } }, "Organism (Human Ethnic Group) (biolink:PopulationOfIndividualOrganisms)": { "Native American": { "id": "UMLS:C1515945", "name": "American Indian or Alaska Native" }, "Fort Peck Assiniboine and Sioux": { "id": "UMLS:C1555055", "name": "Fort Peck Assiniboine Sioux (ethnic group)" } }, "Intervention (biolink:None)": { "Wak\u021f\u00e1\u014bye\u017ea (Little Holy One)": { "id": "NCBITaxon:204149", "name": "Ocimum tenuiflorum" }, "Education and prescribing guidelines": { "id": "UMLS:C0582584", "name": "Training and Education" }, "Communities That HEAL (CTH) intervention": { "id": "UMLS:C0086944", "name": "Rural Communities" }, "SurgeryPalTM": { "id": null, "name": null }, "Housing First model": { "id": "UMLS:C5544474", "name": "Housing Quality" } }, "Other (biolink:None)": { "Social Support (SS)": { "id": "UMLS:C0037438", "name": "Social support" }, "Project WATCH": { "id": "UMLS:C1709701", "name": "Project" }, "Hospital medical records": { "id": "UMLS:C0025103", "name": "Medical Records Department, Hospital" }, "Medicare Part D": { "id": "UMLS:C1955953", "name": "Medicare Part D" }, "Medicaid": { "id": "UMLS:C0025071", "name": "Medicaid" }, "Comprehensive Opioid Addiction Treatment (COAT) program": { "id": "UMLS:C1144855", "name": "Opioid addiction treatment program" }, "West Virginia": { "id": "UMLS:C0043127", "name": "West Virginia" }, "GeoPain": { "id": null, "name": null }, "VAS": { "id": "NCBIGene:410692", "name": "vas" }, "PANAS": { "id": "UMLS:C0193018", "name": "Linear proctotomy" }, "PAINS": { "id": "UMLS:C0456669", "name": "Suxamethonium pains" }, "School climate": { "id": "UMLS:C0036375", "name": "School" }, "Health insurance status": { "id": "UMLS:C0021682", "name": "Health Insurance" }, "Pragmatic Explanatory Continuum Indicator Summary (PRECIS-2)": { "id": "UMLS:C1706244", "name": "Summary (document)" }, "Whole Health model": { "id": "UMLS:C0596657", "name": "health care model" }, "Whole Health Team (WHT)": { "id": "UMLS:C0086390", "name": "Medical Care Team" }, "Primary Care Group Education (PC-GE)": { "id": "UMLS:C3870363", "name": "Education note:Find:Pt:{Setting}:Doc:Primary care" }, "Usual VA Primary Care (UPC)": { "id": "UMLS:C0033137", "name": "Primary Health Care" }, "Cognitive behavioral therapy": { "id": "UMLS:C0009244", "name": "Cognitive Therapy" }, "Nonpharmacological therapies": { "id": "UMLS:C0949266", "name": "Therapies, Investigational" }, "Pharmacological therapies": { "id": "UMLS:C0205464", "name": "pharmacological" }, "Medicare": { "id": "UMLS:C0018717", "name": "Medicare" }, "Prescription Drug Monitoring Program (PDMP)": { "id": "UMLS:C4505167", "name": "Prescription Drug Monitoring Programs" }, "Opioid Reduction Act": { "id": "UMLS:C2246160", "name": "activation of cellular pH reduction" }, "mHealth": { "id": "UMLS:C2718080", "name": "Mobile Health" }, "Reinforcement learning": { "id": "UMLS:C0683263", "name": "reinforcement and learning" }, "Thompson-Sampling bandit algorithms": { "id": "UMLS:C0005349", "name": "Sampling Bias" }, "IntelligentPooling": { "id": null, "name": null }, "Pragmatic clinical trials (PCTs)": { "id": "UMLS:C3658215", "name": "Pragmatic Clinical Trials as Topic" }, "Pain Management Collaboratory": { "id": "UMLS:C0002766", "name": "Pain management" }, "Veteran and military health systems": { "id": "UMLS:C5197818", "name": "Military Health Services" }, "Minnesota law": { "id": "UMLS:C0026183", "name": "Minnesota" }, "Smartphone application (app)": { "id": "UMLS:C4723949", "name": "Smartphone Application" }, "Progressive muscle relaxation (PMR)": { "id": "UMLS:C0454043", "name": "Progressive muscle relaxation" }, "Electronic headache diary": { "id": "UMLS:C0376660", "name": "Diary" }, "MIDAS scores": { "id": "NCBITaxon:78354", "name": "Saguinus midas midas" }, "Electronic health record": { "id": "UMLS:C1555708", "name": "electronic health record - ActClassContainer" }, "Primary care providers": { "id": "UMLS:C0497107", "name": "Consult between primary care providers" }, "Nurses": { "id": "UMLS:C0028661", "name": "Nurses" }, "Medical assistants": { "id": "UMLS:C0205476", "name": "Medical" }, "Knowledge to Action (KTA) framework": { "id": "UMLS:C4296486", "name": "Barriers to action" }, "Addiction treatment": { "id": "UMLS:C3242777", "name": "addiction treatment center" }, "Affordable Care Act (ACA)": { "id": "UMLS:C2936611", "name": "Patient Protection and Affordable Care Act" }, "Discharge against medical advice (DAMA)": { "id": "UMLS:C0743214", "name": "Discharged against medical advice" }, "Counselor turnover": { "id": "UMLS:C1561602", "name": "counselor" }, "Women and Trauma Study": { "id": "UMLS:C0869027", "name": "Study and teaching" }, "successful opioid use outcome": { "id": "UMLS:C4324621", "name": "Opioid Use Disorder" }, "opioid use outcome": { "id": "UMLS:C0240602", "name": "opioid use" }, "Depressive symptoms": { "id": "UMLS:C0086132", "name": "Depressive Symptoms" }, "opioid outcomes": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Goal of opioid abstinence at treatment entry": { "id": "UMLS:C2042175", "name": "abstinence from alcohol" }, "Mutual-help group participation": { "id": "UMLS:C0679842", "name": "addiction mutual help and support group" }, "good treatment outcomes": { "id": "UMLS:C2015919", "name": "outcomes orthopedics limb integrity good" }, "good outcomes": { "id": "UMLS:C0205170", "name": "Good" }, "Depression history": { "id": "UMLS:C0455383", "name": "FH: Depression" }, "good opioid outcomes": { "id": "UMLS:C2015919", "name": "outcomes orthopedics limb integrity good" }, "Electronic Health Record (EHR)": { "id": "UMLS:C3869638", "name": "Electronic health record implementation stage" }, "Telemedicine": { "id": "UMLS:C0162648", "name": "Telemedicine" }, "Addiction consult services (ACS)": { "id": "UMLS:C2224451", "name": "services source consult services" }, "Substance use treatment": { "id": "UMLS:C0150359", "name": "Substance use therapy" }, "Markov model": { "id": "UMLS:C2697586", "name": "Hidden Markov Model" }, "Oregon Medicaid data": { "id": "UMLS:C0025071", "name": "Medicaid" }, "Bayesian logistic regression models": { "id": "UMLS:C0206031", "name": "Logistic Regression" }, "Prescription drug monitoring programs (PDMPs)": { "id": "UMLS:C4505167", "name": "Prescription Drug Monitoring Programs" }, "Narcotic Score (NS) metric": { "id": "UMLS:C0025867", "name": "Metric System" }, "WHO Alcohol, Smoking, and Substance Involvement Screening Test (ASSIST)": { "id": "UMLS:C1319363", "name": "Antibacterial substance screening test" }, "Patient reported outcomes (PROs)": { "id": "UMLS:C2987124", "name": "Patient Reported Outcome" }, "Homelessness": { "id": "UMLS:C0237154", "name": "Homelessness" }, "Falls": { "id": "HP:0002527", "name": "Falls" }, "Body Mass Index (BMI)": { "id": "UMLS:C1305855", "name": "Body mass index" }, "Pain": { "id": "EFO:0003843", "name": "pain" }, "HEALing Communities Study (HCS)": { "id": "UMLS:C0086944", "name": "Rural Communities" }, "Evidence-based practices (EBPs)": { "id": "UMLS:C4042944", "name": "Evidence-Based Facility Design" }, "Community coalition-based intervention (Communities that HEAL [CTH])": { "id": "UMLS:C0009462", "name": "Community" }, "RE-AIM/PRISM implementation science framework": { "id": "FB:FBgn0024254", "name": "aim" }, "Physical activity": { "id": "UMLS:C0026606", "name": "Physical activity" }, "JJ-TRIALS": { "id": "UMLS:C3658215", "name": "Pragmatic Clinical Trials as Topic" }, "BH Services Cascade": { "id": "MGI:88159", "name": "bh" }, "EPIS": { "id": "HP:0000039", "name": "Epispadias" }, "Core": { "id": "NCBIGene:1254201", "name": "corE" }, "Core+Enhanced": { "id": "UMLS:C5200846", "name": "Robot-Enhanced Surgery" }, "Clinical staff": { "id": "UMLS:C0205210", "name": "Clinical" }, "Medicaid/insurance": { "id": "UMLS:C5778825", "name": "Enrolled in Medicaid health insurance coverage" }, "BeatPain": { "id": null, "name": null }, "Telehealth": { "id": "UMLS:C1328956", "name": "Telehealth" }, "Brief pain consult (BPC)": { "id": "UMLS:C1511326", "name": "Brief Pain Inventory" }, "Telehealth physical therapy (PT)": { "id": "UMLS:C5571523", "name": "Note:Find:Pt:Telehealth:Doc:Physical therapy" }, "Medicare-ineligible population": { "id": "UMLS:C1512714", "name": "Ineligibility" }, "Homophobic name-calling": { "id": "UMLS:C5707982", "name": "Variant Calling" }, "Substance use": { "id": "UMLS:C0150359", "name": "Substance use therapy" }, "Verbal sexual harassment": { "id": "UMLS:C0162467", "name": "Harassment, Non-Sexual" }, "Peer relationship quality": { "id": "UMLS:C2169948", "name": "relationship problems with peer group" }, "Parenting resources": { "id": "UMLS:C2073758", "name": "child protective services referral to parenting resources" }, "Mobile technology": { "id": "UMLS:C0231435", "name": "Mobile" }, "Web-based treatment delivery": { "id": "UMLS:C3873719", "name": "Web-based calculator" }, "Social Connection": { "id": "UMLS:C0728831", "name": "Social" }, "Family Check-Up (FCU)": { "id": "UMLS:C0850544", "name": "gynaecological check up" }, "NIDA's Principles of Substance Use Prevention for Early Childhood": { "id": "UMLS:C0150358", "name": "Substance use prevention" }, "Workers' compensation (WC) insurance": { "id": "UMLS:C0681106", "name": "Workers' Compensation Insurance" } }, "Disease Model (biolink:None)": { "Mouse inflammatory pain model": { "id": "UMLS:C0234251", "name": "Inflammatory pain" } }, "Cognitive Process (biolink:None)": { "Cocaine Words (CW)": { "id": "UMLS:C2010447", "name": "garbles words" } }, "Technique (biolink:Procedure)": { "Functional magnetic resonance imaging (fMRI)": { "id": "UMLS:C0376335", "name": "fMRI" }, "Dynamic causal modeling (DCM)": { "id": "UMLS:C2986744", "name": "Dynamic Scan" }, "Resting state functional MRI": { "id": "UMLS:C5554796", "name": "Resting Functional Magnetic Resonance Imaging" }, "MRI": { "id": "UMLS:C0917711", "name": "MRI Scans" } }, "Biological molecule (biolink:None)": { "mRNA": { "id": "UniProtKB:O45146", "name": "O45146_CAEEL Embryonic mRna (mRNA) Anterior (trembl)" }, "Cellular proteome": { "id": "UMLS:C0178539", "name": "Cellular" }, "MicroRNAs": { "id": "HGNC.FAMILY:476", "name": "MicroRNAs" } }, "Sequence Variants (Alleles) (biolink:None)": { "Genetic variation": { "id": "UMLS:C0314603", "name": "Genetic" } }, "Treatment (biolink:Procedure)": { "Spinal manipulative therapy (SMT)": { "id": "UMLS:C0949742", "name": "Manipulation Therapy" }, "Virtual perspective-taking intervention": { "id": "UMLS:C3494470", "name": "Virtual Reality Exposure Therapy" }, "Cognitive therapy (CT)": { "id": "UMLS:C0009244", "name": "Cognitive Therapy" }, "Mindfulness meditation (MM)": { "id": "UMLS:C4724961", "name": "Online Mindfulness Meditation" }, "Activation skills (AS)": { "id": "UMLS:C0556562", "name": "Life skills training" }, "Physical therapy": { "id": "UMLS:C0949766", "name": "Physical therapy" }, "Flexibility training": { "id": "UMLS:C2945658", "name": "flexibility exercises" }, "Yoga": { "id": "UMLS:C1883583", "name": "Yoga" }, "Core strengthening": { "id": "UMLS:C0815165", "name": "strengthening individual competencies" }, "Cognitive behavioral therapies": { "id": "UMLS:C0009244", "name": "Cognitive Therapy" }, "Acupuncture": { "id": "UMLS:C0394664", "name": "Acupuncture procedure" }, "Pharmacological treatment": { "id": "UMLS:C1963873", "name": "Pharmacological cardioversion" }, "Mindfulness-based interventions": { "id": "UMLS:C5769522", "name": "Mindfulness Based Stress Reduction program" }, "Cognitive behavioral therapy for chronic pain (CBT-CP)": { "id": "UMLS:C4763869", "name": "Cognitive behavioral therapy for insomnia" }, "Self-care CIH therapies": { "id": "UMLS:C1279747", "name": "Promotion of self-care" }, "Practitioner-delivered CIH therapies": { "id": "UMLS:C0949266", "name": "Therapies, Investigational" }, "Combination of self-care and practitioner-delivered CIH therapies": { "id": "UMLS:C1279747", "name": "Promotion of self-care" }, "Physical Therapy (PT)": { "id": "UMLS:C0949766", "name": "Physical therapy" }, "Move2Health (M2H)": { "id": null, "name": null }, "Mindfulness-Oriented Recovery Enhancement (MORE)": { "id": "UMLS:C2170389", "name": "repair of retinal detachment patient to recovery alert, oriented, stable" }, "Acceptance and commitment therapy": { "id": "UMLS:C3658321", "name": "Acceptance and Commitment Therapy" }, "Classification-based exercise and manual therapy intervention": { "id": "UMLS:C0454525", "name": "Manual Therapies" }, "Self-management approach": { "id": "UMLS:C0262675", "name": "Self-harm behavior management" }, "Methadone maintenance therapy (MMT)": { "id": "UMLS:C0588202", "name": "Drug addiction therapy - methadone" }, "Individualized care plans": { "id": "UMLS:C1144884", "name": "Individualized education program (iep)" }, "Antiretroviral Therapy": { "id": "UMLS:C1963724", "name": "Antiretroviral therapy" }, "Aerobic exercise": { "id": "UMLS:C0001701", "name": "Exercise, Aerobic" }, "Health education interventions": { "id": "UMLS:C1268941", "name": "Health risks education" }, "Community Outpatient Program": { "id": "UMLS:C1161268", "name": "Special program education community" }, "Medication-assisted treatment (MAT)": { "id": "UMLS:C4704949", "name": "Medication Assisted Treatment of Opioid" }, "Opioid agonist therapy (OAT)": { "id": "UMLS:C0279690", "name": "Releasing factor agonist therapy" }, "Antiretroviral Therapy (ART)": { "id": "UMLS:C1963724", "name": "Antiretroviral therapy" }, "Pain rehabilitation program": { "id": "UMLS:C0458264", "name": "Pain rehabilitation" }, "Substance use treatment": { "id": "UMLS:C0150362", "name": "Substance use treatment: overdose" }, "Medication treatment for opioid use disorder (MOUD)": { "id": "UMLS:C5209216", "name": "Opioid Use Disorder Treatment" }, "Individual Opioid Drug Counseling (ODC)": { "id": "UMLS:C0679947", "name": "individual counselling" }, "Buprenorphine treatment duration": { "id": "UMLS:C2076655", "name": "duration of infrared treatment" }, "Medications for Opioid Use Disorder (MOUD)": { "id": "UMLS:C5389789", "name": "digital therapeutics for opioid use disorder" }, "Chronic opioid therapy (COT)": { "id": "UMLS:C0203628", "name": "Radionuclide therapy for chronic leukemia" }, "Antipruritic therapies": { "id": "UMLS:C4544516", "name": "Administration of antipruritic" }, "Pharmacotherapy for opioid use disorder": { "id": "UMLS:C5441495", "name": "Pharmacotherapy for substance use" }, "TGF\u03b2 treatment": { "id": "UMLS:C0808304", "name": "Treatment battery.first" }, "Acceptance and Commitment Therapy for chronic pain": { "id": "UMLS:C3658321", "name": "Acceptance and Commitment Therapy" }, "Mindfulness Based Relapse Prevention for opioid misuse": { "id": "UMLS:C0679867", "name": "Relapse Prevention" }, "Chronic Opioid Therapy": { "id": "UMLS:C2936530", "name": "Opiate Substitution Treatment" }, "ADHD pharmacotherapy": { "id": "UMLS:C0013216", "name": "Pharmacotherapy" }, "Opioid maintenance therapies": { "id": "UMLS:C2936530", "name": "Opiate Substitution Treatment" }, "Neuromodulation treatment modalities": { "id": "UMLS:C1144746", "name": "pulsed magnetic neuromodulation for incontinence, per day" } }, "Organization (biolink:Agent)": { "US Drug Enforcement Administration": { "id": "UMLS:C1549052", "name": "Drug Enforcement Agency" }, "Ohio Medicaid": { "id": "UMLS:C4524280", "name": "Medicaid - Dental" }, "Centers for Disease Control and Prevention": { "id": "UMLS:C0007670", "name": "Centers for Disease Control and Prevention (U.S.)" }, "Multicenter Perioperative Outcomes Group (MPOG)": { "id": "UMLS:C1516186", "name": "Cancer Clinical and Economic Outcomes Shared Resource" }, "Medicare": { "id": "UMLS:C0596896", "name": "medicare/medicaid" }, "NIH-DOD-VA Pain Management Collaboratory": { "id": "UMLS:C0587486", "name": "Pain management department" }, "Veteran and Military Health Systems": { "id": "UMLS:C4302782", "name": "Military health institution" }, "Defense Health Agency": { "id": "UMLS:C0019859", "name": "Home Health Agencies" }, "National Institutes of Health": { "id": "UMLS:C0027468", "name": "United States National Institutes of Health" }, "Department of Defense": { "id": "UMLS:C1511775", "name": "Department of Defense" }, "Department of Veterans Affairs": { "id": "UMLS:C1549054", "name": "Veterans Affairs" }, "Veterans Affairs health care facilities": { "id": "UMLS:C1549054", "name": "Veterans Affairs" }, "Los Angeles County Department of Mental Health": { "id": "UMLS:C5240560", "name": "Health department" }, "Pain Management Collaboratory (PMC)": { "id": "UMLS:C0587486", "name": "Pain management department" }, "Military Treatment Facility Engagement Committee (MTFEC)": { "id": "UMLS:C3530278", "name": "Military Treatment Facility" }, "FDA": { "id": null, "name": null }, "Michigan Opioid Prescribing Engagement Network": { "id": "UMLS:C0470994", "name": "Network Management Ltd" }, "US Centers for Disease Control and Prevention": { "id": "UMLS:C0007670", "name": "Centers for Disease Control and Prevention (U.S.)" }, "Blue Cross Blue Shield of Michigan (BCBSM)": { "id": "UMLS:C1955981", "name": "Blue Cross Blue Shield Insurance Plans" }, "Military Health System (MHS)": { "id": "UMLS:C4302782", "name": "Military health institution" }, "Cincinnati Children's Hospital Medical Center Review Board": { "id": "UMLS:C0020017", "name": "Hospitals, Pediatric" }, "Stanford's IRB": { "id": null, "name": null }, "University of Toronto": { "id": "UMLS:C0020028", "name": "Hospitals, University" }, "The Hospital for Sick Children (SickKids)": { "id": "UMLS:C1552473", "name": "Rehabilitation Hospital - Children" }, "Medicaid": { "id": "UMLS:C4524280", "name": "Medicaid - Dental" }, "Private insurance": { "id": "UMLS:C3530226", "name": "Other Private Insurance" }, "National Institute on Drug Abuse's Center for the Clinical Trials Network": { "id": "UMLS:C1513885", "name": "National Cancer Institute of Canada Clinical Trials Group" }, "Promoting Action on Research Implementation in Health Services (PARiHS)": { "id": "UMLS:C2826339", "name": "Office of Research Services" }, "National Drug Abuse Treatment Clinical Trials Network (CTN)": { "id": "UMLS:C1513899", "name": "National Institute of Drug Abuse" }, "U.S. National Institute on Drug Abuse": { "id": "UMLS:C1513899", "name": "National Institute of Drug Abuse" }, "U.S. Food and Drug Administration (FDA)": { "id": "UMLS:C0041714", "name": "United States Food and Drug Administration" }, "Veterans Health Administration (VHA)": { "id": "UMLS:C4763569", "name": "Veterans Health Administration" }, "American College of Emergency Physicians": { "id": "UMLS:C1515941", "name": "American College of Radiology" }, "University of Wisconsin's Center for Health Enhancement and Systems Studies (CHESS)": { "id": "UMLS:C0027450", "name": "National Center for Health Statistics, U.S." }, "George Mason University's Center for Advancing Correctional Excellence! (ACE!)": { "id": "UMLS:C4277546", "name": "National Center for Advancing Translational Sciences (U.S.)" }, "National Institute on Drug Abuse": { "id": "UMLS:C1513899", "name": "National Institute of Drug Abuse" }, "National Institutes of Health (NIH)": { "id": "UMLS:C0027468", "name": "United States National Institutes of Health" }, "HEAL Initiative": { "id": null, "name": null }, "National Institutes for Health (NIH)": { "id": "UMLS:C0027468", "name": "United States National Institutes of Health" }, "Acupuncture Advisory Panel (AAP)": { "id": "UMLS:C1513881", "name": "National Cancer Advisory Board" }, "National Drug Early Warning System (NDEWS)": { "id": "UMLS:C1513899", "name": "National Institute of Drug Abuse" }, "Drug Outbreak Testing Service (DOTS)": { "id": "UMLS:C1546531", "name": "Hospital Service - Medical Service" }, "National Institute of Allergy and Infectious Diseases": { "id": "UMLS:C1513895", "name": "National Institute of Allergy and Infectious Diseases (U.S.)" }, "Preventing Opioid Use Disorder in Older Adolescents and Young Adults cooperative": { "id": "UMLS:C1551288", "name": "Rehabilitation, Substance Use Disorder Unit" }, "Helping to End Addiction Long-term (HEAL) Initiative": { "id": "UMLS:C1708733", "name": "Long-Term Care Facility" }, "HEAL Prevention Cooperative (HPC)": { "id": "UMLS:C0679729", "name": "cooperative" }, "Food and Drug Administration (FDA)": { "id": "UMLS:C0041714", "name": "United States Food and Drug Administration" } }, "Organism (Human) (biolink:Cohort)": { "Advanced practice providers (nurse practitioners and physician assistants)": { "id": "UMLS:C0028657", "name": "nurse practitioner" }, "Primary care providers": { "id": "UMLS:C0033131", "name": "Primary Care Physicians" }, "Surgeons": { "id": "UMLS:C0282594", "name": "Barber Surgeons" }, "Primary Care Service Area (PCSA)": { "id": "UMLS:C0033131", "name": "Primary Care Physicians" }, "Primary Care Providers (PCPs)": { "id": "UMLS:C1552271", "name": "Nurse Practitioner - Primary Care" }, "Rheumatologists": { "id": "UMLS:C0334889", "name": "Rheumatologist" }, "Military service members and veterans": { "id": "UMLS:C1550414", "name": "Military Service (group)" }, "Primary care patients": { "id": "UMLS:C0033131", "name": "Primary Care Physicians" }, "Clinical practitioners": { "id": "UMLS:C0008961", "name": "Clinical Investigators" }, "Researchers": { "id": "UMLS:C0687734", "name": "medical researcher" }, "Nephrologist": { "id": "UMLS:C0260039", "name": "Nephrologists" }, "Dialysis Care Team": { "id": "UMLS:C4708570", "name": "Care team coordinator" }, "KDOQI": { "id": null, "name": null }, "Hemodialysis Patients": { "id": "UMLS:C0030705", "name": "Patients" }, "Older Adults": { "id": "UMLS:C0337511", "name": "Older sibling" }, "Juvenile justice youth (JJ-youth)": { "id": "UMLS:C0087178", "name": "Youth" }, "Caregivers": { "id": "UMLS:C0086279", "name": "Family Caregivers" }, "JJ staff": { "id": "UMLS:C0728982", "name": "Staff nurse" } }, "Activity (biolink:Activity)": { "Physical activity": { "id": "UMLS:C0026606", "name": "Physical activity" }, "Exercise": { "id": "UMLS:C0015259", "name": "Exercise" } }, "Measurement (biolink:None)": { "Opioid prescription size": { "id": "UMLS:C5392921", "name": "Prescription Opioid Abuse" }, "Patient-reported opioid consumption": { "id": "UMLS:C2987124", "name": "Patient Reported Outcome" }, "American Society of Anesthesiologists class": { "id": "UMLS:C2346733", "name": "American Society of Anesthesiologists" }, "Age": { "id": "EFO:0000246", "name": "age" }, "Pain frequency in the past 6 months": { "id": "UMLS:C4054235", "name": "Past Seven Days Frequency of Pain in the Abdomen" }, "Morphine milligram equivalents": { "id": "UMLS:C5575766", "name": "Oral Morphine Milligram Equivalents" }, "Finnegan Score": { "id": "UMLS:C5442581", "name": "Finnegan score increased" }, "Patient-Reported Outcomes Measurement Information System pain interference computer-adapted test score": { "id": "UMLS:C2964659", "name": "Patient Reported Outcomes Measurement Information System" }, "CEP T2* relaxation times": { "id": "UMLS:C0767948", "name": "CEP-701" }, "Vertebral BMFF": { "id": "UMLS:C0877400", "name": "Vertebral lesion" }, "T1\u03c1 relaxation times in the nucleus pulposus (NP T1\u03c1)": { "id": "UMLS:C0678212", "name": "Herniation of nucleus pulposus" }, "Ocular surface disease index (OSDI)": { "id": "UMLS:C3896641", "name": "Ocular Surface Disease Index" }, "Ocular pain assessment survey (OPAS)": { "id": "HP:0200026", "name": "Ocular pain" }, "Transmissible Liability Index (TLI)": { "id": "UMLS:C0021686", "name": "Insurance, Liability" }, "Consumption Frequency Index (CFI)": { "id": "UMLS:C0429625", "name": "Indexed oxygen consumption" }, "Overall Problem Density (OPD)": { "id": "UMLS:C4289616", "name": "EPIC-CP - Overall Problem Urinary Function" }, "Length of stay": { "id": "UMLS:C0023303", "name": "Length of Stay" }, "Hazard ratio": { "id": "UMLS:C2985465", "name": "Hazard Ratio" }, "Quality-adjusted life years": { "id": "UMLS:C0080071", "name": "Quality-Adjusted Life Years" }, "Quality of life (QoL)": { "id": "UMLS:C0034380", "name": "Quality of life" } }, "Lifestyle factor (biolink:Behavior)": { "Tobacco use": { "id": "UMLS:C0543414", "name": "Tobacco use" } }, "Database (biolink:None)": { "Clinformatics DataMart Database": { "id": "UMLS:C0872249", "name": "Databases, Protein" }, "Optum's de-identified Clinformatics Data Mart database": { "id": "UMLS:C4505080", "name": "Data Mart" } }, "Statistical method (biolink:Activity)": { "Logistic regression": { "id": "UMLS:C0206031", "name": "Logistic Regression" }, "Cluster analysis": { "id": "UMLS:C0009085", "name": "statistical cluster" } }, "Sequence Variants (biolink:None)": { "Single Nucleotide Polymorphisms": { "id": "UMLS:C0752046", "name": "Single Nucleotide Polymorphism" }, "Single Nucleotide Polorphisms": { "id": "UMLS:C0752046", "name": "Single Nucleotide Polymorphism" }, "Oprm1 splice variants": { "id": "UMLS:C1720834", "name": "Splice Variants, Protein" }, "7 transmembrane (7TM) C-terminal splice variants": { "id": "UMLS:C1720834", "name": "Splice Variants, Protein" }, "Exon 7": { "id": "NCIT:C13231", "name": "Exon" }, "Exon 4": { "id": "NCIT:C13231", "name": "Exon" } }, "Chemicals (biolink:ChemicalEntity)": { "Buprenorphine/Naloxone": { "id": "PUBCHEM.COMPOUND:6321408", "name": "Buprenorphine/naloxone" }, "Metabolites": { "id": "UMLS:C0578570", "name": "Metabolites and metabolic markers" }, "Prescription drugs": { "id": "UMLS:C0304227", "name": "Prescription Drugs" }, "Pollutants": { "id": "UMLS:C0014417", "name": "Environmental Pollutants" }, "Chemicals": { "id": "UMLS:C0220806", "name": "Chemicals" }, "Endocannabinoids": { "id": "MESH:D063388", "name": "Endocannabinoids" }, "Cannabinoids": { "id": "UMLS:C0683087", "name": "cannabinoids in any form" }, "Mu agonists": { "id": "UMLS:C0243192", "name": "agonists" }, "Compounds 2, 5, 17, and 19": { "id": "PUBCHEM.COMPOUND:22806907", "name": "19-Triphenylsiloxy-5-androsten-17-one" }, "Biomarkers": { "id": "MESH:D054316", "name": "Biomarkers, Pharmacological" }, "New psychoactive substances (NPS)": { "id": "UMLS:C0682880", "name": "Psychoactive substance" }, "Marijuana": { "id": "UMLS:C0304395", "name": "marijuana derivative" }, "Opioids": { "id": "UMLS:C0242402", "name": "Opioids" }, "Drugs": { "id": "UMLS:C0282568", "name": "Drugs, Essential" } }, "procedure (biolink:Procedure)": { "Medication Assisted Treatment (MAT)": { "id": "UMLS:C4704949", "name": "Medication Assisted Treatment of Opioid" }, "Surgery": { "id": "UMLS:C0748275", "name": "RENAL CALCULUS SURGERY SURGERY" }, "Behavioral Therapy": { "id": "UMLS:C2733064", "name": "Behavioral activation therapy" }, "Patient Navigation (PN)": { "id": "UMLS:C5392974", "name": "Surgical Navigation" }, "Contingency Management (CM)": { "id": "UMLS:C0683476", "name": "Contingency Management" }, "Patient Navigation (PN) and Contingency Management (CM)": { "id": "UMLS:C0683476", "name": "Contingency Management" }, "HCV care facilitation": { "id": "UMLS:C0589254", "name": "Facilitation of speech" }, "Medication assisted therapy (MAT)": { "id": "UMLS:C5392985", "name": "Pet-Assisted Therapy" }, "HIV testing": { "id": "UMLS:C0459958", "name": "HIV screen" } }, "drug (biolink:Drug)": { "Buprenorphine": { "id": "PUBCHEM.COMPOUND:644073", "name": "Buprenorphine" }, "Chronic Opioid Therapy": { "id": "UMLS:C0307841", "name": "Therapy Bayer Aspirin Caplets" }, "Benzodiazepine": { "id": "UMLS:C3536850", "name": "Benzodiazepine [EPC]" }, "Long acting opioid": { "id": "UMLS:C1579330", "name": "Opioid Analgesics, Long-acting" }, "Buprenorphine/Naloxone": { "id": "UMLS:C4067597", "name": "Buprenorphine/naloxone, oral, greater than 10 mg buprenorphine" }, "aprepitant": { "id": "PUBCHEM.COMPOUND:135413536", "name": "Aprepitant" }, "Gabapentin": { "id": "PUBCHEM.COMPOUND:3446", "name": "Gabapentin" }, "Ketorolac": { "id": "PUBCHEM.COMPOUND:3826", "name": "Ketorolac" }, "Extended-release naltrexone (XR-NTX)": { "id": "RXCUI:863844", "name": "" }, "Buprenorphine-naloxone (BUP-NX)": { "id": "UMLS:C1169989", "name": "buprenorphine / naloxone" }, "Methadone": { "id": "PUBCHEM.COMPOUND:4095", "name": "Methadone" }, "Naltrexone": { "id": "PUBCHEM.COMPOUND:5360515", "name": "Naltrexone" }, "Buprenorphine Extended-Release": { "id": "PUBCHEM.COMPOUND:644073", "name": "Buprenorphine" }, "Extended-release injectable naltrexone": { "id": "UMLS:C4720160", "name": "Naltrexone and Bupropion Hydrochlorides Extended-Release Tablets" }, "Buprenorphine-naloxone": { "id": "UMLS:C1169989", "name": "buprenorphine / naloxone" }, "MOUD": { "id": null, "name": null }, "Injectable Naltrexone": { "id": "UMLS:C4282509", "name": "naltrexone / oxycodone" }, "Naloxone": { "id": "PUBCHEM.COMPOUND:5284596", "name": "Naloxone" }, "Medication for OUD (MOUD)": { "id": "UMLS:C2945846", "name": "medication for anaphylaxis" }, "Highly active antiviral therapy (HAART)": { "id": "UMLS:C0003451", "name": "Antiviral Agents" }, "Stavudine (D4T)": { "id": "PUBCHEM.COMPOUND:18283", "name": "Stavudine" }, "Morphine": { "id": "PUBCHEM.COMPOUND:5288826", "name": "Morphine" }, "Vivitrol": { "id": "PUBCHEM.COMPOUND:5360515", "name": "Naltrexone" }, "Medications for opioid use disorder (MOUD)": { "id": "UMLS:C0849171", "name": "medications for the reproductive system" }, "Pre-exposure prophylaxis (PrEP)": { "id": "UMLS:C5427989", "name": "antiviral pre-exposure prophylaxis" }, "Extended-release (XR) naltrexone": { "id": "UMLS:C4720160", "name": "Naltrexone and Bupropion Hydrochlorides Extended-Release Tablets" }, "Extended-release buprenorphine (XR-B; BRIXADI\u2122 formulation)": { "id": "UMLS:C5433203", "name": "Buprenorphine Extended-Release Injection" }, "FDA-approved medications for opioid use disorder (MOUD)": { "id": "UMLS:C0849171", "name": "medications for the reproductive system" } }, "Biological structure (biolink:AnatomicalEntity)": { "Fronto-temporal-limbic pathways": { "id": "UMLS:C3498126", "name": "fronto-orbital white matter" }, "Frontal-subcortical (basal ganglia and cerebellum) pathways": { "id": "UMLS:C0228291", "name": "Basal ganglia and capsules" }, "Lipid raft": { "id": "UMLS:C1167250", "name": "lipid raft" }, "Facial muscle-based action units (AUs)": { "id": "UBERON:0015789", "name": "cranial or facial muscle" } }, "Outcome (biolink:None)": { "Mortality": { "id": "EFO:0004352", "name": "mortality" }, "Hospital readmission": { "id": "UMLS:C0600290", "name": "Hospital Readmissions" }, "Revision operation": { "id": "UMLS:C0439617", "name": "Revision" }, "Opioid overdose": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Vertebral fracture": { "id": "HP:0041166", "name": "Fractured vertebra" }, "Nonvertebral fracture": { "id": "UMLS:C0332761", "name": "Fracture Dislocation" }, "Response to SMT": { "id": "UMLS:C3180194", "name": "SMT A07" }, "Retention in treatment": { "id": "UMLS:C0679681", "name": "treatment outcome in HSR" }, "Arrest": { "id": "UMLS:C1389177", "name": "arrest; auricular" } }, "Sequence Variant (biolink:None)": { "Polymorphism": { "id": "UMLS:C1882417", "name": "Polymorphism" }, "COMT Polymorphism": { "id": "NCBIGene:1312", "name": "COMT" }, "Goutallier classification (GC)": { "id": "UMLS:C0524634", "name": "Angle's Classification" }, "Nrcam+10": { "id": "UniProtKB:A0A2J8QXV7", "name": "A0A2J8QXV7_PANTR NRCAM isoform 10 (Fragment) (trembl)" }, "Nrcam-10": { "id": "UniProtKB:A0A2J8QXV7", "name": "A0A2J8QXV7_PANTR NRCAM isoform 10 (Fragment) (trembl)" }, "Asn30\u2193Arg31": { "id": "UMLS:C1531442", "name": "acetyl-(Asn30,Tyr32)sCT(8-37)" }, "Nav1.8-/trkC-": { "id": "PUBCHEM.COMPOUND:162520669", "name": "Nav1.8-IN-2" }, "rs10485058": { "id": null, "name": null }, "A/A genotype at rs10485058": { "id": "UMLS:C4554368", "name": "AT genotype" }, "A/G and G/G genotypes at rs10485058": { "id": "PUBCHEM.COMPOUND:16204582", "name": "A* G G G G G G A* (Phosphorothioate)" }, "miR-95-3p": { "id": "UMLS:C3661131", "name": "miR-450a-3p" }, "ClinicalTrials.gov NCT03023930": { "id": "UMLS:C4086204", "name": "ClinicalTrials.gov" }, "DATA-waiver": { "id": "UMLS:C3827528", "name": "Waiver" }, "Genetic predisposition": { "id": "UMLS:C0314603", "name": "Genetic" } }, "Biological Process/Disease (biolink:None)": { "\u00b5-Opioid Activity in Chronic TMD Pain": { "id": "UMLS:C0747141", "name": "pain chronic management" } }, "Organ System (biolink:AnatomicalEntity)": { "Central nervous system": { "id": "UBERON:0001017", "name": "central nervous system" }, "Respiratory system": { "id": "UBERON:0001004", "name": "respiratory system" }, "Physiological systems": { "id": "UMLS:C2338512", "name": "Physiological cup" }, "Nervous system": { "id": "UBERON:0001016", "name": "nervous system" } }, "Concept (biolink:None)": { "Health care spending": { "id": "UMLS:C0086388", "name": "Health Care" }, "Readmissions": { "id": "UMLS:C0600290", "name": "Hospital Readmissions" }, "Ambulatory care visits": { "id": "UMLS:C0002423", "name": "Ambulatory Care" }, "Pain catastrophizing": { "id": "UMLS:C3178745", "name": "Pain Catastrophizing" }, "Pain interference": { "id": "HP:0012531", "name": "Pain" }, "Craving": { "id": "NCIT:C41365", "name": "Craving" }, "Mood difficulties": { "id": "UMLS:C0233479", "name": "Elevated mood" }, "Substance use": { "id": "UMLS:C0150359", "name": "Substance use therapy" }, "Academic performance": { "id": "UMLS:C0036373", "name": "Academic Performance" }, "Abstinence": { "id": "UMLS:C3843422", "name": "Abstinence" }, "Academic achievement": { "id": "UMLS:C0700132", "name": "Academic achievement" }, "Past-year substance users": { "id": "UMLS:C4086728", "name": "Past Year" }, "Skipping school": { "id": "UMLS:C0560437", "name": "Difficulty skipping" }, "Low grades": { "id": "FB:FBgn0011646", "name": "Low" }, "Lifetime non-users": { "id": "UMLS:C4071830", "name": "Lifetime" }, "Academic self-efficacy": { "id": "UMLS:C3533164", "name": "Self-efficacy score" }, "Emotional academic engagement": { "id": "UMLS:C3242376", "name": "Academic title" }, "Substance use prevention programs": { "id": "UMLS:C0150358", "name": "Substance use prevention" }, "Prescription drug misuse": { "id": "UMLS:C0581388", "name": "Prescription Drug Misuse" }, "High school heavy drinking": { "id": "UMLS:C0870649", "name": "High School Graduate" }, "Cigarette smoking": { "id": "UMLS:C0677453", "name": "Cigarette" }, "Marijuana use": { "id": "UMLS:C4316909", "name": "Marijuana Use" }, "Poly-prescription drug misuse": { "id": "UMLS:C4272633", "name": "Misuse of non-prescription drug" }, "4-year university degree": { "id": "UMLS:C5548976", "name": "University undergraduate degree" } }, "Location (biolink:None)": { "Massachusetts": { "id": "UMLS:C0024874", "name": "Massachusetts (geographic location)" }, "Connecticut": { "id": "UMLS:C0009778", "name": "Connecticut" }, "Michigan": { "id": "UMLS:C0025939", "name": "Michigan (geographic location)" }, "West Virginia": { "id": "UMLS:C0043127", "name": "West Virginia" }, "United States": { "id": "UMLS:C0041703", "name": "United States" }, "Rural county residence": { "id": "UMLS:C5691416", "name": "Rural Residence" }, "Urban counties": { "id": "UMLS:C0724128", "name": "Urban tradename" } }, "Medical condition (biolink:None)": { "Readmissions": { "id": "UMLS:C0600290", "name": "Hospital Readmissions" } }, "Policy (biolink:None)": { "Medicare Part D": { "id": "UMLS:C1955953", "name": "Medicare Part D" }, "Modifier 22": { "id": "PUBCHEM.COMPOUND:313794", "name": "22-Methyltritetracontane-22-ol" } }, "Biological characteristic (biolink:None)": { "Race": { "id": "NCBIGene:986027", "name": "racE" }, "Socioeconomic Status (SES)": { "id": "UMLS:C0086996", "name": "Socioeconomic Status" }, "Infant sex": { "id": "UMLS:C0021270", "name": "Infant" }, "Age": { "id": "EFO:0000246", "name": "age" }, "Annual clinic admissions": { "id": "UMLS:C2936216", "name": "Annual Weeds" }, "Race/Ethnicity": { "id": "UMLS:C5450304", "name": "CDC Race and Ethnicity" } }, "Technology (biolink:None)": { "ActiGraph technology": { "id": "UMLS:C4285610", "name": "Actigraph record" }, "Virtual reality (VR)": { "id": "UMLS:C0871582", "name": "Virtual Reality" }, "Biometric sensors": { "id": "UMLS:C2717871", "name": "Biometric Identification" }, "REDCap (Research Electronic Data Capture)": { "id": "UMLS:C4553958", "name": "Electronic Data Capture" }, "Fitbit Charge 4": { "id": "UMLS:C5207035", "name": "FitBit" }, "Electronic health records (EHRs)": { "id": "UMLS:C2362543", "name": "Electronic Health Records" }, "Health information technology (IT)": { "id": "UMLS:C2936756", "name": "Health Information Technology" }, "Patient portal": { "id": "UMLS:C4277550", "name": "Patient Portals" }, "Practice management system": { "id": "UMLS:C0600585", "name": "Practice Management" }, "mHealth": { "id": "UMLS:C2718080", "name": "Mobile Health" }, "Telemedicine (TM)": { "id": "UMLS:C0162648", "name": "Telemedicine" }, "Polysomnography": { "id": "UMLS:C0162701", "name": "Polysomnography" }, "Actigraphy": { "id": "UMLS:C1171301", "name": "Actigraphy" }, "Ambulatory polysomnography": { "id": "UMLS:C5401192", "name": "Ambulatory" }, "Electroencephalography": { "id": "UMLS:C0013819", "name": "Electroencephalography" }, "At-home sleep apnea testing": { "id": "UMLS:C4304208", "name": "Home-use sleep apnea recording system" }, "Electronic health record (EHR)": { "id": "UMLS:C3869638", "name": "Electronic health record implementation stage" }, "Patient Reported Outcomes Measurement Information System (PROMIS)": { "id": "UMLS:C2964659", "name": "Patient Reported Outcomes Measurement Information System" }, "JavaScript/Python": { "id": "UMLS:C0206304", "name": "Genus Python (organism)" }, "Graphical user interface (GUI)": { "id": "UMLS:C1710590", "name": "User Interface Device" } }, "Measurement Tool (biolink:None)": { "PROMIS 5-item Pain Interference scale": { "id": "UMLS:C2964387", "name": "PROMIS item bank - pain interference - version 1.0" }, "The STarT Back Tool": { "id": "UMLS:C4536888", "name": "STarT Back screening tool" }, "Patient-Reported Outcomes Measurement Information System Short Form (PROMIS-SF)": { "id": "UMLS:C2964659", "name": "Patient Reported Outcomes Measurement Information System" }, "Roland Morris Disability Questionnaire": { "id": "UMLS:C3639717", "name": "Roland Morris Disability Questionnaire" }, "Pain, Enjoyment and General Activity (PEG) scale": { "id": "UMLS:C4740017", "name": "Pain intensity, Enjoyment of life, General activity scale:-:Pt:^Patient:-:Pain intensity, Enjoyment of life, General activity (PEG)" }, "OUD Symptom Checklist": { "id": "UMLS:C0451524", "name": "Symptom checklist" }, "Patient Adherence Questionnaire for Opioid Use Disorder Treatment (PAQ-OUD)": { "id": "UMLS:C5209216", "name": "Opioid Use Disorder Treatment" }, "Pittsburgh Sleep Quality Index": { "id": "UMLS:C3697468", "name": "Pittsburgh sleep quality index" }, "Insomnia Severity Index": { "id": "UMLS:C4520529", "name": "Insomnia severity index" }, "Sleep diaries": { "id": "UMLS:C0037313", "name": "Sleep" }, "Visual analogue scales": { "id": "UMLS:C0042815", "name": "Visual Analog Pain Scale" }, "Likert scales": { "id": "UMLS:C0451267", "name": "Likert scale" }, "Pain intensity": { "id": "HP:0012531", "name": "Pain" }, "Pain interference": { "id": "HP:0012531", "name": "Pain" }, "Sleep quality": { "id": "EFO:0005272", "name": "sleep quality" } }, "Statistical Method (biolink:Activity)": { "Structural equation modeling (SEM)": { "id": "UMLS:C0681947", "name": "Structural Equation Modeling" } }, "Clinical Trial Identifier (biolink:None)": { "NCT03687762": { "id": null, "name": null } }, "Profession (biolink:None)": { "Orthopedic surgeons": { "id": "UMLS:C0334891", "name": "Orthopedic Surgeons" }, "Hospitalists": { "id": "UMLS:C0600620", "name": "Hospitalists" } }, "Process (biolink:None)": { "postoperative opioid prescribing": { "id": "UMLS:C0842499", "name": "Caudal injection of opioid, postoperative" }, "Whole exome sequencing": { "id": "UMLS:C3640077", "name": "Whole Exome Sequencing" }, "Array genotyping": { "id": "UMLS:C1510941", "name": "Array" }, "Opioid detoxification": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Healthcare utilization": { "id": "UMLS:C5447469", "name": "Healthcare Utilization" }, "Infant Foster Care": { "id": "UMLS:C0867871", "name": "care; infant, lack of" } }, "Biological Measurement (biolink:None)": { "Body mass index": { "id": "UMLS:C0518010", "name": "body mass" } }, "Physical Attribute (biolink:None)": { "Height": { "id": "UMLS:C0489786", "name": "Height" }, "Extension status": { "id": "UBERON:2000106", "name": "extension" } }, "Biological Attribute (biolink:None)": { "Gender": { "id": "UMLS:C0079399", "name": "Gender" } }, "Psychological Attribute (biolink:None)": { "Patients' expectations about medication and strengthening exercises": { "id": "UMLS:C0850583", "name": "advice and education about medication" } }, "region (biolink:None)": { "Appalachia": { "id": "NCBITaxon:180202", "name": "Appalachia" }, "West Virginia": { "id": "UMLS:C0043127", "name": "West Virginia" } }, "organization (biolink:Agent)": { "Behavioral Medicine (BMED)": { "id": "UMLS:C5769438", "name": "Forensic medicine center" }, "National Drug Abuse Treatment Clinical Trials Network": { "id": "UMLS:C1513899", "name": "National Institute of Drug Abuse" }, "Justice Community Opioid Innovation Network (JCOIN)": { "id": "UMLS:C0282622", "name": "Community Health Networks" } }, "Measurement Scale (biolink:None)": { "Oswestry Disability Index": { "id": "UMLS:C0451360", "name": "Oswestry disability index" }, "NIH Patient-Reported Outcomes Measurement Information System (PROMIS) Pain Interference scale": { "id": "UMLS:C2964659", "name": "Patient Reported Outcomes Measurement Information System" }, "PROMIS Anxiety": { "id": "UMLS:C3836326", "name": "PROMIS-29 questionnaire: anxiety" }, "PROMIS Sleep Disturbance": { "id": "UMLS:C3693643", "name": "PROMIS-29 questionnaire sleep disturbance" }, "Pain Catastrophizing Scale Short Form": { "id": "UMLS:C4273905", "name": "Pain Catastrophizing Scale" } }, "Therapy/Procedure (biolink:None)": { "Brief Cognitive Behavioral Therapy for Chronic Pain (BCBT-CP)": { "id": "UMLS:C4273841", "name": "Cognitive behavioral therapy for psychosis" } }, "Clinical Trial (biolink:None)": { "Improving Veteran Access to Integrated Management of Back Pain (AIM-Back)": { "id": "UMLS:C0277969", "name": "Abdominal pain through to back" }, "NCT04285112": { "id": null, "name": null }, "CTN0049": { "id": null, "name": null } }, "Phenotype (biolink:PhenotypicFeature)": { "Pain interference": { "id": "HP:0012531", "name": "Pain" }, "Pain intensity": { "id": "HP:0012531", "name": "Pain" }, "Depression symptom severity": { "id": "UMLS:C1579931", "name": "Depressed - symptom" }, "Sleep": { "id": "UMLS:C5392947", "name": "Sleep Insufficiency" }, "Self-efficacy": { "id": "UMLS:C3533164", "name": "Self-efficacy score" }, "Global impression of change": { "id": "UMLS:C4706354", "name": "Patient Global Impression of Improvement score" }, "Patient satisfaction": { "id": "UMLS:C0451370", "name": "Patient satisfaction score" }, "Social functioning": { "id": "UMLS:C0425244", "name": "Mobility - social functioning" }, "Psychological distress": { "id": "HP:0032941", "name": "Intense psychological distress to cues" }, "Hypertrophy phenotype": { "id": "EFO:0002460", "name": "hypertrophy" }, "Risky Behavior": { "id": "UMLS:C4304880", "name": "Able to identify risky behavior" } }, "biological process (biolink:None)": { "Biofilm": { "id": "MESH:D018441", "name": "Biofilms" }, "BOLDSV": { "id": null, "name": null }, "heroin-induced antinociception": { "id": "UMLS:C0858353", "name": "Addicted to heroin" }, "Trigeminal nociceptive behaviors": { "id": "UMLS:C3178766", "name": "Nociceptive Pain" }, "Headache-related behaviors": { "id": "UMLS:C0239886", "name": "Frontal headache" }, "GAP-43+ fiber synovial innervation": { "id": "UMLS:C5201127", "name": "innervation (process)" }, "CARTp-GPR160 interaction": { "id": "NCBIGene:26996", "name": "GPR160" }, "appetite": { "id": "UMLS:C0858274", "name": "Appetite suppressed" }, "thirst": { "id": "UMLS:C0039971", "name": "Thirst" }, "Self-efficacy for HIV treatment adherence": { "id": "UMLS:C0600564", "name": "Self Efficacy" }, "viral suppression": { "id": "UMLS:C0521026", "name": "Viral" }, "Heart rate": { "id": "UBERON:0000948", "name": "heart" }, "Blood pressure": { "id": "UBERON:0000178", "name": "blood" }, "Body temperature": { "id": "UMLS:C0005903", "name": "Body Temperature" }, "Activity": { "id": "UMLS:C0001289", "name": "Activity Cycles" }, "memory": { "id": "GO:0007613", "name": "memory" }, "brain reward thresholds": { "id": "UMLS:C0815012", "name": "brain reward pathway" }, "response latencies": { "id": "UMLS:C0242465", "name": "Response Latency" }, "Antinociception": { "id": null, "name": null }, "Hyperlocomotion": { "id": null, "name": null }, "neuroimmunity": { "id": null, "name": null }, "opioid exposure": { "id": "PUBCHEM.COMPOUND:126961754", "name": "Opioid" }, "Hypusine biosynthesis": { "id": "PUBCHEM.COMPOUND:65396", "name": "Hypusine" } }, "Sequence variant (biolink:None)": { "5' untranslated region": { "id": "NCIT:C13371", "name": "5' Untranslated Region" }, "5' untranslated regions": { "id": "UMLS:C0600493", "name": "5' Untranslated Regions" }, "Upstream open reading frame (uORF)": { "id": "NCBIGene:100085744", "name": "ASDURF" }, "Mu opioid receptor 118A>G": { "id": "UMLS:C0066908", "name": "Receptors, Opioid, mu" }, "68-bp repeat in prodynorphin": { "id": "UMLS:C3150643", "name": "CBS, 68-BP INS" }, "Prodynorphin SNP rs910080": { "id": "UMLS:C1527094", "name": "SNP Info" }, "Kappa opioid receptor SNP rs6473797": { "id": "UMLS:C0064239", "name": "Receptors, Opioid, kappa" }, "Opioid Reduction Act (SB 273)": { "id": "PUBCHEM.COMPOUND:9887568", "name": "Emindole Sb" } }, "Statistical Model (biolink:None)": { "Logistic Regression": { "id": "UMLS:C0206031", "name": "Logistic Regression" }, "Least Absolute Shrinkage and Selection Operator Regularization": { "id": "UMLS:C0332513", "name": "Shrinkage" }, "Receiver Operating Characteristic Area Under the Curve (AUC)": { "id": "UMLS:C0376690", "name": "Area Under Curve" }, "Confidence Interval (95% CI)": { "id": "UMLS:C5419036", "name": "Estimated Copy Number 95 Percent Confidence Interval" } }, "Condition (biolink:PhenotypicFeature)": { "Traumatic experiences": { "id": "UMLS:C5544356", "name": "Childhood Trauma" }, "Limb loss": { "id": "UMLS:C4014142", "name": "Loss of lower-limb tendon reflexes" }, "Tibia fracture": { "id": "HP:0041143", "name": "Fractured tibia" }, "Popliteal lymphadenopathy": { "id": "HP:0002716", "name": "Lymphadenopathy" }, "Prenatal hypoxia-ischemia (HI) injury": { "id": "EFO:1000846", "name": "brain hypoxia-Ischemia" }, "Age": { "id": "EFO:0000246", "name": "age" } }, "Geographic Location (biolink:None)": { "Metropolitan counties": { "id": "UMLS:C0599587", "name": "metropolitan" }, "Less populous counties": { "id": "UMLS:C0454770", "name": "Counties of Republic of Ireland" }, "Kentucky": { "id": "UMLS:C0022557", "name": "Kentucky (geographic area)" }, "Massachusetts": { "id": "UMLS:C0024874", "name": "Massachusetts (geographic location)" }, "New York": { "id": "UMLS:C0205314", "name": "New" }, "Ohio": { "id": "UMLS:C0028905", "name": "Ohio" } }, "sequence variant (biolink:None)": { "COMT Val158Met": { "id": "NCBIGene:1312", "name": "COMT" }, "COMT 158Met": { "id": "NCBIGene:1312", "name": "COMT" }, "Lys374": { "id": null, "name": null } }, "Therapy (biolink:Procedure)": { "brief cognitive behavioral therapy for chronic pain (BCBT-CP)": { "id": "UMLS:C4273841", "name": "Cognitive behavioral therapy for psychosis" }, "Cognitive behavioural therapy": { "id": "UMLS:C0579049", "name": "Generic cognitive behavioral therapy" }, "Mindful meditation": { "id": "UMLS:C0812167", "name": "Meditation facilitation" }, "Physiological biofeedback therapy": { "id": "UMLS:C2713543", "name": "Neurofeedback" }, "Mindfulness-Oriented Recovery Enhancement": { "id": "UMLS:C2170389", "name": "repair of retinal detachment patient to recovery alert, oriented, stable" }, "Individual counseling": { "id": "UMLS:C0679947", "name": "individual counselling" }, "12-Step participation": { "id": "UMLS:C0087028", "name": "Step Test" }, "Group therapy": { "id": "UMLS:C1527374", "name": "Group Therapy" } }, "Tool (biolink:None)": { "Numeric Rating Scale": { "id": "UMLS:C4050142", "name": "Numeric Rating Scale" }, "Self-Report Concise Associated Symptoms Tracking Scale (CAST-SR)": { "id": "UMLS:C0451487", "name": "Social adjustment scale self - report" }, "myTAPS": { "id": null, "name": null }, "Substance Abuse Self-Stigma Scale (SASSS)": { "id": "UMLS:C1290899", "name": "Self abuse" } }, "Sequence Variant (Allele) (biolink:None)": { "Rs678849": { "id": null, "name": null }, "rs1022563": { "id": null, "name": null }, "rs1997794": { "id": null, "name": null } }, "process (biolink:None)": { "opioid consumption after surgery": { "id": "UMLS:C4312994", "name": "Excessive acetaldehyde accumulation after alcohol consumption" }, "postoperative refills": { "id": "UMLS:C4285491", "name": "Refills prescribed:Num:Pt:Medication:Qn" }, "research": { "id": "UMLS:C0035168", "name": "research" }, "practice": { "id": "UMLS:C0237607", "name": "Practice Experience" }, "telehealth service delivery": { "id": "UMLS:C4520476", "name": "Telehealth service" }, "telehealth treatment": { "id": "UMLS:C1328956", "name": "Telehealth" }, "pain management practices": { "id": "UMLS:C0002766", "name": "Pain management" } }, "Biological Material (biolink:None)": { "Acellular dermal matrix": { "id": "UMLS:C3494272", "name": "Acellular Dermal Matrix" }, "Rat plasma": { "id": "UniProtKB:P14272", "name": "KLKB1_RAT Plasma kallikrein (sprot)" } }, "Biological Substance (biolink:None)": { "Maternal breast milk": { "id": "UMLS:C0026140", "name": "Milk, Human" } }, "Organ system (biolink:AnatomicalEntity)": { "CNS": { "id": "UMLS:C0682714", "name": "CNS component" } }, "Data (biolink:None)": { "Opioid prescription data": { "id": "UMLS:C5392921", "name": "Prescription Opioid Abuse" } }, "Organism part (biolink:AnatomicalEntity)": { "Spine": { "id": "UMLS:C1116441", "name": "spine facet" }, "Vertebral midline": { "id": "UMLS:C1660780", "name": "midline cell component" }, "3D spines": { "id": "UMLS:C5419550", "name": "Neurosphere" }, "Masseter muscle": { "id": "UBERON:0001597", "name": "masseter muscle" }, "Brainstem": { "id": "UBERON:0002298", "name": "brainstem" }, "Spinal cord": { "id": "UBERON:0002240", "name": "spinal cord" }, "Dorsal root ganglia": { "id": "UBERON:0000044", "name": "dorsal root ganglion" }, "Nociceptors": { "id": "UBERON:0035017", "name": "nociceptor" } }, "Lifestyle Factor (biolink:Behavior)": { "Diet": { "id": "UMLS:C0086152", "name": "Dietary Habits" }, "Lifestyle choices": { "id": "UMLS:C0870811", "name": "Lifestyle changes" }, "Early feeding patterns": { "id": "UMLS:C0015748", "name": "Feeding Patterns" } }, "Demographic Factor (biolink:None)": { "Age": { "id": "EFO:0000246", "name": "age" }, "Birth history": { "id": "HP:0033623", "name": "Birth history" } }, "Organism (Human role) (biolink:None)": { "Peer recovery coaches (PRCs)": { "id": "UMLS:C0876909", "name": "Coach (occupation)" } }, "Disease Symptom (biolink:DiseaseOrPhenotypicFeature)": { "symptoms": { "id": "UMLS:C1389777", "name": "symptoms; awareness" }, "Osteoarthritis pain": { "id": "MONDO:0005178", "name": "osteoarthritis" }, "Subchondral bone deterioration": { "id": "UMLS:C2609299", "name": "Subchondral bone edema" }, "Articular cartilage degeneration": { "id": "UMLS:C1394964", "name": "articular cartilage; degeneration" }, "Opioid cravings": { "id": "UMLS:C5392920", "name": "Opioid Misuse" } }, "Biological factor (biolink:None)": { "Peak alpha frequency (PAF)": { "id": "EFO:0006883", "name": "alpha peak frequency measurement" }, "Pain sensitivity": { "id": "HP:0012531", "name": "Pain" }, "Corticomotor excitability (CME)": { "id": "UMLS:C0235169", "name": "Excitability" } }, "Symptoms (biolink:None)": { "physical, mental, and social domains": { "id": "UMLS:C3165799", "name": "PhenX - physical, social, and mental health functioning - SF-36v2 protocol" }, "Negative affect\u2013related factors": { "id": "UMLS:C4716783", "name": "Factors that affect immune response" } }, "Behavior (biolink:Behavior)": { "Substance use": { "id": "UMLS:C0946429", "name": "Substance use behavior" }, "Cigarette Smoking": { "id": "UMLS:C0700219", "name": "Cigarette smoking behavior" }, "Smoking": { "id": "UMLS:C0037369", "name": "Smoking" }, "Cigarette smoking": { "id": "UMLS:C0700219", "name": "Cigarette smoking behavior" }, "Self-regulation": { "id": "UMLS:C2370884", "name": "Emotional Regulation" }, "Negative affect": { "id": "UMLS:C0001721", "name": "Affect (mental function)" } }, "cell type (biolink:Cell)": { "B-cells": { "id": "UMLS:C3178739", "name": "Effector B Cells" }, "CD4 T-cells": { "id": "UMLS:C5420769", "name": "Anti-CD4 CAR T-cells" }, "Neurons": { "id": "UMLS:C0027882", "name": "Neurons" }, "T follicular helper cells (Tfh)": { "id": "UMLS:C5392114", "name": "T Follicular Helper Cells" }, "B cells": { "id": "UMLS:C5382575", "name": "Cells.CD8.PMA+ionomycin stimulated CD107a+b expressing" }, "GFAP+ astrocytic cells": { "id": "UMLS:C0007634", "name": "Cells" }, "Iba1+ microglia": { "id": "UMLS:C0206116", "name": "Microglia" }, "Iba1+ (macrophage)": { "id": "CL:0000235", "name": "macrophage" }, "ATF3+ cells": { "id": "UMLS:C0007634", "name": "Cells" }, "macrophages and microglia": { "id": "UMLS:C0206116", "name": "Microglia" }, "Ganglion sensory neurons": { "id": "CL:1001451", "name": "sensory neuron of dorsal root ganglion" }, "Skin cells": { "id": "UMLS:C1956121", "name": "Skin Dendritic Cells" }, "MRC1 (CD206)-positive macrophages": { "id": "UMLS:C0085236", "name": "Macrophages, Alveolar" }, "DRG neurons": { "id": "UMLS:C0027882", "name": "Neurons" }, "Nociceptors": { "id": null, "name": null }, "Human stem cells": { "id": "UMLS:C1171346", "name": "Human Embryonic Stem Cells" }, "Sensory neurons": { "id": "UMLS:C0027883", "name": "Afferent neuron" }, "hiPSCs": { "id": null, "name": null }, "hiPSC samples": { "id": "UMLS:C3658289", "name": "Human Induced Pluripotent Stem Cells" }, "iPSC-CMs": { "id": "UMLS:C4764367", "name": "iPSC-derived Natural Killer Cells FT500" }, "C-fiber nociceptors": { "id": "UMLS:C0596568", "name": "fiber cell" }, "Mouse sensory neurons": { "id": "UMLS:C0027883", "name": "Afferent neuron" }, "Human sensory neurons": { "id": "UMLS:C0027883", "name": "Afferent neuron" } }, "Biological Product (biolink:None)": { "Vaccine": { "id": "UMLS:C0042209", "name": "Vaccine Therapy" } }, "Tissue (biolink:None)": { "Bone-marrow": { "id": "HP:0004333", "name": "Bone-marrow foam cells" }, "Hyaline cartilage": { "id": "UBERON:0001994", "name": "hyaline cartilage tissue" } }, "Cell (biolink:None)": { "DRG Macrophages": { "id": "FB:FBgn0000495", "name": "drg" }, "Macrophage Presence in DRG": { "id": "UMLS:C4481696", "name": "magnesium presence in blood" } }, "biological structure (biolink:AnatomicalEntity)": { "Trigeminal ganglia (TG)": { "id": "UBERON:0001675", "name": "trigeminal ganglion" }, "Dorsal root ganglia (DRG)": { "id": "UBERON:0000044", "name": "dorsal root ganglion" }, "TG neurons": { "id": "UMLS:C0027882", "name": "Neurons" }, "TG nociceptors": { "id": "CL:0002282", "name": "type TG enteroendocrine cell" }, "Hippocampal volume": { "id": "UMLS:C0524817", "name": "Mossy Fibers, Hippocampal" } }, "sequence variants (alleles) (biolink:None)": { "TRESK mutations": { "id": "MESH:C488253", "name": "TRESK-2 protein, mouse" }, "Splice variants of the \u03bc receptor": { "id": "UMLS:C1720834", "name": "Splice Variants, Protein" } }, "cellular component (biolink:None)": { "endosomes": { "id": "MESH:D011992", "name": "Endosomes" }, "spinal neurons": { "id": "UMLS:C0521329", "name": "Spinal" } }, "Gene Part (biolink:None)": { "Exon 10 of Nrcam gene": { "id": "UMLS:C5412191", "name": "Gene analysis (MPL proto-oncogene, thrombopoietin receptor) sequence analysis of exon 10" } }, "Gene/Protein (biolink:None)": { "SIRT1": { "id": "NCBIGene:23411", "name": "SIRT1" }, "CaMKII\u03b1": { "id": "NCBIGene:815", "name": "CAMK2A" } }, "organism part (biolink:AnatomicalEntity)": { "central amygdala": { "id": "UBERON:0002883", "name": "central amygdaloid nucleus" }, "nociceptive sensory afferents": { "id": "UBERON:0035017", "name": "nociceptor" }, "lumbar dorsal root ganglia": { "id": "UBERON:0002836", "name": "lumbar dorsal root ganglion" }, "central and peripheral nervous systems": { "id": "UBERON:0000010", "name": "peripheral nervous system" }, "endocrine organs": { "id": "UBERON:0002368", "name": "endocrine gland" }, "pancreas": { "id": "UBERON:0001264", "name": "pancreas" } }, "Biological Entity (biolink:None)": { "Genes": { "id": "UMLS:C0017337", "name": "Genes" }, "Rostral-caudal lesion length": { "id": "GO:0032525", "name": "somite rostral/caudal axis specification" }, "Splice variants": { "id": "UMLS:C1720834", "name": "Splice Variants, Protein" } }, "anatomical structure (biolink:AnatomicalEntity)": { "Anterior cingulate cortex": { "id": "UMLS:C5700070", "name": "Anterior Cingulate Cortex" } }, "condition (biolink:PhenotypicFeature)": { "Tibia fracture": { "id": "HP:0041143", "name": "Fractured tibia" } }, "RNA (biolink:None)": { "Neuronal mRNAs": { "id": "UMLS:C0521390", "name": "neuronal" }, "NIS-lncRNA": { "id": "NCBIGene:102637887", "name": "Gm34583" } }, "organ (biolink:AnatomicalEntity)": { "Bone": { "id": "UBERON:0002481", "name": "bone tissue" }, "DRG tissues": { "id": "UMLS:C1449674", "name": "Adventitial Tissue" } }, "phenotype (biolink:PhenotypicFeature)": { "Neuropathic phenotype": { "id": "NCIT:C96210", "name": "Neuropathic Pain" } }, "Cellular component (biolink:None)": { "Endosomal membranes": { "id": "UMLS:C1406225", "name": "membranes; retention" } }, "Cell structure (biolink:None)": { "Germinal center": { "id": "UBERON:0010754", "name": "germinal center" } }, "cell line (biolink:None)": { "Neuro2A cells": { "id": "UMLS:C0439378", "name": "cells/uL" } }, "Phenomenon (biolink:None)": { "pain behaviors": { "id": "HP:0012531", "name": "Pain" } }, "peptide (biolink:None)": { "CARTp": { "id": "NCBIGene:100170597", "name": "cartpt" } }, "receptor (biolink:None)": { "GPR160": { "id": "NCBIGene:26996", "name": "GPR160" } }, "Cell component (biolink:None)": { "Mitochondria": { "id": "MESH:D008928", "name": "Mitochondria" } }, "Gene/Hormone (biolink:None)": { "Cyp2f2, Krt18, Ptgds, Prl, Gh, Pomc": { "id": "NCBIGene:13107", "name": "Cyp2f2" } }, "Hormone (biolink:None)": { "GH": { "id": "NCBIGene:14599", "name": "Gh" } }, "Protein/Organism (biolink:None)": { "TRPV1+ and CGRP+ TG neurons": { "id": "GTOPDB:681", "name": "α-CGRP" } }, "Cell line (biolink:None)": { "HSC-3": { "id": "NCBITaxon:419666", "name": "Meloidogyne sp. HSC" } }, "biological molecule (biolink:None)": { "Spinal cord Il10 mRNA": { "id": "UMLS:C0598939", "name": "Spinal Cord Regeneration" }, "mRNA": { "id": "UniProtKB:O45146", "name": "O45146_CAEEL Embryonic mRna (mRNA) Anterior (trembl)" } }, "organelle (biolink:None)": { "Mitochondria": { "id": "MESH:D008928", "name": "Mitochondria" } }, "biological condition (biolink:None)": { "Childhood trauma": { "id": "UMLS:C5544356", "name": "Childhood Trauma" } }, "activity (biolink:Activity)": { "voluntary wheel running": { "id": "UMLS:C0376348", "name": "Voluntary Admission" } }, "Disease symptom (biolink:DiseaseOrPhenotypicFeature)": { "Pain": { "id": "EFO:0003843", "name": "pain" }, "Vaso-occlusive crises (VOC)": { "id": "UMLS:C0750151", "name": "Vaso-Occlusive Crisis" } }, "Not a biological entity (biolink:None)": { "Sex risk behaviors": { "id": "UMLS:C4737261", "name": "sex risk assessment" } }, "behavior (biolink:Behavior)": { "Opioid Use": { "id": "UMLS:C0563700", "name": "Use of language" }, "Injection drug use (IDU)": { "id": "UMLS:C5424598", "name": "Injection drug use" }, "Heroin seeking": { "id": "UMLS:C2372068", "name": "Seeking advice or assistance from caregivers or professionals" }, "sexual risk behavior": { "id": "UMLS:C1261242", "name": "High risk sexual behavior" }, "problem substance use": { "id": "UMLS:C0946429", "name": "Substance use behavior" } }, "other (biolink:None)": { "Electronic Health Record Data": { "id": "UMLS:C5691440", "name": "Electronic Health Record Data" }, "online personal ads": { "id": "UMLS:C4505477", "name": "Online Learning" } }, "Sex (biolink:None)": { "Male": { "id": "NCBIGene:914317", "name": "malE" } }, "biological measurement (biolink:None)": { "viral load": { "id": "EFO:0010125", "name": "viral load" } }, "Program (biolink:None)": { "Syringe Services Program (SSP)": { "id": "UMLS:C0242883", "name": "Needle-Exchange Programs" } }, "Method (biolink:None)": { "Timeline Follow-back (TLFB)": { "id": "UMLS:C4049978", "name": "Timeline Follow-back Protocol" }, "Oral fluid testing (OFT)": { "id": "UMLS:C2711133", "name": "Oral fluid specimen" }, "e-Delphi consensus study": { "id": "UMLS:C0086109", "name": "Delphi Studies" }, "Core outcomes set (COS)": { "id": "UMLS:C5569287", "name": "Perioperative nursing data set outcomes panel" }, "Evidence-based practices (EBPs)": { "id": "UMLS:C4042944", "name": "Evidence-Based Facility Design" } }, "method (biolink:None)": { "economic evaluations": { "id": "UMLS:C0013557", "name": "Economic" } }, "Medical Field (biolink:None)": { "Behavioral health care": { "id": "UMLS:C0815183", "name": "behavioral health care" } }, "Biological pathway (biolink:Pathway)": { "Opioid signaling": { "id": "GO:0038003", "name": "G protein-coupled opioid receptor signaling pathway" }, "G-protein activation": { "id": "REACT:R-CEL-1296041", "name": "Activation of G protein gated Potassium channels (Caenorhabditis elegans)" }, "Serotonin receptors": { "id": "REACT:R-BTA-390666", "name": "Serotonin receptors (Bos taurus)" }, "GPCR signaling": { "id": "REACT:R-XTR-372790", "name": "Signaling by GPCR (Xenopus tropicalis)" } }, "Protocol (biolink:None)": { "National Institute on Drug Abuse Clinical Trials Network protocol": { "id": "UMLS:C1513899", "name": "National Institute of Drug Abuse" }, "National Drug Abuse Treatment Clinical Trials Network (CTN) Core Outcome Set for OUD (COS-OUD)": { "id": "UMLS:C5425793", "name": "PANEL.SURVEY.NIDA" } }, "Substance (biolink:None)": { "Tobacco": { "id": "MESH:D062789", "name": "Tobacco Products" }, "Alcohol": { "id": "CHEBI:30879", "name": "alcohol" }, "Prescription medication": { "id": "UMLS:C1827189", "name": "Medication prescription surveillance" }, "Other Substance use (TAPS)": { "id": "UMLS:C1948181", "name": "Substance use - other" } }, "study (biolink:None)": { "RDD": { "id": "NCBIGene:398486", "name": "rdd4.L" } }, "Study (biolink:None)": { "Rural Expansion of Medication Treatment for Opioid Use Disorder (Rural MOUD; CTN-0102)": { "id": "UMLS:C0240919", "name": "Rural" }, "HEALing Communities Study (HCS)": { "id": "UMLS:C0086944", "name": "Rural Communities" }, "Helping to End Addiction Long-termSM (HEALing) Communities Study (HCS)": { "id": "UMLS:C2983670", "name": "Study End Date" }, "HEALing Communities Study": { "id": "UMLS:C0086944", "name": "Rural Communities" } }, "Measure (biolink:None)": { "Quality-adjusted life-years (QALYs)": { "id": "UMLS:C0080071", "name": "Quality-Adjusted Life Years" }, "Quality-adjusted life-year": { "id": "UMLS:C0080071", "name": "Quality-Adjusted Life Years" } }, "measurement (biolink:None)": { "HCV viral load": { "id": "UMLS:C1868902", "name": "HCV viral load" }, "HIV-1 viral load": { "id": "UMLS:C1168369", "name": "HIV viral load" }, "Sustained virologic response (SVR)": { "id": "NCIT:C120598", "name": "Sustained Virologic Response" } }, "system (biolink:None)": { "Clinical decision support systems": { "id": "UMLS:C4042765", "name": "Clinical Decision Support" } }, "Social factor (biolink:None)": { "Boarding school attendance": { "id": "UMLS:C0424935", "name": "Boarding school" }, "Discrimination": { "id": "UMLS:C2987623", "name": "Discrimination" }, "Historical loss": { "id": "UMLS:C0019659", "name": "Historical Aspects" } }, "Project (biolink:None)": { "Project ED Health": { "id": "UMLS:C0596668", "name": "health service demonstration project" } }, "Biological system (biolink:None)": { "Reward network": { "id": "UMLS:C0035397", "name": "Rewards" }, "Mesocortical circuits": { "id": "UMLS:C2326470", "name": "mesocortex" }, "Mesolimbic circuits": { "id": "UMLS:C0815276", "name": "mesolimbic dopamine system" }, "Descending Pain Modulation System": { "id": "UMLS:C2110482", "name": "knee pain increased by descending stairs" }, "Dopaminergic Reward System": { "id": "UMLS:C0035397", "name": "Rewards" }, "Facial Action Coding System (FACS)": { "id": "UMLS:C0805703", "name": "Coding system used" } }, "Vaccine (biolink:None)": { "Oxy(Gly)4-sKLH": { "id": "PUBCHEM.COMPOUND:10622126", "name": "1-[4-[(Boc-Gly-Gly-Gly-)Oxy]phenyl]guanidine" } }, "Biological region (biolink:None)": { "PAG": { "id": "NCBIGene:100034171", "name": "PAG" }, "VTA": { "id": "FB:FBgn0020772", "name": "vta" } }, "Biological Pathway (biolink:Pathway)": { "Thalamocortical": { "id": null, "name": null }, "Left thalamo-motor pathway": { "id": "GO:0003154", "name": "BMP signaling pathway involved in determination of left/right symmetry" }, "Bilateral thalamo-motor/somatosensory pathways": { "id": "REACT:R-HSA-9824443", "name": "Parasitic Infection Pathways (Homo sapiens)" }, "Right thalamo-somatosensory pathway": { "id": "GO:0003154", "name": "BMP signaling pathway involved in determination of left/right symmetry" } }, "Cell Line (biolink:None)": { "HEK cells": { "id": "ZFIN:ZDB-GENE-070117-2119", "name": "hek" } }, "Biological product (biolink:None)": { "Vaccines": { "id": "MESH:D014612", "name": "Vaccines" }, "F1-CRM": { "id": "UMLS:C0719068", "name": "CRM chromium picolinate" } }, "symptom (biolink:PhenotypicFeature)": { "Relapse": { "id": "NCIT:C168418", "name": "Relapse Following Intervention for Kawasaki Disease" }, "Opioid overdose mortality": { "id": "EFO:0010140", "name": "opioid overdose severity measurement" } }, "protein structure (biolink:None)": { "4DKL MOR crystal structures": { "id": "UMLS:C1410320", "name": "structures in vitreous; vestige" }, "6DDF MOR crystal structures": { "id": "UMLS:C1410320", "name": "structures in vitreous; vestige" } }, "research study (biolink:None)": { "HEALing (Helping to End Addiction Long-termSM) Communities Study (HCS)": { "id": "UMLS:C2983670", "name": "Study End Date" } }, "medical intervention (biolink:None)": { "Communities That HEAL (CTH) intervention": { "id": "UMLS:C0086944", "name": "Rural Communities" } }, "medical practice (biolink:None)": { "Evidence-based practices (EBPs)": { "id": "UMLS:C4042944", "name": "Evidence-Based Facility Design" } }, "model/framework (biolink:None)": { "RE-AIM/PRISM framework": { "id": "FB:FBgn0024254", "name": "aim" } }, "concept (biolink:None)": { "CTH implementation context": { "id": "UMLS:C0003100", "name": "Annual Implementation Plans" }, "Implementation fidelity": { "id": "UMLS:C1708476", "name": "Implementation" }, "stigma": { "id": "GO:0048480", "name": "stigma development" }, "discrimination": { "id": "UMLS:C2987623", "name": "Discrimination" }, "policy attitudes": { "id": "UMLS:C0242456", "name": "Policy" }, "familiarity with OUD": { "id": "UMLS:C0600269", "name": "Familiarity" }, "criminal justice involvement": { "id": "UMLS:C0086072", "name": "Criminal Justice" }, "respondent demographic characteristics": { "id": "UMLS:C0683970", "name": "Demographic Characteristics" } }, "Approach (biolink:None)": { "Opioid-overdose Reduction Continuum of Care Approach": { "id": "UMLS:C0009853", "name": "Continuity of Patient Care" } }, "Research Study (biolink:None)": { "HEALing Communities Study (HCS)": { "id": "UMLS:C0086944", "name": "Rural Communities" } }, "Medical Procedure (biolink:None)": { "Communities That HEAL (CTH) intervention": { "id": "UMLS:C0086944", "name": "Rural Communities" } }, "intervention (biolink:None)": { "Communities that Heal (CTH) intervention": { "id": "UMLS:C0086944", "name": "Rural Communities" } }, "Biological (biolink:None)": { "lower birth weight": { "id": "UMLS:C1398622", "name": "weight; 1000-2499 grams at birth" }, "Perinatal opioid exposure": { "id": "UMLS:C3506545", "name": "exposure to tobacco smoke in perinatal period" }, "Neurocognitive outcomes": { "id": "UMLS:C0518895", "name": "Neurocognitive" }, "Mental health outcomes": { "id": "UMLS:C0025353", "name": "mental health" }, "Behavioral outcomes": { "id": "UMLS:C0086750", "name": "Outcomes Research" }, "Developmental outcomes": { "id": "UMLS:C2015883", "name": "outcomes general productivity developmental" } }, "Test (biolink:None)": { "Bayley Scales of Infant Development-III (BSID-III) Cognitive": { "id": "UMLS:C0451021", "name": "Bayley scale of infant development" }, "Bayley Scales of Infant Development-III (BSID-III) Language": { "id": "UMLS:C0451021", "name": "Bayley scale of infant development" }, "Bayley Scales of Infant Development-III (BSID-III) Motor": { "id": "UMLS:C0451021", "name": "Bayley scale of infant development" } }, "Anatomical Entity (biolink:None)": { "Frontoocccipital index": { "id": "UMLS:C0021194", "name": "Index Medicus" } }, "Event (biolink:None)": { "Hospitalizations": { "id": "UMLS:C4264056", "name": "Hospitalizations+Outpatient visits" }, "Mortality": { "id": "EFO:0004352", "name": "mortality" }, "Physical victimization in adolescence": { "id": "UMLS:C0376695", "name": "Victimization" } }, "Organism (Human, Juvenile) (biolink:None)": { "Juvenile justice (JJ)": { "id": "UMLS:C1510553", "name": "Juvenile Justice" } }, "sequence variants (biolink:None)": { "HCV RNA-positive specimens": { "id": "NCIT:C129452", "name": "Hepatitis C Virus Positive" } }, "Model (biolink:None)": { "NIATx model": { "id": "UMLS:C3274659", "name": "Model Number" }, "Extension for Community Healthcare Outcomes (ECHO) model": { "id": "UMLS:C5575284", "name": "Extension for Community Healthcare Outcomes" } }, "Research Project (biolink:None)": { "Juvenile Justice-Translational Research on Interventions for Adolescents in the Legal System": { "id": "UMLS:C1510553", "name": "Juvenile Justice" } }, "Psychological Concept (biolink:None)": { "Psychological flexibility": { "id": "UMLS:C2945658", "name": "flexibility exercises" }, "Self-efficacy": { "id": "UMLS:C3533164", "name": "Self-efficacy score" }, "Self-stigma": { "id": "NCBITaxon:117547", "name": "Diatrype stigma" } }, "Organism with Disease (biolink:None)": { "Latinos with Substance Use Disorders (SUDs)": { "id": "UMLS:C0038586", "name": "Substance Use Disorders" } }, "Organism (group) (biolink:None)": { "Juvenile justice (JJ)": { "id": "UMLS:C1510553", "name": "Juvenile Justice" }, "Behavioral health (BH)": { "id": "UMLS:C0815183", "name": "behavioral health care" } }, "technology (biolink:None)": { "Wearable sensors": { "id": "UMLS:C4505348", "name": "Wearable Electronic Devices" } }, "Digital tool (biolink:None)": { "Realize Analyze Engage (RAE)": { "id": "MESH:C470748", "name": "engage 8200" } }, "Gene expression (biolink:None)": { "p38 expression": { "id": "NCBIGene:16479688", "name": "p38" } }, "Protein level (biolink:None)": { "P-Smad 1/5 level": { "id": "UMLS:C0456951", "name": "Level 5" } }, "biological model (biolink:None)": { "iPSC-derived brain organoid models": { "id": "UMLS:C4764367", "name": "iPSC-derived Natural Killer Cells FT500" } }, "Trial (biolink:None)": { "BackInAction": { "id": null, "name": null } }, "Material (biolink:None)": { "Healing After Surgery guide": { "id": "UMLS:C3846202", "name": "Rad After Surgery" } }, "policy (biolink:None)": { "Punitive state policies": { "id": "UMLS:C4062003", "name": "Punitive" }, "Reporting state policies": { "id": "UMLS:C4019203", "name": "Reporting state" }, "state parity laws": { "id": "UMLS:C0030563", "name": "Parity" } }, "treatment (biolink:Procedure)": { "substance use disorder treatments": { "id": "UMLS:C5441491", "name": "Substance Use Disorder Treatment" } }, "Biological data type (biolink:None)": { "Electronic medical records": { "id": "UMLS:C2362543", "name": "Electronic Health Records" } }, "Biological Sample (biolink:None)": { "Urine": { "id": "UBERON:0001088", "name": "urine" }, "Hair": { "id": "UMLS:C0018503", "name": "Hair Preparations" }, "Blood": { "id": "UBERON:0000178", "name": "blood" } }, "organism characteristic (biolink:None)": { "sexual/gender identity": { "id": "UMLS:C0017249", "name": "Gender Identity" }, "race/ethnicity": { "id": "UMLS:C5450304", "name": "CDC Race and Ethnicity" }, "socioeconomic status": { "id": "UMLS:C0748878", "name": "socioeconomic" }, "sex assigned at birth": { "id": "UMLS:C4019317", "name": "Sex assigned at birth" } }, "Statistic (biolink:None)": { "Employment rate": { "id": "UMLS:C0014003", "name": "Employment" } }, "Biological Molecule (biolink:None)": { "Polygenic Risk Scores (PRS)": { "id": "UMLS:C5204126", "name": "Low Neoplasm Polygenic Risk Score" }, "DNA": { "id": "GO:1990814", "name": "DNA/DNA annealing activity" } }, "Social Environment Variable (biolink:None)": { "perceived disorganization": { "id": "UMLS:C3887467", "name": "Perceived constipation (disorder)" }, "objective neighborhood SES": { "id": "UMLS:C0155534", "name": "Tinnitus, Objective" }, "perceived social cohesion": { "id": "UMLS:C5392952", "name": "Perceived Social Support" } }, "Treatment Stage (biolink:None)": { "Treatment Preparation": { "id": "UMLS:C0729623", "name": "Preparation of radiation therapy aid" }, "Treatment Initiation": { "id": "UMLS:C2065087", "name": "initiation of mechanical ventilation" }, "Treatment Stabilization": { "id": "UMLS:C2019751", "name": "stabilization exercises for lumbar region" }, "OUD Recovery": { "id": "UMLS:C0237820", "name": "Recovery - action" } }, "Treatment Method (biolink:None)": { "Methadone maintenance treatment (MMT)": { "id": "UMLS:C0746569", "name": "methadone treatment" } }, "Genetic Trait (biolink:None)": { "Sleep-related GWAS traits": { "id": "UMLS:C2732337", "name": "Sleep hypoventilation" }, "Sleep duration": { "id": "EFO:0005271", "name": "sleep duration" } }, "Drug class (biolink:Drug)": { "Anticonvulsants": { "id": "UMLS:C0003286", "name": "Anticonvulsants" }, "Antidepressants": { "id": "UMLS:C1579362", "name": "ANTIDEPRESSANTS,OTHER" }, "Oral opioids": { "id": "UMLS:C3653647", "name": "Opioids in combination with antispasmodics" } }, "Device (biolink:Device)": { "Spinal cord stimulators (SCS)": { "id": "UMLS:C0810635", "name": "Stimulators, Electrical, Spinal Cord" }, "Implantable pulse generator (IPG)": { "id": "UMLS:C2048365", "name": "implantable cardioverter-defibrillator pulse generator" }, "Ultrasound Transducer Devices": { "id": "UMLS:C4052519", "name": "Ultrasound Transducer Disinfectors" }, "High-resolution (HR)-SCS lead": { "id": "UMLS:C0687333", "name": "High-Resolution Electrocardiographs" }, "Activa PC+S": { "id": "UMLS:C4309969", "name": "ACTIVA BioACTIVE-RESTORATIVE" }, "Summit RC+S": { "id": "UMLS:C0611983", "name": "RC-2B" } } }